1 2000-11-14 Rob Lahaye <lahaye@postech.edu>
3 * default.ui: capitalized some menu items to improve shortcuts.
5 2000-11-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7 * src/frontends/xforms/FormPreferences.C (ok): use AddName().
9 * src/frontends/xforms/Dialogs.C: add "using" directive.
11 2000-11-13 Angus Leeming <a.leeming@ic.ac.uk>
13 * src/filedlg.C (Select): highlight suggested file in browser, if
16 * src/frontends/xforms/FormPreferences.[Ch]: re-written so that
17 each tab folder is encapsulated in its own class.
18 The Language keymaps are now chosen using a text input and a
19 browser button, rather than a Combox.
20 All the browser buttons are now functional, although LyXFileDlg
21 still needs to be modified to make it straighhtforward to return a
22 directory if that is what is desired.
24 * src/frontends/xforms/forms/form_preferences.fd: use text input
25 and browse button to input the Language keymaps. Add a few
26 callbacks for the browse buttons.
28 2000-11-14 Lars Gullik Bjønnes <larsbj@lyx.org>
30 * src/support/tempname.C (tempName): small changes to make it
31 safer. remove the '.' before XXXXXX
33 * src/support/filetools.C (TmpFileName): remove func
36 * src/frontends/xforms/FormRef.C (FormRef): explicit call the bp
37 * src/frontends/xforms/FormUrl.C (FormUrl): ditto
38 * src/frontends/xforms/FormTabularCreate.C (FormTabularCreate): ditto
39 * src/frontends/xforms/FormTabular.C (FormTabular): ditto
41 * src/frontends/xforms/FormInset.h (FormInset): remove default for bp
44 * src/frontends/xforms/FormGraphics.C (FormGraphics): explicit
47 * src/frontends/xforms/FormError.C (FormError): use IgnorantPolicy
48 for bp (this fixes a reproducible hard crash)
50 * src/frontends/xforms/FormCopyright.C (FormCopyright): explicit
53 * src/frontends/xforms/FormBase.h: make bp_ private
54 (FormBaseBI): remove default for bp
57 * src/frontends/xforms/Dialogs.C (Dialogs): use the old method it
60 * src/frontends/xforms/Color.C (RGBColor): made several vars
61 const, changed initialization of j to allow it to be const
64 * several files: added const to local variables.
66 * src/lyx_cb.C: removed several function prototypes and moved them
70 (UpdateLayoutPreamble):
72 (MenuInsertLabel): add BufferView as arguemnt
73 (LayoutsCB): make tmp const
75 * src/layout_forms.h: regenerated
77 * src/debug.C: add Debug::FILES
78 (showLevel) (showTags): translate the desc
80 * src/debug.h: add FILES as debug target
82 * src/bufferlist.C: use current_view as an interim measure becuase
83 of added arguments to MenuWrite and MenuWriteAs
85 * forms/layout_forms.h.patch: make the patch more correct and more appalyable
87 * config/lyxinclude.m4 (LYX_STD_COUNT): change test to not involve
89 (LYX_PROG_CXX): change 2.97 rules to include the -f.. that
90 libstdc++ is compiled with.
92 2000-11-13 José Abílio Matos <jamatos@fep.up.pt>
94 * lib/layouts/docbook-book.layout
95 * lib/layouts/docbook.layout
96 * lib/layouts/linuxdoc.layout: No need for "dummy" paragraphs, now
97 those paragraphs are expresse as SGML comments <!-- -->.
100 * src/LaTeXFeatures.C (getIncludedFiles): takes a filename as
101 parameter, this allows to express all the include files as relative
102 paths to the master buffer. The verbatim insert works as the other
105 * src/buffer.C (sgmlOpenTag) (sgmlCloseTag): don't write if latexname
107 (MakeLinuxdocFile) (MakeDocBookFile): included files are relative
109 (MakeDocBookFile): top_element is always written. Some clean up, as
110 sgmlOpenTag() and sgmlCloseTag() take care of the SGML comment case.
112 * src/insets/insetinclude.C (Linuxdoc): Added verbatim file fix.
113 (DocBook) added close tag to inlinegraphics trick for verbatim. Now
114 a reference is written instead of the name.
115 (Validate): use the relative path for the filename.
117 * src/insets/insetlabel.C (DocBook): write end tag, for XML
120 * src/support/filetools.h
121 * src/support/filetools.C (IsSGMLFilename): added.
124 2000-11-13 Miyata Shigeru <miyata@kusm.kyoto-u.ac.jp>
126 * development/OS2/quick_fix.patch:
128 * README.OS2: quick update to the OS/2 port.
130 2000-11-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
132 * src/converter.C: add "using" directive.
134 * src/frontends/xforms/FormPreferences.C: add "using" directive.
135 (compare_converter): add "int" as return type.
137 * src/frontends/xforms/Color.C: comment out FL_LIGHTER_COL1 here
140 2000-11-11 Angus Leeming <a.leeming@ic.ac.uk>
142 * src/lyx_gui.C (create_forms): map the xform colours, should a
143 mapping exist. Ie, call XformColor::read().
145 * src/frontends/xforms/Color.[Ch] renamed struct RGB as RGBColor
146 and struct HSV as HSVColor.
147 (XformColor::read, XformColor::write) : new methods that
148 input/output any changes to the cform GUI colors.
150 * src/frontends/xforms/Dialogs.C: FORMS_H_LOCATION no longer
153 * src/frontends/xforms/FormPreferences.C Lots of little changes
154 associated with the changed name of the RGB and HSV structs. Can
155 now save changes to xforms GUI to file. Commented out
156 FL_LIGHTER_COL1 to allow compilation with xforms 0.88. It isn't
157 used currently anyway.
159 2000-11-11 Dekel Tsur <dekelts@tau.ac.il>
161 * src/converter.C: A lot of changes:
162 - It is no longer possible to choose between two or more ways to
163 export to some format (the new code uses only the shortest path).
164 However, it is still possible to choose between pdflatex/ps2pdf
165 for creating a PDF file, by defining two PDF formats: pdf & pdf2.
166 - Added several methods that makes the FormPreferences code simpler.
167 - Changed the tokens $$FName and $$OutName to $$i and $$o.
169 * src/exporter.C (Export): lyxrc.use_pdf is set before
170 makeLaTeXFile is called. This works but not very nice.
172 * src/frontends/xforms/FormPreferences.C: The formats/converters
173 tabs are now fully functional.
175 * src/buffer.C (getTocList): Add numbers to the captions.
177 * lib/lyxrc.example: Removed fax section
179 * src/support/rename.C (rename): Delete the old file if lyx::copy
182 2000-11-13 Rob Lahaye <lahaye@postech.edu>
184 * lib/ui/default.ui: minor polishing.
186 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
188 * src/frontends/xforms/Color.C: include <algorithm> and <cmath>
191 * lib/Makefile.am (DOCINST): do not install everything in the
192 documentation directory.
194 2000-11-10 John Levon <moz@compsoc.man.ac.uk>
196 * src/bufferlist.C (newFile): set the filename to the constructed
199 * src/lyx_cb.C (MenuWriteAs): if a buffer is "unnamed", pass the
200 constructed "newfileXX.lyx" name to the dialog
202 * src/frontends/DialogBase.h: make update() non-abstract so
203 KDE doesn't need to implement two update methods for every form
205 * src/frontends/kde/Makefile.am: add missing xforms objects
208 * src/frontends/kde/Dialogs.C: Add FormTabularCreate dialog
210 2000-11-09 Angus Leeming <a.leeming@ic.ac.uk>
212 * src/frontends/xforms/Color.[Ch]: new files, defining the color
213 structs RGB and HSV. May not be the best place for these files.
214 Perhaps move them into src ?
216 * src/frontends/xforms/Makefile.am: added new files.
218 * src/frontends/xforms/forms/form_preferences.fd:
219 * src/frontends/xforms/FormPreferences.[Ch]: bowed to reality and
220 replaced all instances of "colour" with "color"!
222 * src/frontends/xforms/forms/form_preferences.fd: modified Colors tab
225 * src/frontends/xforms/FormPreferences.[Ch]: functioning Colors
226 tab. Can now alter the colors of the xform's GUI on the fly. With
227 the aid of a single static Signal (see below), can "Apply" these
228 changes to all currently open dialogs. (Well, to all of the NEW
229 dialogs and to LyXView. The OLD dialogs are not yet redrawn.) ALL
230 subsequently opened dialogs will, of course, also have the new
231 color scheme. Cannot yet save (or load) the choices to file, so
232 they are lost when exiting LyX.
234 * src/frontends/Dialogs.h:
235 * src/frontends/xforms/Dialogs.C (redrawGUI): new static Signal.
236 Used to trigger a redraw of any dialogs connected to it because,
237 for example, the GUI colours have been re-mapped.
239 * src/frontends/xforms/FormBase.[Ch]:
240 * src/frontends/xforms/FormDocument.[Ch]:
241 * src/frontends/xforms/FormParagraph.[Ch]:
242 * src/frontends/xforms/FormPreferences.[Ch]:
243 * src/frontends/xforms/FormTabular.[Ch]: (redraw): new virtual
244 method, to be connected to Dialogs::redrawGUI. Method must be
245 virtual, because dialogs with tabbed folders need to redraw the
246 forms of each tab folder.
248 * src/LyXView.C (d-tor):
249 * src/frontends/xforms/FormBase.C (d-tor): connected
250 Dialogs::redrawGUI signal to redraw().
252 * src/frontends/xforms/FormBase.C (~FormBaseBI, ~FormBaseBD):
253 removed Assert, because it is identical to that in FormBase.
255 2000-11-10 Rob Lahaye <lahaye@postech.edu>
257 * lib/ui/default.ui: minor polishing.
259 2000-11-10 Juergen Vigna <jug@sad.it>
261 * src/insets/insettext.C (resizeLyXText): check !cache[bv]
262 (deleteLyXText): ditto
264 * src/insets/insettabular.C (InsetButtonPress): don't clear the
265 selection on mouse-button-3.
267 * src/insets/insettabular.h: new function clearSelection(), use this
268 functions inside insettabular.C.
270 * src/insets/insettabular.C (TabularFeatures): clear the selection
271 on remove_row/column.
273 * src/insets/inset.C (scroll): fixed some scroll stuff.
275 * src/insets/insettabular.C (draw): fixed another minor draw problem.
277 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
279 * lib/CREDITS: add Yves Bastide
281 2000-11-03 Yves Bastide <stid@libd-pc11.univ-bpclermont.fr>
283 * config/lyxinclude.m4 (LYX_CXX_GLOBAL_CSTD): new function to
284 check whether C library functions are in the global namespace.
286 * configure.in: calls it.
288 * src/support/lstrings.C: #ifndef CXX_GLOBAL_CSTD instead of
291 2000-11-08 Dekel Tsur <dekelts@tau.ac.il>
293 * src/frontends/xforms/FormPreferences.C (updateLanguage): Check
294 iterators to prevent crash.
296 2000-11-08 Angus Leeming <a.leeming@ic.ac.uk>
298 * src/converter.h (getprettyname, getFromToPrettyname): new methods.
300 * src/frontends/xforms/xform_macros.h (C_PREPOSTHANDLER): new macro
301 shortcut for xforms CB to the preemptive or post-handler function.
303 * src/frontends/xforms/forms/form_preferences.fd (form_preferences):
304 removed the HIDDEN_TIMER as it's no longer used.
305 Various other small changes.
307 * src/frontends/xforms/FormPreferences.[Ch]: removed timer. Use a
308 preemptive handler to obtain feedback, rather than the post-handler.
309 (ColoursLoadBrowser): find "black" and "white" based on RGB values
311 Formats tab is now complete. Converters tab is nearly so.
313 2000-11-09 Juergen Vigna <jug@sad.it>
315 * src/insets/insettext.C (~InsetText):
318 (SetParagraphData): set cache.second to 0 after deleting it!
319 (getLyXText): check if cache.second is not 0 if finding it.
321 2000-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
323 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): use
324 lyxlex to parse the rgb.txt file.
327 * src/lyxlex_pimpl.[Ch]: implement setCommentChar method, to
328 replace the default '#' comment character.
330 * src/support/tempname.C: add "using" directive
331 * src/frontends/ButtonPolicies.C: ditto.
333 * src/support/filetools.C (DirList): add an explicit cast to avoid
334 a compile error (probably not the right fix)
336 2000-11-08 Lars Gullik Bjønnes <larsbj@lyx.org>
338 * src/support/filetools.C (DirList): implement using system functions
340 * src/support/tempname.C: new file
342 * src/support/Makefile.am (libsupport_la_SOURCES): add tempname.C
344 * src/insets/insetexternal.C (InsetExternal): use lyx::tempName
346 * src/graphics/GraphicsCacheItem_pimpl.C (renderXPM): use
349 * src/frontends/xforms/ButtonController.C: new file
351 * src/os2_defines.h: remove getcwd define
353 * src/lyxvc.C: include support/lyxlib.h
354 (showLog): use lyx::tempName
356 * src/lyx_cb.C: comment out includes that we don't need
357 (AutoSave): use lyx::tempName
359 * src/filedlg.C: include support/lyxlib.h
360 (Reread): use lyx::getcwd
362 * src/converter.C: include support/filetools.h
363 (add_options): change to static inline, make tail const
364 (Add): make old_viewer const
365 (GetAllFormats): make it a const method, use const_iterator
366 (enable): make static inline
367 (SplitFormat): make using_format const
369 * src/LaTeX.C (run): use lyx::getcwd
371 * configure.in: check for mkstemp as well
373 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
375 * src/converter.[Ch] (GetAllCommands): new method.
377 * src/support/filetools.[Ch] (DirList): new method.
379 * src/frontends/xforms/FormPreferences.C: started (just!) adding
380 functionality to the converters tab.
381 The formats tab is now nearly complete.
382 The kbmap choices in Languages tab now display the contents of
383 system_lyxdir/kbd/*.kmap in readable form.
385 * src/frontends/xforms/FormPreferences.h: made struct RGB private.
386 Moved some variables into the class.
388 * src/frontends/xforms/forms/form_preferences.fd: Revert colour of
389 inactive tab folder to FL_COL1. Haven't yet worked out how to change
390 colour of active folder to lighter grey instead. Any takers?
391 (form_colours): added an "Apply" button.
392 (form_converters): added a "Flags" input field.
393 (form_formats): added a "Shortcut" input field. Note that we can't use
394 names such as "input_shortcut" as this buggers up the sed script stuff.
396 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
404 * src/lyx_sendfax_main.C:
407 * src/spellchecker.C:
408 * src/insets/figinset.C:
409 * src/insets/insetbib.C:
410 * src/insets/insetexternal.C:
411 * src/insets/insetinclude.C:
412 * src/insets/insetinfo.C:
413 * src/mathed/math_panel.C:
414 use FL_PLACE_MOUSE | FL_FREE_SIZE, FL_TRANSIENT in fl_show_form(), so
415 all "daughter" dialogs now have identical "feel".
417 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
419 * src/lyx_gui_misc.[Ch] (IgnoreCloseBoxCB): removed as it's no longer
420 used (and was only used in one place prior to this patch. Incorrectly!)
422 * src/frontends/xforms/FormDocument.C: changed some instances of
423 FL_RETURN_ALWAYS to FL_RETURN_CHANGED as I think that this makes more
424 sense. Also added fl_set_input_return() for class_->input_doc_extra and
425 for options_->input_float_placement. This fixes a bug reported by
428 * src/frontends/xforms/FormGraphics.[Ch] (free): removed. Placed
429 functionality into d-tor.
431 * src/frontends/xforms/input_validators.c (fl_lowercase_filter): allow
432 input of numerals also.
434 * src/insets/insetinclude.C (Edit): use CancelCloseBoxCB in
435 fl_set_form_atclose(). Can now close dialog from window manager,
436 fixing a bug reported by Rob Lahaye.
438 2000-11-06 Angus Leeming <a.leeming@ic.ac.uk>
440 * src/frontends/xforms/forms/form_preferences.fd: Inactive tab folders
441 are no longer dark. Haven't yet worked out how to lighten the colour of
442 the active tabfolder. Any ideas anybody?
443 Adjusted Colours tab a little.
444 Added Shortcut field to converters tab. Note that we can't create an
445 fdesign label like "input_shortcut" as this buggers up the sed-script
448 * src/frontends/xforms/FormPreferences.[Ch]:
449 (feedback): fixed crash due to to ob=0.
450 (LanguagesXXX): the kbmap choices now contain the files
451 sytem_lyxdir/kbd/*.kmap. I think that these choices should eventually
452 be replaced by an input with a file browse button, but since the browse
453 buttons don'y yet work, this'll do for the moment.
454 (FormatsXXX): think that this is now nearly fully functional.
455 Some points/questions though:
456 1. Does "Apply" remove formats if no longer present?
457 2. I think that the browser should list the GUI names rather than the
459 3. Must ensure that we can't delete Formats used by an existing
462 * src/support/filetools.[Ch] (DirList): new function. Not at all sure
463 if this is the best way to do this.
465 2000-11-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
467 * lib/reLyX/acinclude.m4 (RELYX_CHECK_ERRORS): remove useless message.
469 * lib/configure.m4 (latex_to_html_command): avoid spaces around =
470 for variable assignment.
472 2000-11-07 Rob Lahaye <lahaye@postech.edu>
474 * src/lib/ui/default.ui: added sub/superscripts to menu as
475 Insert->Special characters and cleaned-up the file a bit
477 2000-11-07 Allan Rae <rae@lyx.org>
479 * src/frontends/xforms/FormPreferences.C (feedback): make sure
480 ob isn't 0 before using it. See comments in function.
482 * src/frontends/xforms/forms/fdfixc.sed: tiny spacing fix.
484 * src/frontends/xforms/form_*.C: regenerated
486 2000-11-07 Lars Gullik Bjønnes <larsbj@lyx.org>
488 * src/LaTeX.C (deplog): change reg1 to handle (/.../.../fil.sty)
490 * config/lyxinclude.m4 (LYX_PROG_CXX): remove -fno-rtti when
491 compiling with gcc-2.96
493 2000-11-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
495 * src/support/lyxstring.C: add a couple "using" directives.
497 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): add
498 a .c_str() here too for good measure.
499 * src/Spacing.C (set): ditto.
500 * src/lyxfunc.C (Dispatch): ditto.
502 * src/insets/insettabular.C (copySelection): change .str() to
503 .str().c_str() to fix problems with lyxstring.
504 * src/support/filetools.C (GetFileContents): ditto.
505 * src/buffer.C (asciiParagraph): ditto.
506 * src/paragraph.C (String): ditto.
508 * lib/bind/fi_menus.bind: change symbol-insert to math-insert.
509 * lib/bind/sciword.bind: ditto.
511 * src/LyXAction.C (init): remove "symbol-insert" function, which
512 shared LFUN_INSERT_MATH with "math-insert".
514 * lib/configure.m4: == is not a valid operator for command test.
516 * src/lyxrc.C: add using directive.
518 * src/converter.h: add std:: qualifier.
520 2000-11-03 Dekel Tsur <dekelts@tau.ac.il>
522 * src/converter.[Ch] and other files: Change the Format class to a
523 real class, and create two instances: formats and system_format.
525 * src/lyxrc.C (output): Output the difference between formats and
528 * src/frontends/xforms/FormPreferences.C (input): Simplify.
529 (buildFormats): Insert formats into browser.
530 (inputFormats): Made the browser and add button functional.
531 (applyFormats): Update formats from format_vec.
533 * src/converter.C: Changed all (*it). to it->
534 (Format::dummy): New method.
535 (Format::importer): New format flag.
536 (Formats::GetAllFormats): New method.
537 (Formats::Add): Delete format from the map if prettyname is empty.
538 (Converter::Convert): Print an error message if moving the file fails.
539 (Converter::GetReachableTo): New method
541 * src/MenuBackend.[Ch]: Add support for importformats tag.
543 * src/support/rename.C (rename): Call to lyx::copy if ::rename fails.
545 * lib/configure.m4: Add word->tex and ps->fax converters.
547 * lib/ui/default.ui: Use ImportFormats on file->import menu.
548 Return fax to file menu.
552 2000-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
554 * src/frontends/xforms/FormPreferences.h (operator=): move out of RGB
557 * src/frontends/xforms/FormPreferences.C (WriteableFile): simplify
560 * src/lyxfunc.C (processKeyEvent): removed
562 * src/bufferlist.C (emergencyWrite): removed the out commented
563 emergency write code.
565 * src/Makefile.am (lyx_main.o): add dep for commandtags.h
567 * src/LyXView.[Ch]: remove the outcommented raw_callback code
569 * many files: change formatting to be a bit more uniform for
570 if,while,for,switch statements, remove some parantesis not needed.
573 2000-11-03 John Levon <moz@compsoc.man.ac.uk>
575 * config/kde.m4: make config more robust when KDEDIR is set
577 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
579 * src/frontends/xforms/Toolbar_pimpl.C: do not crash if mathed has
580 not returned a pixmap for "math-insert".
582 * src/LyXAction.C (init): sort the entries a bit.
584 2000-11-03 Juergen Vigna <jug@sad.it>
586 * src/insets/insettabular.h: added fixed number to update codes so
587 that update is only in one direction.
589 * src/insets/insettabular.C (UpdateLocal): modified a bit don't think
592 * src/insets/insettext.C (InsetButtonPress): set the_locking_inset
593 before call to edit because of redraw.
595 * src/insets/insetcollapsable.C (draw): fixed clearing too much.
597 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
599 * lib/ui/default.ui: Populate "edit_float" menu
601 * src/lyxfunc.C (Dispatch): implement LFUN_FLOATSOPERATE.
603 * src/LyXAction.C (init): add new entry LFUN_FLOATSOPERATE, name
604 "floats-operate". The name is ugly (and the func also), but this
605 is just a band-aid until we switch to new insets.
607 2000-11-03 Rob Lahaye <lahaye@postech.edu>
609 * lib/ui/default.ui: update again the menu layout (fix some
612 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
614 * src/MenuBackend.h (fulllabel): new method.
616 * src/MenuBackend.C (checkShortcuts): new method. Checks whether
617 the menu shortcuts of a menu are unique and whether they
618 correspond to a letter of the label.
619 (expand): call checkShortcuts when debugging.
621 2000-11-03 Andre Poenitz <poenitz@HTWM.De>
623 * src/insets/insettext.C (InsetButtonPress): shut off warning.
625 2000-11-02 Lior Silberman <lior@Princeton.EDU>
627 * lib/examples/*.lyx : '\language default' => '\language english'
629 * lib/examples/it_splash.lyx : except where it should be italian
631 * lib/templates/*.lyx : the same
633 * doc/*.lyx* : the same
635 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
637 * lib/bind/menus.bind: remove the Layout menu entries, which I
638 somehow forgot earlier.
640 2000-11-03 Rob Lahaye <lahaye@postech.edu>
642 * lib/ui/old-default.ui: keep the old one here for reference (to
645 * lib/ui/default.ui: update the menu layout
647 2000-11-02 Angus Leeming <a.leeming@ic.ac.uk>
649 * src/frontends/xforms/FormCitation.C: made use of ButtonController.
650 Can now Apply to different insets without closing the dialog.
652 * src/frontends/xforms/FormPreferences.C: new Colour and Format tabs.
653 Can't actually DO anything with them yet, but I'd like a little
656 * src/frontends/xforms/input_validators.[ch]
657 (fl_lowercase_filter): new.
659 2000-10-27 Dekel Tsur <dekelts@tau.ac.il>
661 * src/mathed/formulamacro.h (LyxCode) Return MATHMACRO_CODE instead
662 of MATH_CODE. This fixes a bug with math-macros in RTL text.
664 * src/text.C (PrepareToPrint): Show math-macros block aligned.
666 2000-11-02 Juergen Vigna <jug@sad.it>
668 * src/insets/insettext.C (LocalDispatch): return a DISPATCHED_NOUPDATE
669 on char insertion as it has already be updated by bv->updateInset().
671 * src/insets/insettabular.C (UpdateInsetInInset): update the inset
672 if an inset inside was updated.
674 * lib/configure.cmd: commented out fax-search code
676 2000-11-01 Yves Bastide <stid@acm.org>
678 * src/tabular.C (OldFormatRead): set tabular language to the
681 2000-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
683 * lib/reLyX/MakePreamble.pm (translate_preamble): fix reading of
684 class names with non-letter characters (from Yves Bastide).
686 * lib/ui/default.ui: change Item to OptItem in import menu.
687 Comment out fax stuff.
689 * lib/configure.m4: comment out fax-related stuff.
691 2000-10-31 Angus Leeming <a.leeming@ic.ac.uk>
693 * src/frontends/xforms/xform_helpers.[Ch]: new files. Repository for
694 useful xforms helper functions. At present contains only formatted().
695 Input a string and it returns it with line breaks so that in fits
698 * src/frontends/xforms/Makefile.am: add new files.
700 * src/lyxrc.[Ch] (getDescription): new name for getFeedback.
701 * src/lyxrc.C (getDescription): Removed '\n's from strings. Corrected
704 * src/frontends/xforms/FormPreferences.[Ch]:
705 * src/frontends/xforms/forms/form_preferences.fd: No new functionality
706 but lots of little clean ups. Removed enum State. Make use of
707 formatted(). Constify lots of methods. Perhaps best of all: removed
708 requirement for that horrible reinterpret_cast from pointer to long in
711 2000-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
713 * src/lyxlookup.C: include FORMS_H_LOCATION to get at FL_REVISION,
714 conditionalize build on xforms < 0.89
716 * src/lyx_gui.C (LyXGUI): only close lyxlookup if not xforms 0.89
718 * src/lyxfunc.C (getStatus): commenout LFUN_FAX
720 * src/LyXAction.C (init): comment out fax
722 * src/lyxrc.h: comment out the fax enums
723 comment out the fax variables
725 * src/commandtags.h: comment out LFUN_FAX
727 * src/lyxrc.C: disable fax variables.
728 (read): disable parsing of fax variables
729 (output): disable writing of fax variables
730 (getFeedback): now description for fax variables
732 * src/lyxfunc.C: comment out MenuFax
733 (Dispatch): disable LFUN_FAX
735 * src/lyx_cb.C (MenuFax): comment out
737 * src/WorkArea.C: add <cctype>
738 (work_area_handler): better key handling, should be ok now.
739 for accented chars + etc
741 * src/Makefile.am (lyx_SOURCES): remove lyx_sendfax.C
742 lyx_sendfax.h and lyx_sendfax_man.C
744 * src/LyXView.C: don't include lyxlookup.h when using xforms 0.89
745 (show): don't call InitLyXLookup when using xforms 0.89
747 2000-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
749 * src/trans.C (AddDeadkey): better fix, the other one could crash...
751 * src/support/filetools.C (GetFileContents): close to dummy change
753 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
755 * src/trans.C (AddDeadkey): workaround stupid compilers.
757 2000-10-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
759 * src/frontends/xforms/FormDocument.C (class_update): fix setting
760 of two-sided document.
762 2000-10-31 Juergen Vigna <jug@sad.it>
764 * src/WorkArea.C (work_area_handler): honor xforms 0.88 defines.
766 * src/insets/insettabular.C (ActivateCellInset): passed the wrong
767 xposition to the Edit call.
769 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
771 * src/trans.C (AddDeadkey): cast explicitly to char.
773 2000-10-30 Lars Gullik Bjønnes <larsbj@lyx.org>
775 * src/tabular.C (AsciiBottomHLine): simplify?
776 (AsciiTopHLine): simplify?
777 (print_n_chars): simplify
778 (DocBook): remove most of the << endl; we should flush the stream
779 as seldom as possible.
781 (TeXBottomHLine): ditto
784 (write_attribute): try a templified version.
785 (set_row_column_number_info): lesson scope of variables
787 * src/support/lstrings.h (tostr): new specialization of tostr
789 * src/trans.C (AddDeadkey): slightly cleaner fix.
791 2000-10-28 Dekel Tsur <dekelts@tau.ac.il>
793 * src/frontends/xforms/Menubar_pimpl.C (add_toc): Replace '%' by
794 '%%' in Toc menu labels.
797 * src/insets/insetlatexaccent.C (draw): Correct rendering when
798 font_norm is iso10646-1.
800 * src/font.C (ascent): Fixed for 16bit fonts
801 (descent,lbearing,rbearing): ditto
803 2000-10-30 Angus Leeming <a.leeming@ic.ac.uk>
805 * src/lyxrc.C.[Ch]: moved LyXRCTags into public part of header file.
806 (getFeedback): new static method.
808 * src/frontends/xforms/FormPreferences.[Ch]: one or two new inputs.
809 Now use combox rather than choice to display languages.
810 Feedback is now output using a new timer callback mechanism, identical
811 to that in Toolbar_pimpl. Individual messages obtained from lyxrc.
813 2000-10-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
815 * src/minibuffer.C: fix for older compilers
817 2000-10-30 Juergen Vigna <jug@sad.it>
819 * src/insets/insettext.C (InsertInset): fixed this as the cursor
820 has to be Left of the inset otherwise LyXText won't find it!
822 * src/BufferView2.C (open_new_inset): delete the inset if it can
825 2000-10-30 Rob Lahaye <lahaye@postech.edu>
829 2000-10-29 Marko Vendelin <markov@ioc.ee>
830 * src/frontends/gnome/FormCitation.C
831 * src/frontends/gnome/FormCitation.h
832 * src/frontends/gnome/FormCopyright.C
833 * src/frontends/gnome/FormCopyright.h
834 * src/frontends/gnome/FormError.C
835 * src/frontends/gnome/FormError.h
836 * src/frontends/gnome/FormIndex.C
837 * src/frontends/gnome/FormIndex.h
838 * src/frontends/gnome/FormPrint.C
839 * src/frontends/gnome/FormPrint.h
840 * src/frontends/gnome/FormRef.C
841 * src/frontends/gnome/FormRef.h
842 * src/frontends/gnome/FormToc.C
843 * src/frontends/gnome/FormToc.h
844 * src/frontends/gnome/FormUrl.C
845 * src/frontends/gnome/FormUrl.h
846 * src/frontends/gnome/Menubar_pimpl.C
847 * src/frontends/gnome/mainapp.C
848 * src/frontends/gnome/mainapp.h
849 * src/frontends/gnome/pixbutton.h: replacing NULL with 0 and
850 changing update() to updateSlot() where appropriate
852 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
854 * src/frontends/xforms/FormPreferences.[Ch]:
855 * src/frontends/xforms/forms/form_preferences.fd: added a Languagues
858 2000-10-28 Juergen Vigna <jug@sad.it>
860 * src/insets/insettabular.C (draw): fixed drawing bug.
862 * src/insets/insettext.C (clear):
864 (SetParagraphData): clearing the TEXT buffers when deleting the
865 paragraphs used by it.
867 * src/BufferView_pimpl.C (cursorNext): fixed PageDown problem.
869 * src/trans.C (AddDeadkey): fixed bug in inizializing keymap array.
871 2000-10-27 Juergen Vigna <jug@sad.it>
873 * src/tabular.C (~LyXTabular): removed not needed anymore.
875 * src/tabular.h: changed rowofcell and columnofcell to vector<int>
878 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
880 * src/frontends/Dialogs.h: remove hideTabular signal as it is no
883 * src/frontends/xforms/FormRef.[Ch]: fix bug when setting the min
886 * src/frontends/xforms/FormPreferences.[Ch]:
887 * src/frontends/xforms/forms/form_preferences.fd: lots and lots!
888 Reorganised as modules based on tabs. Much easier to follow the
889 flow and to add new tabs. Added warning and feedback messages.
892 2000-10-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
894 * src/tabular.h (DocBook): add std:: qualifier.
896 2000-10-26 José Abílio Matos <jamatos@fep.up.pt>
898 * src/buffer.h (SimpleDocBookOnePar): becomes public and const.
899 * src/buffer.C (SimpleDocBookOnePar): this method goes const.
902 * insettabular.C (DocBook): uses the tabular methods to export
905 * src/insets/insettext.h
906 * src/insets/insettext.C (DocBook): Implemented export for docbooc.
908 2000-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
910 * src/frontends/ButtonPolicies.h (operator<<): reinsert for State
913 * src/lyxfunc.C (MenuNew): lessen the scope of fname
914 moved misplaced AllowInput two lines up.
916 * src/buffer.C (readFile): compare float with float, not with int
918 2000-10-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
920 * src/minibuffer.C: add "using SigC::slot" statement.
922 2000-10-25 Angus Leeming <a.leeming@ic.ac.uk>
924 * src/frontends/xforms/forms/README: updated section about make.
926 * src/frontends/xforms/forms/form_*.fd: lots and lots of shortcuts.
927 Tidied some forms up, made two of form_tabular's tabs more
928 self-consistent, fixed Jean-Marc's size problem in form_preferences,
929 fixed translation problem with "Column".
931 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
933 * src/minibuffer.h: use Timeout instead of the xforms timer
935 (setTimer) rewrite for the Timeout, change to unsigned arg
936 (set): change to unsigned timer arg
939 * src/minibuffer.C (TimerCB): removed func
940 (C_MiniBuffer_TimerCB): removed func
941 (C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB
942 (peek_event): use a switch statement
943 (add): don't use fl_add_timer.
944 (Set): rewrite to use the Timeout
947 * src/Timeout.[Ch] (setType): return a Timeout &
948 (setTimeout): ditto, change to unsigned arg for timeout
950 2000-10-25 Dekel Tsur <dekelts@tau.ac.il>
952 * src/mathed/formula.C (mathed_string_width): Use string instead
953 of a constant size char array.
955 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
957 * src/frontends/ButtonPolicies.h: remove the LOstream and remove
958 the two recently added operator<< for SMInput and State.
960 * src/frontends/ButtonPolicies.C (PreferencesPolicy): cast
962 (OkCancelPolicy): ditto
963 (OkCancelReadOnlyPolicy): ditto
964 (NoRepeatedApplyReadOnlyPolicy): ditto
965 (OkApplyCancelReadOnlyPolicy): ditto
966 (OkApplyCancelPolicy): ditto
967 (NoRepeatedApplyPolicy): ditto
969 2000-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
971 * src/frontends/ButtonPolicies.h: include "support/LOstream.h" and
972 add the usual std:: qualifiers.
974 2000-10-25 Juergen Vigna <jug@sad.it>
976 * src/screen.C (ShowManualCursor): fixed another uint -> int problem.
978 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
980 * src/support/filetools.C (MakeRelPath): change some types to
983 * src/frontends/ButtonPolicies.h (operator<<): new operator for
984 ButtonPolicy::SMInput and ButtonPolicy::State.
986 * src/FontLoader.C (reset): small cleanup
987 (unload): small cleanup
989 * src/FontInfo.C (getFontname): initialize error to 10000.0
991 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
993 * src/frontends/xforms/FormPreferences.[Ch]:
994 * src/frontends/xforms/forms/form_preferences.fd: added spell checker,
995 TeX encoding and default paper size sections.
997 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
999 * src/frontends/xforms/FormTabularCreate.C: add missing #pragma
1002 * src/frontends/xforms/FormError.C (disconnect): use erase() to
1003 make the message_ empty.
1004 (FormError): don't initialize message_ in initializer list.
1006 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1008 * src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot.
1010 2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1012 * lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi)
1014 2000-10-24 John Levon <moz@compsoc.man.ac.uk>
1016 * src/frontends/kde/*data.[Ch]: _("") is not
1019 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1021 * src/buffer.C: removed redundant using directive.
1023 * src/frontends/DialogBase.h: revert to original definition of
1026 * src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
1027 stuff into two classes, one for each dialog, requires a new
1028 element in the dialogs vector, FormTabularCreate.
1030 * src/frontends/xforms/FormXXX.[Ch] (update): revert to original
1033 * src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new
1034 method. Continues Allan's idea, but means that derived classes
1035 don't need to worry about "update or hide?".
1037 * src/frontends/xforms/FormError.C (showInset): add connection
1040 * src/frontends/xforms/FormTabular.[Ch]: split into two classes,
1041 one for each dialog. FormTabular now contains main tabular dialog
1044 * src/frontends/xforms/FormTabularCreate.[Ch]:
1045 * src/frontends/xforms/forms/form_tabular_create.fd: the create
1048 * src/frontends/xforms/FormGraphics.[Ch]:
1049 * src/frontends/xforms/forms/form_graphics.fd
1050 * src/frontends/xforms/FormTabular.[Ch]:
1051 * src/frontends/xforms/forms/form_tabular.fd: made daughter
1052 classes of FormInset.
1054 * src/frontends/xforms/forms/fdfix.sh: small fix. Can now create
1055 class names properly. Eg, form_my_new_dialog -> FormMyNewDialog.
1057 * src/frontends/xforms/Makefile.am:
1058 * src/frontends/xforms/forms/makefile: added new files.
1060 * src/insets/insettabular.[Ch]: removed (Dialogs *) member
1061 variable. added Signal0 hide signal, in keeping with other GUI-I
1064 * src/support/lstrings.h: removed redundant std:: qualifier as
1065 it's already declared in Lsstream.h.
1067 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1069 * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
1073 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
1075 * src/tabular.C (Ascii): minimize scope of cell.
1077 * src/BufferView2.C (nextWord): return string() instead of 0;
1079 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1081 * src/converter.h: add a std:: qualifier
1083 2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
1085 * src/importer.[Ch]: New files. Used for importing files into LyX.
1087 * src/lyxfunc.C (doImport): Use the new Importer class.
1089 * src/converter.h: Add shortcut member to the Format class.
1090 Used for holding the menu shortcut.
1092 * src/converter.C and other files: Made a distinction between
1093 format name and format extension. New formats can be defined using
1094 the \format lyxrc tag.
1095 Added two new converter flags: latex and disable.
1097 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1099 * src/support/lyxlib.h: unify namespace/struct implementation.
1100 Remove extra declarations.
1102 * src/support/chdir.C (chdir): remove version taking char const *
1104 * src/support/rename.C: ditto.
1105 * src/support/lyxsum.C: ditto.
1107 2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
1109 * src/frontends/xforms/FormBase.[Ch]:
1110 * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
1111 read the xforms manual to discover that fl_set_form_minsize()/maxsize()
1112 work only for the next call to fl_show_form(). The correct place to set
1113 them, therefore is in connect() immediately BEFORE fl_show_form(). Now
1114 done. FormBase also stores minw_, minh_ itself. All dialogs derived
1115 from FormBase have the minimum size set; no more stupid crashes with
1118 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1120 * lib/ui/default.ui: fix shortcut for Insert->Include File.
1122 2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1124 * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
1126 * src/support/lyxlib.h: changed second argument of mkdir to
1127 unsigned long int (unsigned int would probably have been enough,
1128 but...). Removed <sys/types.h> header.
1129 * src/support/mkdir.C (mkdir): ditto.
1133 2000-10-19 Juergen Vigna <jug@sad.it>
1135 * src/lyxfunc.C (MenuNew): small fix (form John)
1137 * src/screen.C (Update): removed unneeded code.
1139 * src/tabular.C (Ascii): refixed int != uint bug!
1141 * src/support/lyxlib.h: added sys/types.h include for now permits
1142 compiling, but I don't like this!
1144 2000-10-18 Juergen Vigna <jug@sad.it>
1146 * src/text2.C (ClearSelection): if we clear the selection we need
1147 more refresh so set the status apropriately
1149 * src/insets/insettext.C (draw): hopefully finally fixed draw
1152 2000-10-12 Juergen Vigna <jug@sad.it>
1154 * src/insets/insettext.C (draw): another small fix and make a block
1155 so that variables are localized.
1157 2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
1159 * src/support/lstrings.C (lowercase, uppercase):
1160 use explicit casts to remove compiler warnings.
1162 * src/support/LRegex.C (Impl):
1163 * src/support/StrPool.C (add):
1164 * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
1165 (AddPath, MakeDisplayPath):
1166 * src/support/lstrings.C (prefixIs, subst):
1167 use correct type to remove compiler warnings.
1169 * src/support/lstrings.[Ch] (countChar): returns string::size_type.
1171 * src/support/lyxlib.h:
1172 * src/support/mkdir.C (mkdir): change parameter to mode_t for
1173 portability and to remove compiler warning with DEC cxx.
1175 * src/support/FileInfo.[Ch] (flagRWX): ditto.
1177 2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1179 * src/minibuffer.C (peek_event): retun 1 when there has been a
1180 mouseclick in the minibuffer.
1184 2000-10-17 John Levon <moz@compsoc.man.ac.uk>
1186 * src/frontends/xforms/FormParagraph.C: more space above/below
1189 2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
1191 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
1192 a char only if real_current_font was changed.
1194 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1196 * NEWS: update somewhat for 1.1.6
1198 * lib/ui/default.ui: clean up.
1200 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
1202 * lib/CREDITS: clean up
1204 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1206 * src/combox.[Ch] (select): changed argument back to int
1207 * src/combox.C (peek_event): removed num_bytes as it is declared but
1210 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
1211 modified calls to Combox::select() to remove warnings about type
1214 * src/insets/insetbutton.C (width): explicit cast to remove warning
1215 about type conversion.
1217 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
1220 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
1221 sel_pos_end, refering to cursor position are changed to
1222 LyXParagraph::size_type.
1224 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
1225 consistent with LyXCursor::pos().
1226 (inset_pos): changed to LyXParagraph::size_type for same reason.
1228 * src/insets/insettext.C (resizeLyXText): changed some temporary
1229 variables refing to cursor position to LyXParagraph::size_type.
1231 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
1233 * src/frontends/kde/<various>: The Great Renaming,
1236 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1238 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
1240 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1242 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
1243 0 when there are no arguments.
1245 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1247 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
1248 to segfaults when pressing Ok in InsetBibtex dialog.
1250 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1252 * forms/layout_forms.fd:
1253 * src/layout_forms.C (create_form_form_character): small change to use
1254 labelframe rather than engraved frame + text
1256 * src/lyx_gui.C (create_forms): initialise choice_language with some
1257 arbitrary value to prevent segfault when dialog is shown.
1259 2000-10-16 Baruch Even <baruch.even@writeme.com>
1261 * src/converter.C (runLaTeX, scanLog): Added a warning when there
1262 is no resulting file. This pertains only to LaTeX output.
1264 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
1266 * src/text.C (Backspace): Make sure that the row of the cursor is
1269 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
1272 * src/lyx_gui.C (init): Prevent a crash when only one font from
1273 menu/popup fonts is not found.
1275 * lib/lyxrc.example: Add an example for binding a key for language
1278 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
1280 * src/converter.C (GetReachable): Changed the returned type to
1282 (IsReachable): New method
1284 * src/MenuBackend.C (expand): Handle formats that appear more
1287 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1289 * src/frontends/support/Makefile.am
1290 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
1293 * lib/CREDITS: add Garst Reese.
1295 * src/support/snprintf.h: add extern "C" {} around the definitions.
1297 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
1299 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
1302 * src/frontends/xforms/FormDocument.C:
1303 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
1304 compile without "conversion to integral type of smaller size"
1307 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
1309 * src/text.C (GetColumnNearX): Fixed disabled code.
1311 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
1313 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
1316 * src/support/snprintf.[ch]: new files
1318 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
1320 * src/frontends/kde/formprintdialog.C: add
1321 file browser for selecting postscript output
1323 * src/frontends/kde/formprintdialogdata.C:
1324 * src/frontends/kde/formprintdialogdata.h: re-generate
1327 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
1329 * src/frontends/gnome/Makefile.am:
1330 * src/frontends/kde/Makefile.am: FormCommand.C
1331 disappeared from xforms
1333 * src/frontends/kde/FormCitation.C:
1334 * src/frontends/kde/FormIndex.C: read-only
1337 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1339 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
1342 * src/bufferlist.C: add using directive.
1344 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
1346 * src/support/lyxfunctional.h: version of class_fun for void
1347 returns added, const versions of back_inseter_fun and compare_fun
1350 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
1352 * src/frontends/xforms/FormInset.C (showInset): fix typo.
1354 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1356 * ChangeLog: cleanup.
1358 * lib/CREDITS: update to add all the contributors we've forgotten.
1359 I have obviously missed some, so tell me whether there were
1362 2000-10-13 Marko Vendelin <markov@ioc.ee>
1364 * src/frontends/gnome/FormCitation.C
1365 * src/frontends/gnome/FormCitation.h
1366 * src/frontends/gnome/FormError.C
1367 * src/frontends/gnome/FormIndex.C
1368 * src/frontends/gnome/FormRef.C
1369 * src/frontends/gnome/FormRef.h
1370 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
1372 * src/frontends/gnome/FormCitation.C
1373 * src/frontends/gnome/FormCopyright.C
1374 * src/frontends/gnome/FormError.C
1375 * src/frontends/gnome/FormIndex.C
1376 * src/frontends/gnome/FormRef.C
1377 * src/frontends/gnome/FormToc.C
1378 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
1381 * src/frontends/gnome/Menubar_pimpl.C
1382 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
1385 2000-10-11 Baruch Even <baruch.even@writeme.com>
1388 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
1389 to convey its real action.
1391 * src/minibuffer.C (peek_event): Added action when mouse clicks to
1392 clear the minibuffer and prepare to enter a command.
1394 * src/mathed/formula.C (LocalDispatch): Changed to conform with
1395 the rename from ExecCommand to PrepareForCommand.
1396 * src/lyxfunc.C (Dispatch): ditto.
1398 2000-10-11 Baruch Even <baruch.even@writeme.com>
1400 * src/buffer.C (writeFile): Added test for errors on writing, this
1401 catches all errors and not only file system full errors as intended.
1403 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
1405 * src/lyx_gui.C (create_forms): better fix for crash with
1406 translated interface.
1408 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
1410 * src/frontends/kde/Makefile.am:
1411 * src/frontends/kde/FormCopyright.C:
1412 * src/frontends/kde/formcopyrightdialog.C:
1413 * src/frontends/kde/formcopyrightdialog.h:
1414 * src/frontends/kde/formcopyrightdialogdata.C:
1415 * src/frontends/kde/formcopyrightdialogdata.h:
1416 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
1417 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
1418 copyright to use qtarch
1420 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
1422 * src/encoding.C (read): Fixed bug that caused an error message at
1423 the end of the file.
1425 * po/Makefile.in.in: Fixed rule for ext_l10n.h
1427 * lib/lyxrc.example: Fixed hebrew example.
1429 2000-10-13 Allan Rae <rae@lyx.org>
1431 * src/frontends/xforms/FormPreferences.C (input): reworking the
1433 (build, update, apply): New inputs in various tabfolders
1435 * src/frontends/xforms/FormToc.C: use new button policy.
1436 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
1437 dialogs that either can't use any existing policy or where it just
1440 * src/frontends/xforms/FormTabular.h: removed copyright notice that
1443 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
1444 added a bool parameter which is ignored.
1446 * src/buffer.C (setReadonly):
1447 * src/BufferView_pimpl.C (buffer):
1448 * src/frontends/kde/FormCopyright.h (update):
1449 * src/frontends/kde/FormCitation.[Ch] (update):
1450 * src/frontends/kde/FormIndex.[Ch] (update):
1451 * src/frontends/kde/FormPrint.[Ch] (update):
1452 * src/frontends/kde/FormRef.[Ch] (update):
1453 * src/frontends/kde/FormToc.[Ch] (update):
1454 * src/frontends/kde/FormUrl.[Ch] (update):
1455 * src/frontends/gnome/FormCopyright.h (update):
1456 * src/frontends/gnome/FormCitation.[Ch] (update):
1457 * src/frontends/gnome/FormError.[Ch] (update):
1458 * src/frontends/gnome/FormIndex.[Ch] (update):
1459 * src/frontends/gnome/FormPrint.[Ch] (update):
1460 * src/frontends/gnome/FormRef.h (update):
1461 * src/frontends/gnome/FormToc.[Ch] (update):
1462 * src/frontends/gnome/FormUrl.[Ch] (update):
1463 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
1464 to updateBufferDependent and DialogBase
1466 * src/frontends/xforms/FormCitation.[hC]:
1467 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
1468 * src/frontends/xforms/FormError.[Ch]:
1469 * src/frontends/xforms/FormGraphics.[Ch]:
1470 * src/frontends/xforms/FormIndex.[Ch]:
1471 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
1472 and fixed readOnly handling.
1473 * src/frontends/xforms/FormPrint.[Ch]:
1474 * src/frontends/xforms/FormRef.[Ch]:
1475 * src/frontends/xforms/FormTabular.[Ch]:
1476 * src/frontends/xforms/FormToc.[Ch]:
1477 * src/frontends/xforms/FormUrl.[Ch]:
1478 * src/frontends/xforms/FormInset.[Ch]:
1479 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
1480 form of updateBufferDependent.
1482 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
1483 if form()->visible just in case someone does stuff to the form in a
1486 * src/frontends/DialogBase.h (enum): removed enum since we can now use
1487 the buttoncontroller for everything the enum used to be used for.
1488 (update) It would seem we need to force all dialogs to use a bool
1489 parameter or have two update functions. I chose to go with one.
1490 I did try removing update() from here and FormBase and defining the
1491 appropriate update signatures in FormBaseB[DI] but then ran into the
1492 problem of the update() call in FormBase::show(). Whatever I did
1493 to get around that would require another function and that just
1494 got more confusing. Hence the decision to make everyone have an
1495 update(bool). An alternative might have been to override show() in
1496 FormBaseB[DI] and that would allow the different and appropriate
1499 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
1500 true == buffer change occurred. I decided against using a default
1501 template parameter since not all compilers support that at present.
1503 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
1505 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
1506 army knife" by removing functionality.
1507 (clearStore): removed. All such housekeeping on hide()ing the dialog
1508 is to be carried out by overloaded disconnect() methods.
1509 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
1510 superceded by Baruch's neat test (FormGraphics) to update an existing
1511 dialog if a new signal is recieved rather than block all new signals
1513 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
1514 only to Inset dialogs.
1515 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
1516 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
1518 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
1520 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
1521 as a base class to all inset dialogs. Used solely to connect/disconnect
1522 the Inset::hide signal and to define what action to take on receipt of
1523 a UpdateBufferDependent signal.
1524 (FormCommand): now derived from FormInset.
1526 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
1529 * src/frontends/xforms/FormCopyright.[Ch]:
1530 * src/frontends/xforms/FormPreferences.[Ch]:
1531 now derived from FormBaseBI.
1533 * src/frontends/xforms/FormDocument.[Ch]:
1534 * src/frontends/xforms/FormParagraph.[Ch]:
1535 * src/frontends/xforms/FormPrint.[Ch]:
1536 now derived from FormBaseBD.
1538 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
1540 * src/frontends/xforms/FormCitation.[Ch]:
1541 * src/frontends/xforms/FormError.[Ch]:
1542 * src/frontends/xforms/FormRef.[Ch]:
1543 * src/frontends/xforms/FormToc.[Ch]:
1544 (clearStore): reworked as disconnect().
1546 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
1549 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1551 * src/converter.C (runLaTeX): constify buffer argument
1554 * src/frontends/support/Makefile.am (INCLUDES): fix.
1556 * src/buffer.h: add std:: qualifier
1557 * src/insets/figinset.C (addpidwait): ditto
1558 * src/MenuBackend.C: ditto
1559 * src/buffer.C: ditto
1560 * src/bufferlist.C: ditto
1561 * src/layout.C: ditto
1562 * src/lyxfunc.C: ditto
1564 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1566 * src/lyxtext.h (bidi_level): change return type to
1567 LyXParagraph::size_type.
1569 * src/lyxparagraph.h: change size_type to
1570 TextContainer::difference_type. This should really be
1571 TextContainer::size_type, but we need currently to support signed
1574 2000-10-11 Marko Vendelin <markov@ioc.ee>
1575 * src/frontends/gnome/FormError.h
1576 * src/frontends/gnome/FormRef.C
1577 * src/frontends/gnome/FormRef.h
1578 * src/frontends/gnome/FormError.C
1579 * src/frontends/gnome/Makefile.am
1580 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
1581 to Gnome frontend. Both dialogs use "action" area.
1583 2000-10-12 Baruch Even <baruch.even@writeme.com>
1585 * src/graphics/GraphicsCacheItem_pimpl.C:
1586 * src/graphics/Renderer.C:
1587 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
1590 2000-10-12 Juergen Vigna <jug@sad.it>
1592 * src/insets/insettext.C (draw): fixed drawing bug (specifically
1593 visible when selecting).
1595 * development/Code_rules/Rules: fixed some typos.
1597 2000-10-09 Baruch Even <baruch.even@writeme.com>
1599 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
1600 compiling on egcs 1.1.2 possible.
1602 * src/filedlg.C (comp_direntry::operator() ): ditto.
1604 2000-08-31 Baruch Even <baruch.even@writeme.com>
1606 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
1609 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
1610 transient it now only gets freed when the object is destructed.
1612 2000-08-24 Baruch Even <baruch.even@writeme.com>
1614 * src/frontends/FormGraphics.h:
1615 * src/frontends/FormGraphics.C: Changed to use ButtonController and
1618 2000-08-20 Baruch Even <baruch.even@writeme.com>
1620 * src/insets/insetgraphics.C:
1621 (draw): Added messages to the drawn rectangle to report status.
1622 (updateInset): Disabled the use of the inline graphics,
1625 2000-08-17 Baruch Even <baruch.even@writeme.com>
1627 * src/frontends/support: Directory added for the support of GUII LyX.
1629 * src/frontends/support/LyXImage.h:
1630 * src/frontends/support/LyXImage.C: Base class for GUII holding of
1633 * src/frontends/support/LyXImage_X.h:
1634 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
1635 version of LyXImage, this uses the Xlib Pixmap.
1637 * src/PainterBase.h:
1638 * src/PainterBase.C:
1640 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
1641 replacement to Pixmap.
1643 * src/insets/insetgraphics.h:
1644 * src/insets/insetgraphics.C:
1645 * src/graphics/GraphicsCacheItem.h:
1646 * src/graphics/GraphicsCacheItem.C:
1647 * src/graphics/GraphicsCacheItem_pimpl.h:
1648 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
1651 * src/graphics/GraphicsCacheItem.h:
1652 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
1653 another copy of the object.
1655 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
1656 of cacheHandle, this fixed a bug that sent LyX crashing.
1658 * src/graphics/XPM_Renderer.h:
1659 * src/graphics/XPM_Renderer.C:
1660 * src/graphics/EPS_Renderer.h:
1661 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
1663 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
1665 * src/lyxfunc.C (processKeySym): only handle the
1666 lockinginset/inset stuff if we have a buffer and text loaded...
1668 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
1670 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
1672 * src/support/lyxfunctional.h: add operator= that takes a reference
1674 * src/lyxserver.C (mkfifo): make first arg const
1676 * src/layout.h: renamed name(...) to setName(...) to work around
1679 * src/buffer.C (setFileName): had to change name of function to
1680 work around bugs in egcs. (renamed from fileName)
1682 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
1684 * src/support/translator.h: move helper template classes to
1685 lyxfunctional.h, include "support/lyxfunctional.h"
1687 * src/support/lyxmanip.h: add delaration of fmt
1689 * src/support/lyxfunctional.h: new file
1690 (class_fun_t): new template class
1691 (class_fun): helper template function
1692 (back_insert_fun_iterator): new template class
1693 (back_inserter_fun): helper template function
1694 (compare_memfun_t): new template class
1695 (compare_memfun): helper template function
1696 (equal_1st_in_pair): moved here from translator
1697 (equal_2nd_in_pair): moved here from translator
1699 * src/support/fmt.C: new file
1700 (fmt): new func, can be used for a printf substitute when still
1701 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
1703 * src/support/StrPool.C: add some comments
1705 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
1708 * src/insets/figinset.C (addpidwait): use std::copy with
1709 ostream_iterator to fill the pidwaitlist
1711 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
1713 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
1716 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
1719 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
1721 * src/frontends/xforms/FormDocument.C (build): remove c_str()
1722 (class_update): ditto
1723 (BulletPanel): ditto
1724 (CheckChoiceClass): move initialization of tc and tct
1726 * src/tabular.C: remove current_view
1727 (OldFormatRead): similar to right below [istream::ignore]
1729 * src/lyxlex_pimpl.C (next): add code for faster skipping of
1730 chars, unfortunately this is buggy on gcc 2.95.2, so currently
1731 unused [istream::ignore]
1733 * src/lyxfunc.C: include "support/lyxfunctional.h"
1734 (getInsetByCode): use std::find_if and compare_memfun
1736 * src/lyxfont.C (stateText): remove c_str()
1738 * src/lyx_main.C (setDebuggingLevel): make static
1739 (commandLineHelp): make static
1741 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
1742 Screen* together with fl_get_display() and fl_screen
1744 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
1745 togheter with fl_get_display() and fl_screen
1746 (create_forms): remove c_str()
1748 * src/layout.C: include "support/lyxfunctional.h"
1749 (hasLayout): use std::find_if and compare_memfun
1750 (GetLayout): use std::find_if and comapre_memfun
1751 (delete_layout): use std::remove_if and compare_memfun
1752 (NumberOfClass): use std:.find_if and compare_memfun
1754 * src/gettext.h: change for the new functions
1756 * src/gettext.C: new file, make _(char const * str) and _(string
1757 const & str) real functions.
1759 * src/font.C (width): rewrite slightly to avoid one extra variable
1761 * src/debug.C: initialize Debug::ANY here
1763 * src/commandtags.h: update number comments
1765 * src/combox.h (get): make const func
1767 (getline): make const
1769 * src/combox.C (input_cb): handle case where fl_get_input can
1772 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
1773 "support/lyxfunctional.h", remove current_view variable.
1774 (resize): use std::for_each with std::mem_fun
1775 (getFileNames): use std::copy with back_inserter_fun
1776 (getBuffer): change arg type to unsigned int
1777 (emergencyWriteAll): call emergencyWrite with std::for_each and
1779 (emergencyWrite): new method, the for loop in emergencyWriteAll
1781 (exists): use std::find_if with compare_memfun
1782 (getBuffer): use std::find_if and compare_memfun
1784 * src/buffer.h: add typedefs for iterator_category, value_type
1785 difference_type, pointer and reference for inset_iterator
1786 add postfix ++ for inset_iterator
1787 make inset_iterator::getPos() const
1789 * src/buffer.C: added support/lyxmanip.h
1790 (readFile): use lyxerr << fmt instead of printf
1791 (makeLaTeXFile): use std::copy to write out encodings
1793 * src/Painter.C (text): rewrite slightly to avoid extra font variable
1795 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
1796 free and the char * temp.
1797 (hasMenu): use std::find_if and compare_memfun
1800 * src/Makefile.am (lyx_SOURCES): added gettext.C
1802 * src/LyXAction.C (retrieveActionArg): clear the arg, use
1803 string::insert small change to avoid temporary
1805 * src/LColor.C (getGUIName): remove c_str()
1807 * several files: change all occurrences of fl_display to
1810 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
1811 that -pedantic is not used for gcc 2.97 (cvs gcc)
1813 * boost/Makefile.am: begin slowly to prepare for a real boost lib
1815 2000-10-11 Allan Rae <rae@lyx.org>
1817 * src/frontends/xforms/FormPreferences.C (input): template path must be
1818 a readable directory. It doesn't need to be writeable.
1819 (build, delete, update, apply): New inputs in the various tabfolders
1821 * src/frontends/xforms/forms/form_preferences.fd:
1822 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
1823 several new entries to existing folders. Shuffled some existing stuff
1826 * src/frontends/xforms/forms/form_print.fd:
1827 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
1828 Should probably rework PrinterParams as well. Note that the switch to
1829 collated is effectively the same as !unsorted so changing PrinterParams
1830 will require a lot of fiddly changes to reverse the existing logic.
1832 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
1834 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
1836 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
1838 2000-10-10 Allan Rae <rae@lyx.org>
1841 * src/lyxfunc.C (Dispatch):
1843 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
1846 * src/lyxrc.C (output): Only write the differences between system lyxrc
1847 and the users settings.
1850 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
1852 I'll rewrite this later, after 1.1.6 probably, to keep a single
1853 LyXRC but two instances of a LyXRCStruct.
1855 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1857 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
1859 * src/tabular.h: add a few std:: qualifiers.
1861 * src/encoding.C: add using directive.
1862 * src/language.C: ditto.
1864 * src/insets/insetquotes.C (Validate): use languages->lang()
1865 instead of only language.
1867 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
1869 * lib/languages: New file.
1871 * lib/encodings: New file.
1873 * src/language.C (Languages): New class.
1874 (read): New method. Reads the languages from the 'languages' file.
1876 * src/encoding.C (Encodings): New class.
1877 (read): New method. Reads the encodings from the 'encodings' file.
1879 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
1882 * src/bufferparams.h and a lot of files: Deleted the member language,
1883 and renamed language_info to language
1885 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
1886 * src/lyxfont.C (latexWriteStartChanges): ditto.
1887 * src/paragraph.C (validate,TeXOnePar): ditto.
1889 * src/lyxfont.C (update): Restored deleted code.
1891 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
1893 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
1895 * src/BufferView_pimpl.C (buffer): cleaned up a little.
1897 * src/insets/figinset.[Ch]:
1898 * src/insets/insetinclude.[Ch]:
1899 * src/insets/insetinclude.[Ch]:
1900 * src/insets/insetparent.[Ch]:
1901 * src/insets/insetref.[Ch]:
1902 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
1904 * src/insets/*.[Ch]:
1905 * src/mathed/formula.[Ch]:
1906 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
1908 * src/buffer.C (parseSingleLyXformat2Token, readInset):
1909 * src/lyx_cb.C (FigureApplyCB):
1910 * src/lyxfunc.C (getStatus, Dispatch):
1911 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
1914 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
1916 * src/converter.[Ch] (Formats::View):
1917 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
1919 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
1920 *current_view->buffer(). This will change later, but this patch is way
1923 2000-10-09 Juergen Vigna <jug@sad.it>
1925 * src/text.C (GetRow): small fix.
1927 * src/BufferView_pimpl.C (cursorPrevious):
1928 (cursorNext): added LyXText parameter to function.
1930 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
1931 keypress depending on cursor position.
1933 2000-10-06 Juergen Vigna <jug@sad.it>
1935 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
1936 (copySelection): redone this function and also copy ascii representa-
1939 * src/tabular.C (Ascii):
1943 (print_n_chars): new functions to realize the ascii export of tabulars.
1945 2000-10-05 Juergen Vigna <jug@sad.it>
1947 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
1948 if we don't have a buffer.
1950 2000-10-10 Allan Rae <rae@lyx.org>
1952 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
1953 with closing dialog. It seems that nested tabfolders require hiding
1954 of inner tabfolders before hiding the dialog itself. Actually all I
1955 did was hide the active outer folder.
1957 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
1958 unless there really is a buffer. hideBufferDependent is called
1961 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
1962 POTFILES.in stays in $(srcdir).
1964 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
1966 * lib/lyxrc.example: Few changes.
1968 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
1970 * src/BufferView_pimpl.C (buffer): only need one the
1971 updateBufferDependent signal to be emitted once! Moved to the end of
1972 the method to allow bv_->text to be updated first.
1974 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
1975 and hSignal_ with Dialogs * and BufferDependency variables.
1976 New Buffer * parent_, initialised when the dialog is launched. Used to
1977 check whether to update() or hide() dialog in the new, private
1978 updateOrHide() method that is connected to the updateBufferDependent
1979 signal. Daughter classes dictate what to do using the
1980 ChangedBufferAction enum, passed to the c-tor.
1982 * src/frontends/xforms/FormCitation.C:
1983 * src/frontends/xforms/FormCommand.C:
1984 * src/frontends/xforms/FormCopyright.C:
1985 * src/frontends/xforms/FormDocument.C:
1986 * src/frontends/xforms/FormError.C:
1987 * src/frontends/xforms/FormIndex.C:
1988 * src/frontends/xforms/FormPreferences.C:
1989 * src/frontends/xforms/FormPrint.C:
1990 * src/frontends/xforms/FormRef.C:
1991 * src/frontends/xforms/FormToc.C:
1992 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
1995 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
1996 ChangedBufferAction enum.
1998 * src/frontends/xforms/FormParagraph.[Ch]
1999 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
2002 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2004 * lib/bind/cua.bind: fix a bit.
2005 * lib/bind/emacs.bind: ditto.
2007 * lib/bind/menus.bind: remove real menu entries from there.
2009 * src/spellchecker.C: make sure we only include strings.h when
2012 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
2014 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
2015 function. It enlarges the maximum number of pup when needed.
2016 (add_toc2): Open a new menu if maximum number of items per menu has
2019 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
2021 * src/frontends/kde/FormPrint.C: fix error reporting
2023 * src/frontends/xforms/FormDocument.C: fix compiler
2026 * lib/.cvsignore: add Literate.nw
2028 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
2031 * bufferview_funcs.[Ch]
2034 * text2.C: Add support for numbers in RTL text.
2036 2000-10-06 Allan Rae <rae@lyx.org>
2038 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
2039 to be gettext.m4 friendly again. ext_l10n.h is now
2040 generated into $top_srcdir instead of $top_builddir
2041 so that lyx.pot will be built correctly -- without
2042 duplicate parsing of ext_l10n.h.
2044 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
2046 * src/frontends/kde/FormCitation.C: make the dialog
2047 behave more sensibly
2049 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
2051 * config/kde.m4: fix consecutive ./configure runs,
2052 look for qtarch, fix library order
2054 * src/frontends/kde/Makefile.am: tidy up,
2055 add Print dialog, add .dlg dependencies
2057 * src/frontends/kde/FormPrint.C:
2058 * src/frontends/kde/FormPrint.h:
2059 * src/frontends/kde/formprintdialog.C:
2060 * src/frontends/kde/formprintdialog.h:
2061 * src/frontends/kde/formprintdialogdata.C:
2062 * src/frontends/kde/formprintdialogdata.h:
2063 * src/frontends/kde/dlg/formprintdialog.dlg: add
2066 * src/frontends/kde/dlg/README: Added explanatory readme
2068 * src/frontends/kde/dlg/checkinitorder.pl: small perl
2069 script to double-check qtarch's output
2071 * src/frontends/kde/formindexdialog.C:
2072 * src/frontends/kde/formindexdialogdata.C:
2073 * src/frontends/kde/formindexdialogdata.h:
2074 * src/frontends/kde/dlg/formindexdialog.dlg: update
2075 for qtarch, minor fixes
2077 2000-10-05 Allan Rae <rae@lyx.org>
2079 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
2080 dialogs when switching buffers update them instead. It's up to each
2081 dialog to decide if it should still be visible or not.
2082 update() should return a bool to control visiblity within show().
2083 Or perhaps better to set a member variable and use that to control
2086 * lib/build-listerrors: create an empty "listerrors" file just to stop
2087 make trying to regenerate it all the time if you don't have noweb
2090 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
2092 * po/Makefile.in.in (ext_l10n.h): added a rule to build
2093 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
2094 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
2095 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
2096 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
2098 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
2100 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
2102 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
2103 deleting buffer. Closes all buffer-dependent dialogs.
2105 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
2107 * src/frontends/xforms/FormCitation.[Ch]:
2108 * src/frontends/xforms/FormPreferences.[Ch]:
2109 * src/frontends/xforms/FormPrint.[Ch]:
2110 * src/frontends/xforms/FormRef.[Ch]:
2111 * src/frontends/xforms/FormUrl.[Ch]: ditto
2113 * src/frontends/xforms/FormDocument.[Ch]:
2114 * src/frontends/xforms/forms/form_document.C.patch:
2115 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
2116 pass through a single input() function.
2118 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
2120 * lib/build-listerrors: return status as OK
2122 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
2124 * lib/lyxrc.example: Updated to new export code
2126 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2128 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
2131 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
2134 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
2135 LyX-Code is defined.
2136 * lib/layouts/amsbook.layout: ditto.
2138 * boost/Makefile.am: fix typo.
2140 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
2142 (add_lastfiles): removed.
2143 (add_documents): removed.
2144 (add_formats): removed.
2146 * src/frontends/Menubar.C: remove useless "using" directive.
2148 * src/MenuBackend.h: add a new MenuItem constructor.
2150 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
2153 2000-10-04 Allan Rae <rae@lyx.org>
2155 * lib/Makefile.am (listerrors):
2156 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
2157 I haven't got notangle installed so Kayvan please test. The output
2158 should end up in $builddir. This also allows people who don't have
2159 noweb installed to complete the make process without error.
2161 * src/frontends/xforms/FormCommand.[Ch] (showInset):
2162 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
2163 by JMarc's picky compiler.
2165 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2168 * src/insets/insettabular.C (setPos): change for loop to not use
2169 sequencing operator. Please check this Jürgen.
2171 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
2173 * src/insets/insetcite.C (getScreenLabel): ditto
2174 * src/support/filetools.C (QuoteName): ditto
2175 (ChangeExtension): ditto
2177 * src/BufferView_pimpl.C (scrollCB): make heigt int
2179 * src/BufferView2.C (insertInset): comment out unused arg
2181 * boost/Makefile.am (EXTRADIST): new variable
2183 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
2185 * src/exporter.C (IsExportable): Fixed
2187 * lib/configure.m4: Small fix
2189 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
2191 * src/insets/insetbutton.C (width): Changed to work with no GUI.
2192 * src/insets/insetbib.C (bibitemWidest): ditto.
2193 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
2195 2000-10-03 Juergen Vigna <jug@sad.it>
2197 * src/BufferView2.C (theLockingInset): removed const because of
2198 Agnus's compile problems.
2200 * src/insets/insettext.C (LocalDispatch): set the language of the
2201 surronding paragraph on inserting the first character.
2203 * various files: changed use of BufferView::the_locking_inset.
2205 * src/BufferView2.C (theLockingInset):
2206 (theLockingInset): new functions.
2208 * src/BufferView.h: removed the_locking_inset.
2210 * src/lyxtext.h: added the_locking_inset
2212 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
2214 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
2216 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
2218 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
2219 * src/mathed/math_cursor.C (IsAlpha): ditto.
2220 * src/mathed/math_inset.C (strnew): ditto.
2221 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
2222 (IMetrics): cxp set but never used; removed.
2223 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
2224 that the variable in question has been removed also!
2227 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
2228 using the Buffer * passed to Latex(), using the BufferView * passed to
2229 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
2231 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
2232 Linuxdoc() and DocBook() rather than the stored Buffer * master.
2234 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
2235 * src/buffer.C (readInset): used new InsetBibtex c-tor
2236 * (getBibkeyList): used new InsetBibtex::getKeys
2238 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2241 * lib/build-listerrors
2243 * src/exporter.C: Add literate programming support to the export code
2246 * src/lyx_cb.C: Remove old literate code.
2248 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
2251 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
2252 * src/converter.C (View, Convert): Use QuoteName.
2254 * src/insets/figinset.C (Preview): Use Formats::View.
2256 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
2258 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2260 * src/lyxfunc.C (Dispatch): move declaration of text variable at
2261 the top of the function, because compaq cxx complains that the
2262 "goto exit_with_message" when the function is disabled bypasses
2264 (MenuNew): try a better fix for the generation of new file names.
2265 This time, I used AddName() instead of AddPath(), hoping Juergen
2268 2000-10-03 Allan Rae <rae@lyx.org>
2270 * src/frontends/xforms/forms/form_preferences.fd:
2271 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
2272 nested tabfolders has begun. The old "Miscellaneous" was renamed as
2273 "Look and Feel"->"General" but will need to be split up further into
2274 general output and general input tabs. Current plan is for four outer
2275 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
2276 stuff; "Inputs" for input and import configuration; "Outputs" for
2277 output and export configuration; and one more whatever is left over
2278 called "General". The leftovers at present look like being which
2279 viewers to use, spellchecker, language support and might be better
2280 named "Support". I've put "Paths" in "Inputs" for the moment as this
2281 seems reasonable for now at least.
2282 One problem remains: X error kills LyX when you close Preferences.
2284 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
2286 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
2287 qualifier from form()
2288 * src/frontends/xforms/FormCitation.[Ch]:
2289 * src/frontends/xforms/FormCopyright.[Ch]:
2290 * src/frontends/xforms/FormDocument.[Ch]:
2291 * src/frontends/xforms/FormError.[Ch]:
2292 * src/frontends/xforms/FormIndex.[Ch]:
2293 * src/frontends/xforms/FormPreferences.[Ch]:
2294 * src/frontends/xforms/FormPrint.[Ch]:
2295 * src/frontends/xforms/FormRef.[Ch]:
2296 * src/frontends/xforms/FormToc.[Ch]:
2297 * src/frontends/xforms/FormUrl.[Ch]: ditto.
2299 * src/frontends/xforms/FormCitation.[Ch]:
2300 * src/frontends/xforms/FormIndex.[Ch]:
2301 * src/frontends/xforms/FormRef.[Ch]:
2302 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
2303 with Allan's naming policy
2305 * src/frontends/xforms/FormCitation.C: some static casts to remove
2308 2000-10-02 Juergen Vigna <jug@sad.it>
2310 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
2311 now you can type or do stuff inside the table-cell also when in dummy
2312 position, fixed visible cursor.
2314 * src/insets/insettext.C (Edit): fixing cursor-view position.
2316 * src/lyxfunc.C (Dispatch): use * text variable so that it can
2317 be used for equal functions in lyxfunc and insettext.
2319 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
2321 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
2323 * src/frontends/gnome/FormCitation.h:
2324 * src/frontends/gnome/FormCopyright.h:
2325 * src/frontends/gnome/FormIndex.h:
2326 * src/frontends/gnome/FormPrint.h:
2327 * src/frontends/gnome/FormToc.h:
2328 * src/frontends/gnome/FormUrl.h:
2329 * src/frontends/kde/FormCitation.h:
2330 * src/frontends/kde/FormCopyright.h:
2331 * src/frontends/kde/FormIndex.h:
2332 * src/frontends/kde/FormRef.h:
2333 * src/frontends/kde/FormToc.h:
2334 * src/frontends/kde/FormUrl.h: fix remaining users of
2337 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2339 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
2340 from depth argument.
2341 (DocBookHandleCaption): ditto.
2342 (DocBookHandleFootnote): ditto.
2343 (SimpleDocBookOnePar): ditto.
2345 * src/frontends/xforms/FormDocument.h (form): remove extra
2346 FormDocument:: qualifier.
2348 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
2350 * sigc++/handle.h: ditto.
2352 * src/lyx_gui_misc.C: add "using" directive.
2354 * src/cheaders/cstddef: new file, needed by the boost library (for
2357 2000-10-02 Juergen Vigna <jug@sad.it>
2359 * src/insets/insettext.C (SetFont): better support.
2361 * src/insets/insettabular.C (draw): fixed drawing of single cell.
2363 * src/screen.C (DrawOneRow): some uint refixes!
2365 2000-10-02 Allan Rae <rae@lyx.org>
2367 * boost/.cvsignore: ignore Makefile as well
2369 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
2370 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
2372 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
2373 Left this one out by accident.
2375 * src/frontends/xforms/FormBase.h (restore): default to calling
2376 update() since that will restore the original/currently-applied values.
2377 Any input() triggered error messages will require the derived classes
2378 to redefine restore().
2380 * src/frontends/xforms/FormDocument.C: initialize a few variables to
2381 avoid a segfault. combo_doc_class is the main concern.
2383 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
2385 * Simplify build-listerrors in view of GUI-less export ability!
2387 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2389 * src/lyx_main.C (easyParse): Disable gui when exporting
2391 * src/insets/figinset.C:
2394 * src/lyx_gui_misc.C
2395 * src/tabular.C: Changes to allow no-gui.
2397 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
2399 * src/support/utility.hpp: removed file
2400 * src/support/block.h: removed file
2402 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
2405 * src/mathed/formula.C: add support/lyxlib.h
2406 * src/mathed/formulamacro.C: ditto
2408 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
2409 * src/lyxparagraph.h: ditto
2411 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
2412 * src/frontends/Makefile.am (INCLUDES): ditto
2413 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
2414 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
2415 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
2416 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
2417 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
2418 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
2420 * src/BufferView.h: use boost/utility.hpp
2421 * src/LColor.h: ditto
2422 * src/LaTeX.h: ditto
2423 * src/LyXAction.h: ditto
2424 * src/LyXView.h: ditto
2425 * src/bufferlist.h: ditto
2426 * src/lastfiles.h: ditto
2427 * src/layout.h: ditto
2428 * src/lyx_gui.h: ditto
2429 * src/lyx_main.h: ditto
2430 * src/lyxlex.h: ditto
2431 * src/lyxrc.h: ditto
2432 * src/frontends/ButtonPolicies.h: ditto
2433 * src/frontends/Dialogs.h: ditto
2434 * src/frontends/xforms/FormBase.h: ditto
2435 * src/frontends/xforms/FormGraphics.h: ditto
2436 * src/frontends/xforms/FormParagraph.h: ditto
2437 * src/frontends/xforms/FormTabular.h: ditto
2438 * src/graphics/GraphicsCache.h: ditto
2439 * src/graphics/Renderer.h: ditto
2440 * src/insets/ExternalTemplate.h: ditto
2441 * src/insets/insetcommand.h: ditto
2442 * src/support/path.h: ditto
2444 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
2445 and introduce clause for 2.97.
2447 * boost/libs/README: new file
2449 * boost/boost/utility.hpp: new file
2451 * boost/boost/config.hpp: new file
2453 * boost/boost/array.hpp: new file
2455 * boost/Makefile.am: new file
2457 * boost/.cvsignore: new file
2459 * configure.in (AC_OUTPUT): add boost/Makefile
2461 * Makefile.am (SUBDIRS): add boost
2463 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2465 * src/support/lstrings.C (suffixIs): Fixed.
2467 2000-10-01 Allan Rae <rae@lyx.org>
2469 * src/PrinterParams.h: moved things around to avoid the "can't
2470 inline call" warning.
2472 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
2473 into doc++ documentation.
2475 * src/frontends/xforms/FormCommand.[Ch]: support button policy
2477 * src/frontends/xforms/FormRef.C: make use of button controller
2478 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
2479 cleaned up button controller usage.
2480 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
2481 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
2482 use the button controller
2484 * src/frontends/xforms/forms/*.fd: and associated generated files
2485 updated to reflect changes to FormBase. Some other FormXxxx files
2486 also got minor updates to reflect changes to FormBase.
2488 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
2489 (hide): made virtual.
2490 (input): return a bool. true == valid input
2491 (RestoreCB, restore): new
2492 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
2493 Changes to allow derived dialogs to use a ButtonController and
2494 make sense when doing so: OK button calls ok() and so on.
2496 * src/frontends/xforms/ButtonController.h (class ButtonController):
2497 Switch from template implementation to taking Policy parameter.
2498 Allows FormBase to provide a ButtonController for any dialog.
2500 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
2501 Probably should rename connect and disconnect.
2502 (apply): use the radio button groups
2503 (form): needed by FormBase
2504 (build): setup the radio button groups
2506 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
2508 * several files: type changes to reduce the number of warnings and
2509 to unify type hangling a bit. Still much to do.
2511 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2513 * lib/images/*: rename a bunch of icons to match Dekel converter
2516 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
2519 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
2521 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
2523 * sigc++/handle.h: ditto for class Handle.
2525 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
2527 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
2529 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
2531 * src/intl.C (InitKeyMapper): Correct the value of n due to the
2532 removal of the "default" language.
2534 * src/combox.h (getline): Check that sel > 0
2536 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
2538 * lib/examples/docbook_example.lyx
2539 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
2541 * lib/layouts/docbook-book.layout: new docbook book layout.
2543 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
2545 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
2547 * src/insets/figinset.C (DocBook):fixed small typo.
2549 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
2551 * src/insets/insetinclude.h: string include_label doesn't need to be
2554 2000-09-29 Allan Rae <rae@lyx.org>
2556 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
2557 Allow derived type to control connection and disconnection from signals
2558 of its choice if desired.
2560 2000-09-28 Juergen Vigna <jug@sad.it>
2562 * src/insets/insettabular.C (update): fixed cursor setting when
2563 the_locking_inset changed.
2564 (draw): made this a bit cleaner.
2565 (InsetButtonPress): fixed!
2567 * various files: added LyXText Parameter to fitCursor call.
2569 * src/BufferView.C (fitCursor): added LyXText parameter.
2571 * src/insets/insettabular.C (draw): small draw fix.
2573 * src/tabular.C: right setting of left/right celllines.
2575 * src/tabular.[Ch]: fixed various types in funcions and structures.
2576 * src/insets/insettabular.C: ditto
2577 * src/frontends/xforms/FormTabular.C: ditto
2579 2000-09-28 Allan Rae <rae@lyx.org>
2581 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
2582 that the #ifdef's had been applied to part of what should have been
2583 a complete condition. It's possible there are other tests that
2584 were specific to tables that are also wrong now that InsetTabular is
2585 being used. Now we need to fix the output of '\n' after a table in a
2586 float for the same reason as the original condition:
2587 "don't insert this if we would be adding it before or after a table
2588 in a float. This little trick is needed in order to allow use of
2589 tables in \subfigures or \subtables."
2590 Juergen can you check this?
2592 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
2594 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
2595 output to the ostream.
2597 * several files: fixed types based on warnings from cxx
2599 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
2601 * src/frontends/kde/Makefile.am: fix rule for
2602 formindexdialogdata_moc.C
2604 * src/.cvsignore: add ext_l10n.h to ignore
2606 * acconfig.h: stop messing with __STRICT_ANSI__
2607 * config/gnome.m4: remove option to set -ansi
2608 * config/kde.m4: remove option to set -ansi
2609 * config/lyxinclude.m4: don't set -ansi
2611 2000-09-27 Juergen Vigna <jug@sad.it>
2613 * various files: remove "default" language check.
2615 * src/insets/insetquotes.C: removed use of current_view.
2617 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
2618 the one should have red ears by now!
2620 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
2621 in more then one paragraph. Fixed cursor-movement/selection.
2623 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
2624 paragraphs inside a text inset.
2626 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
2627 text-inset if this owner is an inset.
2629 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
2631 * src/Bullet.h: changed type of font, character and size to int
2633 * src/buffer.C (asciiParagraph): remove actcell and fname1.
2635 * src/insets/inseturl.[Ch]:
2636 * src/insets/insetref.[Ch]:
2637 * src/insets/insetlabel.[Ch]: add linelen to Ascii
2639 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
2641 * src/buffer.C (readFile): block-if statement rearranged to minimise
2642 bloat. Patch does not reverse Jean-Marc's change ;-)
2644 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
2645 Class rewritten to store pointers to hide/update signals directly,
2646 rather than Dialogs *. Also defined an enum to ease use. All xforms
2647 forms can now be derived from this class.
2649 * src/frontends/xforms/FormCommand.[Ch]
2650 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
2652 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
2655 * src/frontends/xforms/forms/form_citation.fd
2656 * src/frontends/xforms/forms/form_copyright.fd
2657 * src/frontends/xforms/forms/form_error.fd
2658 * src/frontends/xforms/forms/form_index.fd
2659 * src/frontends/xforms/forms/form_ref.fd
2660 * src/frontends/xforms/forms/form_toc.fd
2661 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
2663 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
2665 * src/insets/insetfoot.C: removed redundent using directive.
2667 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2669 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
2670 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
2672 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
2673 created in the constructors in different groups. Then set() just
2674 have to show the groups as needed. This fixes the redraw problems
2675 (and is how the old menu code worked).
2677 * src/support/lyxlib.h: declare the methods as static when we do
2678 not have namespaces.
2680 2000-09-26 Juergen Vigna <jug@sad.it>
2682 * src/buffer.C (asciiParagraph): new function.
2683 (writeFileAscii): new function with parameter ostream.
2684 (writeFileAscii): use now asciiParagraph.
2686 * various inset files: added the linelen parameter to the Ascii-func.
2688 * src/tabular.C (Write): fixed error in writing file introduced by
2689 the last changes from Lars.
2691 * lib/bind/menus.bind: removed not supported functions.
2693 * src/insets/insettext.C (Ascii): implemented this function.
2695 * src/insets/lyxinset.h (Ascii): added linelen parameter.
2697 * src/tabular.C (write_attribute[int,string,bool]): new functions.
2698 (Write): use of the write_attribute functions.
2700 * src/bufferlist.C (close): fixed reasking question!
2702 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
2704 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
2705 new files use the everwhere possible.
2708 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
2709 src/log_form.C src/lyx.C:
2712 * src/buffer.C (runLaTeX): remove func
2714 * src/PaperLayout.C: removed file
2715 * src/ParagraphExtra.C: likewise
2716 * src/bullet_forms.C: likewise
2717 * src/bullet_forms.h: likewise
2718 * src/bullet_forms_cb.C: likewise
2720 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
2721 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
2724 * several files: remove all traces of the old fd_form_paragraph,
2725 and functions belonging to that.
2727 * several files: remove all traces of the old fd_form_document,
2728 and functions belonging to that.
2730 * several files: constify local variables were possible.
2732 * several files: remove all code that was dead when NEW_EXPORT was
2735 * several files: removed string::c_str in as many places as
2738 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
2739 (e): be a bit more outspoken when patching
2740 (updatesrc): only move files if changed.
2742 * forms/layout_forms.h.patch: regenerated
2744 * forms/layout_forms.fd: remove form_document and form_paragraph
2745 and form_quotes and form_paper and form_table_options and
2746 form_paragraph_extra
2748 * forms/form1.fd: remove form_table
2750 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
2751 the fdui->... rewrite. Update some comments to xforms 0.88
2753 * forms/bullet_forms.C.patch: removed file
2754 * forms/bullet_forms.fd: likewise
2755 * forms/bullet_forms.h.patch: likewise
2757 * development/Code_rules/Rules: added a section on switch
2758 statements. Updated some comment to xforms 0.88.
2760 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2762 * src/buffer.C (readFile): make sure that the whole version number
2763 is read after \lyxformat (even when it contains a comma)
2765 * lib/ui/default.ui: change shortcut of math menu to M-a.
2767 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2769 * src/vspace.C (nextToken): use isStrDbl() to check for proper
2772 * src/LyXView.C (updateWindowTitle): show the full files name in
2773 window title, limited to 30 characters.
2775 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
2776 When a number of characters has been given, we should not assume
2777 that the string is 0-terminated.
2779 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
2780 calls (fixes some memory leaks)
2782 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
2783 trans member on exit.
2785 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2787 * src/converter.C (GetReachable): fix typo.
2789 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
2790 understand ',' instead of '.'.
2791 (GetInteger): rewrite to use strToInt().
2793 2000-09-26 Juergen Vigna <jug@sad.it>
2795 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
2796 better visibility and error-message on wrong VSpace input.
2798 * src/language.C (initL): added english again.
2800 2000-09-25 Juergen Vigna <jug@sad.it>
2802 * src/frontends/kde/Dialogs.C (Dialogs):
2803 * src/frontends/gnome/Dialogs.C (Dialogs):
2804 * src/frontends/kde/Makefile.am:
2805 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
2807 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
2809 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
2811 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
2813 * src/frontends/xforms/FormParagraph.C:
2814 * src/frontends/xforms/FormParagraph.h:
2815 * src/frontends/xforms/form_paragraph.C:
2816 * src/frontends/xforms/form_paragraph.h:
2817 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
2820 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
2822 * src/tabular.C (OldFormatRead): forgot to delete the temporary
2823 Paragraph-Data after use.
2825 * src/insets/insettext.C (LocalDispatch): don't set the layout on
2826 non breakable paragraphs.
2828 2000-09-25 Garst R. Reese <reese@isn.net>
2830 * src/language.C (initL): added missing language_country codes.
2832 2000-09-25 Juergen Vigna <jug@sad.it>
2834 * src/insets/insettext.C (InsetText):
2835 (deleteLyXText): remove the not released LyXText structure!
2837 2000-09-24 Marko Vendelin <markov@ioc.ee>
2839 * src/frontends/gnome/mainapp.C
2840 * src/frontends/gnome/mainapp.h: added support for keyboard
2843 * src/frontends/gnome/FormCitation.C
2844 * src/frontends/gnome/FormCitation.h
2845 * src/frontends/gnome/Makefile.am
2846 * src/frontends/gnome/pixbutton.h: completed the rewrite of
2847 FormCitation to use "action area" in mainapp window
2849 * src/frontends/gnome/Menubar_pimpl.C
2850 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
2853 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
2855 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
2856 width/descent/ascent values if name is empty.
2857 (mathed_string_height): Use std::max.
2859 2000-09-25 Allan Rae <rae@lyx.org>
2861 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
2862 segfault. This will be completely redesigned soon.
2864 * sigc++: updated libsigc++. Fixes struct timespec bug.
2866 * development/tools/makeLyXsigc.sh: .cvsignore addition
2868 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
2870 * several files: removed almost all traces of the old table
2873 * src/TableLayout.C: removed file
2875 2000-09-22 Juergen Vigna <jug@sad.it>
2877 * src/frontends/kde/Dialogs.C: added credits forms.
2879 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
2881 * src/frontends/gnome/Dialogs.C: added some forms.
2883 * src/spellchecker.C (init_spell_checker): set language in pspell code
2884 (RunSpellChecker): some modifications for setting language string.
2886 * src/language.[Ch]: added language_country code.
2888 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
2890 * src/frontends/Dialogs.h: added new signal showError.
2891 Rearranged existing signals in some sort of alphabetical order.
2893 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
2894 FormError.[Ch], form_error.[Ch]
2895 * src/frontends/xforms/forms/makefile: added new file form_error.fd
2896 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
2898 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
2899 dialogs. I think that this can be used as the base to all these
2902 * src/frontends/xforms/FormError.[Ch]
2903 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
2904 implementation of InsetError dialog.
2906 * src/insets/inseterror.[Ch]: rendered GUI-independent.
2908 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
2909 * src/frontends/kde/Makefile.am: ditto
2911 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
2913 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
2914 macrobf. This fixes a bug of invisible text.
2916 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2918 * lib/doc/LaTeXConfig.lyx.in: updated.
2920 * src/language.C (initL): remove language "francais" and change a
2921 bit the names of the two other french variations.
2923 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
2924 string that may not be 0-terminated.
2926 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2928 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
2930 2000-09-20 Marko Vendelin <markov@ioc.ee>
2932 * src/frontends/gnome/FormCitation.C
2933 * src/frontends/gnome/FormIndex.C
2934 * src/frontends/gnome/FormToc.C
2935 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
2936 the variable initialization to shut up the warnings
2938 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2940 * src/table.[Ch]: deleted files
2942 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
2945 2000-09-18 Juergen Vigna <jug@sad.it>
2947 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
2948 problems with selection. Inserted new LFUN_PASTESELECTION.
2949 (InsetButtonPress): inserted handling of middle mouse-button paste.
2951 * src/spellchecker.C: changed word to word.c_str().
2953 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
2955 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
2956 included in the ``make dist'' tarball.
2958 2000-09-15 Juergen Vigna <jug@sad.it>
2960 * src/CutAndPaste.C (cutSelection): small fix return the right
2961 end position after cut inside one paragraph only.
2963 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
2964 we are locked as otherwise we don't have a valid cursor position!
2966 * src/insets/figinset.C (draw): small bugfix but why is this needed???
2968 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
2970 * src/frontends/kde/FormRef.C: added using directive.
2971 * src/frontends/kde/FormToc.C: ditto
2973 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
2975 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
2977 2000-09-19 Marko Vendelin <markov@ioc.ee>
2979 * src/frontends/gnome/Menubar_pimpl.C
2980 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
2981 Toc, ViewFormats, UpdateFormats, and ExportFormats.
2983 * src/frontends/gnome/mainapp.C
2984 * src/frontends/gnome/mainapp.h: support for menu update used
2987 * src/frontends/gnome/mainapp.C
2988 * src/frontends/gnome/mainapp.h: support for "action" area in the
2989 main window. This area is used by small simple dialogs, such as
2992 * src/frontends/gnome/FormIndex.C
2993 * src/frontends/gnome/FormIndex.h
2994 * src/frontends/gnome/FormUrl.C
2995 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
2998 * src/frontends/gnome/FormCitation.C
2999 * src/frontends/gnome/FormCitation.h: rewrite to use main window
3000 action area. Only "Insert new citation" is implemented.
3002 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3004 * src/buffer.C (Dispatch): fix call to Dispatch
3005 * src/insets/insetref.C (Edit): likewise
3006 * src/insets/insetparent.C (Edit): likewise
3007 * src/insets/insetinclude.C (include_cb): likewise
3008 * src/frontends/xforms/FormUrl.C (apply): likewise
3009 * src/frontends/xforms/FormToc.C (apply): likewise
3010 * src/frontends/xforms/FormRef.C (apply): likewise
3011 * src/frontends/xforms/FormIndex.C (apply): likewise
3012 * src/frontends/xforms/FormCitation.C (apply): likewise
3013 * src/lyxserver.C (callback): likewise
3014 * src/lyxfunc.C (processKeySym): likewise
3015 (Dispatch): likewise
3016 (Dispatch): likewise
3017 * src/lyx_cb.C (LayoutsCB): likewise
3019 * Makefile.am (sourcedoc): small change
3021 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
3023 * src/main.C (main): Don't make an empty GUIRunTime object. all
3024 methods are static. constify a bit remove unneded using + headers.
3026 * src/tabular.C: some more const to local vars move some loop vars
3028 * src/spellchecker.C: added some c_str after some word for pspell
3030 * src/frontends/GUIRunTime.h: add new static method setDefaults
3031 * src/frontends/xforms/GUIRunTime.C (setDefaults):
3032 * src/frontends/kde/GUIRunTime.C (setDefaults):
3033 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
3035 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
3036 with strnew in arg, use correct emptystring when calling SetName.
3038 * several files: remove all commented code with relation to
3039 HAVE_SSTREAM beeing false. We now only support stringstream and
3042 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3044 * src/lyxfunc.C: construct correctly the automatic new file
3047 * src/text2.C (IsStringInText): change type of variable i to shut
3050 * src/support/sstream.h: do not use namespaces if the compiler
3051 does not support them.
3053 2000-09-15 Marko Vendelin <markov@ioc.ee>
3054 * src/frontends/gnome/FormCitation.C
3055 * src/frontends/gnome/FormCitation.h
3056 * src/frontends/gnome/diainsertcitation_interface.c
3057 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
3058 regexp support to FormCitation [Gnome].
3060 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
3063 * configure.in: remove unused KDE/GTKGUI define
3065 * src/frontends/kde/FormRef.C
3066 * src/frontends/kde/FormRef.h
3067 * src/frontends/kde/formrefdialog.C
3068 * src/frontends/kde/formrefdialog.h: double click will
3069 go to reference, now it is possible to change a cross-ref
3072 * src/frontends/kde/FormToc.C
3073 * src/frontends/kde/FormToc.h
3074 * src/frontends/kde/formtocdialog.C
3075 * src/frontends/kde/formtocdialog.h: add a depth
3078 * src/frontends/kde/Makefile.am: add QtLyXView.h
3081 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
3083 * src/frontends/kde/FormCitation.h: added some using directives.
3085 * src/frontends/kde/FormToc.h: corrected definition of doTree.
3087 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
3090 * src/mathed/math_defs.h: redefine SetAlign to use string rather
3093 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3095 * src/buffer.C (pop_tag): revert for the second time a change by
3096 Lars, who seems to really hate having non-local loop variables :)
3098 * src/Lsstream.h: add "using" statements.
3100 * src/support/copy.C (copy): add a bunch of std:: qualifiers
3101 * src/buffer.C (writeFile): ditto
3103 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
3105 * src/buffer.C (writeFile): try to fix the locale modified format
3106 number to always be as we want it.
3108 * src/WorkArea.C (work_area_handler): try to workaround the bugs
3109 in XForms 0.89. C-space is now working again.
3111 * src/Lsstream.h src/support/sstream.h: new files.
3113 * also commented out all cases where strstream were used.
3115 * src/Bullet.h (c_str): remove method.
3117 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
3119 * a lot of files: get rid of "char const *" and "char *" is as
3120 many places as possible. We only want to use them in interaction
3121 with system of other libraries, not inside lyx.
3123 * a lot of files: return const object is not of pod type. This
3124 helps ensure that temporary objects is not modified. And fits well
3125 with "programming by contract".
3127 * configure.in: check for the locale header too
3129 * Makefile.am (sourcedoc): new tag for generation of doc++
3132 2000-09-14 Juergen Vigna <jug@sad.it>
3134 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
3135 callback to check which combo called it and do the right action.
3137 * src/combox.C (combo_cb): added combo * to the callbacks.
3138 (Hide): moved call of callback after Ungrab of the pointer.
3140 * src/intl.h: removed LCombo2 function.
3142 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
3143 function as this can now be handled in one function.
3145 * src/combox.h: added Combox * to callback prototype.
3147 * src/frontends/xforms/Toolbar_pimpl.C:
3148 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
3150 2000-09-14 Garst Reese <reese@isn.net>
3152 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
3153 moved usepackage{xxx}'s to beginning of file. Changed left margin
3154 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
3155 underlining from title. Thanks to John Culleton for useful suggestions.
3157 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3159 * src/lyxlex_pimpl.C (setFile): change error message to debug
3162 2000-09-13 Juergen Vigna <jug@sad.it>
3164 * src/frontends/xforms/FormDocument.C: implemented choice_class
3165 as combox and give callback to combo_language so OK/Apply is activated
3168 * src/bufferlist.C (newFile): small fix so already named files
3169 (via an open call) are not requested to be named again on the
3172 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
3174 * src/frontends/kde/Makefile.am
3175 * src/frontends/kde/FormRef.C
3176 * src/frontends/kde/FormRef.h
3177 * src/frontends/kde/formrefdialog.C
3178 * src/frontends/kde/formrefdialog.h: implement
3181 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
3183 * src/frontends/kde/formtocdialog.C
3184 * src/frontends/kde/formtocdialog.h
3185 * src/frontends/kde/FormToc.C
3186 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
3188 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
3190 * src/frontends/kde/FormCitation.C: fix thinko
3191 where we didn't always display the reference text
3194 * src/frontends/kde/formurldialog.C
3195 * src/frontends/kde/formurldialog.h
3196 * src/frontends/kde/FormUrl.C
3197 * src/frontends/kde/FormUrl.h: minor cleanups
3199 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
3201 * src/frontends/kde/Makefile.am
3202 * src/frontends/kde/FormToc.C
3203 * src/frontends/kde/FormToc.h
3204 * src/frontends/kde/FormCitation.C
3205 * src/frontends/kde/FormCitation.h
3206 * src/frontends/kde/FormIndex.C
3207 * src/frontends/kde/FormIndex.h
3208 * src/frontends/kde/formtocdialog.C
3209 * src/frontends/kde/formtocdialog.h
3210 * src/frontends/kde/formcitationdialog.C
3211 * src/frontends/kde/formcitationdialog.h
3212 * src/frontends/kde/formindexdialog.C
3213 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
3215 2000-09-12 Juergen Vigna <jug@sad.it>
3217 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
3220 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3222 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
3225 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
3227 * src/converter.C (Add, Convert): Added support for converter flags:
3228 needaux, resultdir, resultfile.
3229 (Convert): Added new parameter view_file.
3230 (dvips_options): Fixed letter paper option.
3232 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
3233 (Export, GetExportableFormats, GetViewableFormats): Added support
3236 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
3238 (easyParse): Fixed to work with new export code.
3240 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
3243 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
3245 * lib/bind/*.bind: Replaced
3246 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
3247 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
3249 2000-09-11 Juergen Vigna <jug@sad.it>
3251 * src/lyx_gui.C (runTime): uses global guiruntime variable.
3253 * src/main.C (main): now GUII defines global guiruntime!
3255 * src/frontends/gnome/GUIRunTime.C (initApplication):
3256 * src/frontends/kde/GUIRunTime.C (initApplication):
3257 * src/frontends/xforms/GUIRunTime.C (initApplication):
3258 * src/frontends/GUIRunTime.h: added new function initApplication.
3260 * src/spellchecker.C (sc_accept_word): change to add_to_session.
3262 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
3264 2000-09-08 Juergen Vigna <jug@sad.it>
3266 * src/lyx_gui.C (create_forms): don't display the "default" entry as
3267 we have already "Reset".
3269 * src/language.C (initL): inserted "default" language and made this
3270 THE default language (and not american!)
3272 * src/paragraph.C: inserted handling of "default" language!
3274 * src/lyxfont.C: ditto
3278 * src/paragraph.C: output the \\par only if we have a following
3279 paragraph otherwise it's not needed.
3281 2000-09-05 Juergen Vigna <jug@sad.it>
3283 * config/pspell.m4: added entry to lyx-flags
3285 * src/spellchecker.C: modified version from Kevin for using pspell
3287 2000-09-01 Marko Vendelin <markov@ioc.ee>
3288 * src/frontends/gnome/Makefile.am
3289 * src/frontends/gnome/FormCitation.C
3290 * src/frontends/gnome/FormCitation.h
3291 * src/frontends/gnome/diainsertcitation_callbacks.c
3292 * src/frontends/gnome/diainsertcitation_callbacks.h
3293 * src/frontends/gnome/diainsertcitation_interface.c
3294 * src/frontends/gnome/diainsertcitation_interface.h
3295 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
3296 dialog for Gnome frontend
3298 * src/main.C: Gnome libraries require keeping application name
3299 and its version as strings
3301 * src/frontends/gnome/mainapp.C: Change the name of the main window
3302 from GnomeLyX to PACKAGE
3304 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3306 * src/frontends/Liason.C: add "using: declaration.
3308 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
3310 * src/mathed/math_macro.C (Metrics): Set the size of the template
3312 * src/mathed/formulamacro.C (Latex): Fixed the returned value
3314 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
3316 * src/converter.C (add_options): New function.
3317 (SetViewer): Change $$FName into '$$FName'.
3318 (View): Add options when running xdvi
3319 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
3320 (Convert): The 3rd parameter is now the desired filename. Converts
3321 calls to lyx::rename if necessary.
3322 Add options when running dvips.
3323 (dvi_papersize,dvips_options): New methods.
3325 * src/exporter.C (Export): Use getLatexName() instead of fileName().
3327 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
3328 using a call to Converter::dvips_options.
3329 Fixed to work with nex export code.
3331 * src/support/copy.C
3332 * src/support/rename.C: New files
3334 * src/support/syscall.h
3335 * src/support/syscall.C: Added Starttype SystemDontWait.
3337 * lib/ui/default.ui: Changed to work with new export code
3339 * lib/configure.m4: Changed to work with new export code
3341 * src/encoding.C: Changed latex name for iso8859_7 encoding.
3343 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
3345 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
3346 so that code compiles with DEC cxx.
3348 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
3349 to work correctly! Also now supports the additional elements
3352 2000-09-01 Allan Rae <rae@lyx.org>
3354 * src/frontends/ButtonPolicies.C: renamed all the references to
3355 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
3357 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
3358 since it's a const not a type.
3360 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
3362 2000-08-31 Juergen Vigna <jug@sad.it>
3364 * src/insets/figinset.C: Various changes to look if the filename has
3365 an extension and if not add it for inline previewing.
3367 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3369 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
3370 make buttonStatus and isReadOnly be const methods. (also reflect
3371 this in derived classes.)
3373 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
3374 (nextState): change to be static inline, pass the StateMachine as
3376 (PreferencesPolicy): remove casts
3377 (OkCancelPolicy): remvoe casts
3378 (OkCancelReadOnlyPolicy): remove casts
3379 (NoRepeatedApplyReadOnlyPolicy): remove casts
3380 (OkApplyCancelReadOnlyPolicy): remove casts
3381 (OkApplyCancelPolicy): remove casts
3382 (NoRepeatedApplyPolicy): remove casts
3384 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
3386 * src/converter.C: added some using directives
3388 * src/frontends/ButtonPolicies.C: changes to overcome
3389 "need lvalue" error with DEC c++
3391 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
3392 to WMHideCB for DEC c++
3394 * src/frontends/xforms/Menubar_pimpl.C: added using directive
3396 * src/frontends/xforms/forms/form_document.C.patch: use C callback
3397 to BulletBMTableCB for DEC c++
3399 2000-08-31 Allan Rae <rae@lyx.org>
3401 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
3402 character dialog separately from old document dialogs combo_language.
3405 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
3407 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
3408 Removed LFUN_REF_CREATE.
3410 * src/MenuBackend.C: Added new tags: toc and references
3412 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
3413 (add_lastfiles, add_documents, add_formats): Removed the unused smn
3415 (add_toc, add_references): New methods.
3416 (create_submenu): Handle correctly the case when there is a
3417 seperator after optional menu items.
3419 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
3420 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
3421 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
3423 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
3425 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
3427 * src/converter.[Ch]: New file for converting between different
3430 * src/export.[Ch]: New file for exporting a LyX file to different
3433 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
3434 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
3435 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
3436 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
3437 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
3438 RunDocBook, MenuExport.
3440 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
3441 Exporter::Preview methods if NEW_EXPORT is defined.
3443 * src/buffer.C (Dispatch): Use Exporter::Export.
3445 * src/lyxrc.C: Added new tags: \converter and \viewer.
3448 * src/LyXAction.C: Define new lyx-function: buffer-update.
3449 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
3450 when NEW_EXPORT is defined.
3452 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
3454 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
3456 * lib/ui/default.ui: Added submenus "view" and "update" to the
3459 * src/filetools.C (GetExtension): New function.
3461 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
3463 2000-08-29 Allan Rae <rae@lyx.org>
3465 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
3467 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
3468 (EnableDocumentLayout): removed
3469 (DisableDocumentLayout): removed
3470 (build): make use of ButtonController's read-only handling to
3471 de/activate various objects. Replaces both of the above functions.
3473 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
3474 (readOnly): was read_only
3475 (refresh): fixed dumb mistakes with read_only_ handling
3477 * src/frontends/xforms/forms/form_document.fd:
3478 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
3479 tabbed dialogs so the tabs look more like tabs and so its easier to
3480 work out which is the current tab.
3482 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
3483 segfault with form_table
3485 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
3487 2000-08-28 Juergen Vigna <jug@sad.it>
3489 * acconfig.h: added USE_PSPELL.
3491 * src/config.h.in: added USE_PSPELL.
3493 * autogen.sh: added pspell.m4
3495 * config/pspell.m4: new file.
3497 * src/spellchecker.C: implemented support for pspell libary.
3499 2000-08-25 Juergen Vigna <jug@sad.it>
3501 * src/LyXAction.C (init): renamed LFUN_TABLE to
3502 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
3504 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
3506 * src/lyxscreen.h: add force_clear variable and fuction to force
3507 a clear area when redrawing in LyXText.
3509 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
3511 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
3513 * some whitespace and comment changes.
3515 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
3517 * src/buffer.C: up te LYX_FORMAT to 2.17
3519 2000-08-23 Juergen Vigna <jug@sad.it>
3521 * src/BufferView_pimpl.C (tripleClick): disable this when in a
3524 * src/insets/insettabular.C (pasteSelection): delete the insets
3525 LyXText as it is not valid anymore.
3526 (copySelection): new function.
3527 (pasteSelection): new function.
3528 (cutSelection): new function.
3529 (LocalDispatch): implemented cut/copy/paste of cell selections.
3531 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
3532 don't have a LyXText.
3534 * src/LyXAction.C (init): a NEW_TABULAR define too much.
3536 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
3539 2000-08-22 Juergen Vigna <jug@sad.it>
3541 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
3542 ifdef form_table out if NEW_TABULAR.
3544 2000-08-21 Juergen Vigna <jug@sad.it>
3546 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
3547 (draw): fixed draw position so that the cursor is positioned in the
3549 (InsetMotionNotify): hide/show cursor so the position is updated.
3550 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
3551 using cellstart() function where it should be used.
3553 * src/insets/insettext.C (draw): ditto.
3555 * src/tabular.C: fixed initialization of some missing variables and
3556 made BoxType into an enum.
3558 2000-08-22 Marko Vendelin <markov@ioc.ee>
3559 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
3560 stock menu item using action numerical value, not its string
3564 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
3566 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
3567 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
3569 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
3571 * src/frontends/xforms/GUIRunTime.C: new file
3573 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
3574 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
3576 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
3578 * src/frontends/kde/GUIRunTime.C: new file
3580 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
3581 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
3583 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
3585 * src/frontends/gnome/GUIRunTime.C: new file
3587 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
3590 * src/frontends/GUIRunTime.h: removed constructor and destructor,
3591 small change to documetentation.
3593 * src/frontends/GUIRunTime.C: removed file
3595 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
3597 * src/lyxparagraph.h: enable NEW_TABULAR as default
3599 * src/lyxfunc.C (processKeySym): remove some commented code
3601 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
3602 NEW_TABULAR around the fd_form_table_options.
3604 * src/lyx_gui.C (runTime): call the static member function as
3605 GUIRunTime::runTime().
3607 2000-08-21 Allan Rae <rae@lyx.org>
3609 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
3612 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
3614 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
3616 2000-08-21 Allan Rae <rae@lyx.org>
3618 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
3619 keep Garst happy ;-)
3620 * src/frontends/xforms/FormPreferences.C (build): use setOK
3621 * src/frontends/xforms/FormDocument.C (build): use setOK
3622 (FormDocument): use the appropriate policy.
3624 2000-08-21 Allan Rae <rae@lyx.org>
3626 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
3627 automatic [de]activation of arbitrary objects when in a read-only state.
3629 * src/frontends/ButtonPolicies.h: More documentation
3630 (isReadOnly): added to support the above.
3632 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
3634 2000-08-18 Juergen Vigna <jug@sad.it>
3636 * src/insets/insettabular.C (getStatus): changed to return func_status.
3638 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
3639 display toggle menu entries if they are.
3641 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
3642 new document layout now.
3644 * src/lyxfunc.C: ditto
3646 * src/lyx_gui_misc.C: ditto
3648 * src/lyx_gui.C: ditto
3650 * lib/ui/default.ui: removed paper and quotes layout as they are now
3651 all in the document layout tabbed folder.
3653 * src/frontends/xforms/forms/form_document.fd: added Restore
3654 button and callbacks for all inputs for Allan's ButtonPolicy.
3656 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
3657 (CheckChoiceClass): added missing params setting on class change.
3658 (UpdateLayoutDocument): added for updating the layout on params.
3659 (build): forgot to RETURN_ALWAYS input_doc_spacing.
3660 (FormDocument): Implemented Allan's ButtonPolicy with the
3663 2000-08-17 Allan Rae <rae@lyx.org>
3665 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
3666 so we can at least see the credits again.
3668 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
3669 controller calls for the appropriate callbacks. Note that since Ok
3670 calls apply followed by cancel, and apply isn't a valid input for the
3671 APPLIED state, the bc_ calls have to be made in the static callback not
3672 within each of the real callbacks.
3674 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
3675 (setOk): renamed from setOkay()
3677 2000-08-17 Juergen Vigna <jug@sad.it>
3679 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
3680 in the implementation part.
3681 (composeUIInfo): don't show optional menu-items.
3683 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
3685 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
3687 * src/bufferview_funcs.C (CurrentState): fixed to show also the
3688 text-state when in a text-inset.
3690 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
3692 2000-08-17 Marko Vendelin <markov@ioc.ee>
3693 * src/frontends/gnome/FormIndex.C
3694 * src/frontends/gnome/FormIndex.h
3695 * src/frontends/gnome/FormToc.C
3696 * src/frontends/gnome/FormToc.h
3697 * src/frontends/gnome/dialogs
3698 * src/frontends/gnome/diatoc_callbacks.c
3699 * src/frontends/gnome/diatoc_callbacks.h
3700 * src/frontends/gnome/diainsertindex_callbacks.h
3701 * src/frontends/gnome/diainsertindex_callbacks.c
3702 * src/frontends/gnome/diainsertindex_interface.c
3703 * src/frontends/gnome/diainsertindex_interface.h
3704 * src/frontends/gnome/diatoc_interface.h
3705 * src/frontends/gnome/diatoc_interface.c
3706 * src/frontends/gnome/Makefile.am: Table of Contents and
3707 Insert Index dialogs implementation for Gnome frontend
3709 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
3711 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
3713 * src/frontends/gnome/diainserturl_interface.c: make the dialog
3716 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
3718 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
3719 destructor. Don't definde if you don't need it
3720 (processEvents): made static, non-blocking events processing for
3722 (runTime): static method. event loop for xforms
3723 * similar as above for kde and gnome.
3725 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
3726 new Pimpl is correct
3727 (runTime): new method calss the real frontends runtime func.
3729 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
3731 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
3733 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
3735 2000-08-16 Juergen Vigna <jug@sad.it>
3737 * src/lyx_gui.C (runTime): added GUII RunTime support.
3739 * src/frontends/Makefile.am:
3740 * src/frontends/GUIRunTime.[Ch]:
3741 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
3742 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
3743 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
3745 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
3747 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
3748 as this is already set in ${FRONTEND_INCLUDE} if needed.
3750 * configure.in (CPPFLAGS): setting the include dir for the frontend
3751 directory and don't set FRONTEND=xforms for now as this is executed
3754 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
3756 * src/frontends/kde/Makefile.am:
3757 * src/frontends/kde/FormUrl.C:
3758 * src/frontends/kde/FormUrl.h:
3759 * src/frontends/kde/formurldialog.h:
3760 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
3762 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
3764 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
3766 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
3768 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
3771 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
3773 * src/WorkArea.C (work_area_handler): more work to get te
3774 FL_KEYBOARD to work with xforms 0.88 too, please test.
3776 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
3778 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
3780 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
3783 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
3785 * src/Timeout.h: remove Qt::emit hack.
3787 * several files: changes to allo doc++ compilation
3789 * src/lyxfunc.C (processKeySym): new method
3790 (processKeyEvent): comment out if FL_REVISION < 89
3792 * src/WorkArea.C: change some debugging levels.
3793 (WorkArea): set wantkey to FL_KEY_ALL
3794 (work_area_handler): enable the FL_KEYBOARD clause, this enables
3795 clearer code and the use of compose with XForms 0.89. Change to
3796 use signals instead of calling methods in bufferview directly.
3798 * src/Painter.C: change some debugging levels.
3800 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
3803 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
3804 (workAreaKeyPress): new method
3806 2000-08-14 Juergen Vigna <jug@sad.it>
3808 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
3810 * config/kde.m4: addes some features
3812 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
3813 include missing xforms dialogs.
3815 * src/Timeout.h: a hack to be able to compile with qt/kde.
3817 * sigc++/.cvsignore: added acinclude.m4
3819 * lib/.cvsignore: added listerros
3821 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
3822 xforms tree as objects are needed for other frontends.
3824 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
3825 linking with not yet implemented xforms objects.
3827 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
3829 2000-08-14 Baruch Even <baruch.even@writeme.com>
3831 * src/frontends/xforms/FormGraphics.h:
3832 * src/frontends/xforms/FormGraphics.C:
3833 * src/frontends/xforms/RadioButtonGroup.h:
3834 * src/frontends/xforms/RadioButtonGroup.C:
3835 * src/insets/insetgraphics.h:
3836 * src/insets/insetgraphics.C:
3837 * src/insets/insetgraphicsParams.h:
3838 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
3839 instead of spaces, and various other indentation issues to make the
3840 sources more consistent.
3842 2000-08-14 Marko Vendelin <markov@ioc.ee>
3844 * src/frontends/gnome/dialogs/diaprint.glade
3845 * src/frontends/gnome/FormPrint.C
3846 * src/frontends/gnome/FormPrint.h
3847 * src/frontends/gnome/diaprint_callbacks.c
3848 * src/frontends/gnome/diaprint_callbacks.h
3849 * src/frontends/gnome/diaprint_interface.c
3850 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
3853 * src/frontends/gnome/dialogs/diainserturl.glade
3854 * src/frontends/gnome/FormUrl.C
3855 * src/frontends/gnome/FormUrl.h
3856 * src/frontends/gnome/diainserturl_callbacks.c
3857 * src/frontends/gnome/diainserturl_callbacks.h
3858 * src/frontends/gnome/diainserturl_interface.c
3859 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
3860 Gnome implementation
3862 * src/frontends/gnome/Dialogs.C
3863 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
3864 all other dialogs. Copy all unimplemented dialogs from Xforms
3867 * src/frontends/gnome/support.c
3868 * src/frontends/gnome/support.h: support files generated by Glade
3872 * config/gnome.m4: Gnome configuration scripts
3874 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
3875 configure --help message
3877 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
3878 only if there are no events pendling in Gnome/Gtk. This enhances
3879 the performance of menus.
3882 2000-08-14 Allan Rae <rae@lyx.org>
3884 * lib/Makefile.am: listerrors cleaning
3886 * lib/listerrors: removed -- generated file
3887 * acinclude.m4: ditto
3888 * sigc++/acinclude.m4: ditto
3890 * src/frontends/xforms/forms/form_citation.fd:
3891 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
3894 * src/frontends/xforms/forms/makefile: I renamed the `install` target
3895 `updatesrc` and now we have a `test` target that does what `updatesrc`
3896 used to do. I didn't like having an install target that wasn't related
3899 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
3900 on all except FormGraphics. This may yet happen. Followed by a major
3901 cleanup including using FL_TRANSIENT for most of the dialogs. More
3902 changes to come when the ButtonController below is introduced.
3904 * src/frontends/xforms/ButtonController.h: New file for managing up to
3905 four buttons on a dialog according to an externally defined policy.
3906 * src/frontends/xforms/Makefile.am: added above
3908 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
3909 Apply and Cancel/Close buttons and everything in between and beyond.
3910 * src/frontends/Makefile.am: added above.
3912 * src/frontends/xforms/forms/form_preferences.fd:
3913 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
3914 and removed variable 'status' as a result. Fixed the set_minsize thing.
3915 Use the new screen-font-update after checking screen fonts were changed
3916 Added a "Restore" button to restore the original lyxrc values while
3917 editing. This restores everything not just the last input changed.
3918 That's still a tricky one. As is the "LyX: this shouldn't happen..."
3920 * src/LyXAction.C: screen-font-update added for updating buffers after
3921 screen font settings have been changed.
3922 * src/commandtags.h: ditto
3923 * src/lyxfunc.C: ditto
3925 * forms/lyx.fd: removed screen fonts dialog.
3926 * src/lyx_gui.C: ditto
3927 * src/menus.[Ch]: ditto
3928 * src/lyx.[Ch]: ditto
3929 * src/lyx_cb.C: ditto + code from here moved to make
3930 screen-font-update. And people wonder why progress on GUII is
3931 slow. Look at how scattered this stuff was! It takes forever
3934 * forms/fdfix.sh: Fixup the spacing after commas.
3935 * forms/makefile: Remove date from generated files. Fewer clashes now.
3936 * forms/bullet_forms.C.patch: included someones handwritten changes
3938 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
3939 once I've discovered why LyXRC was made noncopyable.
3940 * src/lyx_main.C: ditto
3942 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
3944 * src/frontends/xforms/forms/fdfix.sh:
3945 * src/frontends/xforms/forms/fdfixh.sed:
3946 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
3947 * src/frontends/xforms/Form*.[hC]:
3948 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
3949 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
3950 provide a destructor for the struct FD_form_xxxx. Another version of
3951 the set_[max|min]size workaround and a few other cleanups. Actually,
3952 Angus' patch from 20000809.
3954 2000-08-13 Baruch Even <baruch.even@writeme.com>
3956 * src/insets/insetgraphics.C (Clone): Added several fields that needed
3959 2000-08-11 Juergen Vigna <jug@sad.it>
3961 * src/insets/insetgraphics.C (InsetGraphics): changing init
3962 order because of warnings.
3964 * src/frontends/xforms/forms/makefile: adding patching .C with
3967 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
3968 from .C.patch to .c.patch
3970 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
3971 order because of warning.
3973 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
3975 * src/frontends/Liason.C (setMinibuffer): new helper function
3977 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
3979 * src/lyxfunc.C (Dispatch): calling new Document-Layout
3981 * lib/ui/default.ui: commented out PaperLayout entry
3983 * src/frontends/xforms/form_document.[Ch]: new added files
3985 * src/frontends/xforms/FormDocument.[Ch]: ditto
3987 * src/frontends/xforms/forms/form_document.fd: ditto
3989 * src/frontends/xforms/forms/form_document.C.patch: ditto
3991 2000-08-10 Juergen Vigna <jug@sad.it>
3993 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
3994 (InsetGraphics): initialized cacheHandle to 0.
3995 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
3997 2000-08-10 Baruch Even <baruch.even@writeme.com>
3999 * src/graphics/GraphicsCache.h:
4000 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
4001 correctly as a cache.
4003 * src/graphics/GraphicsCacheItem.h:
4004 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
4007 * src/graphics/GraphicsCacheItem_pimpl.h:
4008 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
4011 * src/insets/insetgraphics.h:
4012 * src/insets/insetgraphics.C: Changed from using a signal notification
4013 to polling when image is not loaded.
4015 2000-08-10 Allan Rae <rae@lyx.org>
4017 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
4018 that there are two functions that have to been taken out of line by
4019 hand and aren't taken care of in the script. (Just a reminder note)
4021 * sigc++/macros/*.h.m4: Updated as above.
4023 2000-08-09 Juergen Vigna <jug@sad.it>
4025 * src/insets/insettext.C (draw): small fix for clearing rectangle.
4027 * src/insets/insettabular.C: make drawing of single cell smarter.
4029 2000-08-09 Marko Vendelin <markov@ioc.ee>
4030 * src/frontends/gnome/Menubar_pimpl.C
4031 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
4032 implementation: new files
4034 * src/frontends/gnome/mainapp.C
4035 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
4038 * src/main.C: create Gnome main window
4040 * src/frontends/xforms/Menubar_pimpl.h
4041 * src/frontends/Menubar.C
4042 * src/frontends/Menubar.h: added method Menubar::update that calls
4043 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
4045 * src/LyXView.C: calls Menubar::update to update the state
4048 * src/frontends/gnome/Makefile.am: added new files
4050 * src/frontends/Makefile.am: added frontend compiler options
4052 2000-08-08 Juergen Vigna <jug@sad.it>
4054 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
4056 * src/bufferlist.C (close):
4057 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
4058 documents if exiting without saving.
4060 * src/buffer.C (save): use removeAutosaveFile()
4062 * src/support/filetools.C (removeAutosaveFile): new function.
4064 * src/lyx_cb.C (MenuWrite): returns a bool now.
4065 (MenuWriteAs): check if file could really be saved and revert to the
4067 (MenuWriteAs): removing old autosavefile if existant.
4069 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
4070 before Goto toggle declaration, because of compiler warning.
4072 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
4074 * src/lyxfunc.C (MenuNew): small fix.
4076 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
4078 * src/bufferlist.C (newFile):
4079 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
4081 * src/lyxrc.C: added new_ask_filename tag
4083 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
4085 * src/lyx.fd: removed code pertaining to form_ref
4086 * src/lyx.[Ch]: ditto
4087 * src/lyx_cb.C: ditto
4088 * src/lyx_gui.C: ditto
4089 * src/lyx_gui_misc.C: ditto
4091 * src/BufferView_pimpl.C (restorePosition): update buffer only
4094 * src/commandtags.h (LFUN_REFTOGGLE): removed
4095 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
4096 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
4097 (LFUN_REFBACK): renamed LFUN_REF_BACK
4099 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
4100 * src/menus.C: ditto
4101 * src/lyxfunc.C (Dispatch): ditto.
4102 InsertRef dialog is now GUI-independent.
4104 * src/texrow.C: added using std::endl;
4106 * src/insets/insetref.[Ch]: strip out large amounts of code.
4107 The inset is now a container and this functionality is now
4108 managed by a new FormRef dialog
4110 * src/frontends/Dialogs.h (showRef, createRef): new signals
4112 * src/frontends/xforms/FormIndex.[Ch],
4113 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
4114 when setting dialog's min/max size
4115 * src/frontends/xforms/FormIndex.[Ch]: ditto
4117 * src/frontends/xforms/FormRef.[Ch],
4118 src/frontends/xforms/forms/form_ref.fd: new xforms
4119 implementation of an InsetRef dialog
4121 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
4124 * src/graphics/XPM_Renderer.C (isImageFormatOK):
4125 ios::nocreate is not part of the standard. Removed.
4127 2000-08-07 Baruch Even <baruch.even@writeme.com>
4129 * src/graphics/Renderer.h:
4130 * src/graphics/Renderer.C: Added base class for rendering of different
4131 image formats into Pixmaps.
4133 * src/graphics/XPM_Renderer.h:
4134 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
4135 in a different class.
4137 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
4138 easily add support for other formats.
4140 * src/insets/figinset.C: plugged a leak of an X resource.
4142 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
4144 * src/CutAndPaste.[Ch]: make all metods static.
4146 * development/Code_rules/Rules: more work, added section on
4147 Exceptions, and a References section.
4149 * a lot of header files: work to make doc++ able to generate the
4150 source documentation, some workarounds of doc++ problems. Doc++ is
4151 now able to generate the documentation.
4153 2000-08-07 Juergen Vigna <jug@sad.it>
4155 * src/insets/insettabular.C (recomputeTextInsets): removed function
4157 * src/tabular.C (SetWidthOfMulticolCell):
4159 (calculate_width_of_column_NMC): fixed return value so that it really
4160 only returns true if the column-width has changed (there where
4161 problems with muliticolumn-cells in this column).
4163 2000-08-04 Juergen Vigna <jug@sad.it>
4165 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
4166 also on the scrollstatus of the inset.
4167 (workAreaMotionNotify): ditto.
4169 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
4171 2000-08-01 Juergen Vigna <jug@sad.it>
4173 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
4175 * src/commandtags.h:
4176 * src/LyXAction.C (init):
4177 * src/insets/inset.C (LocalDispatch): added support for
4180 * src/insets/inset.C (scroll): new functions.
4182 * src/insets/insettext.C (removeNewlines): new function.
4183 (SetAutoBreakRows): removes forced newlines in the text of the
4184 paragraph if autoBreakRows is set to false.
4186 * src/tabular.C (Latex): generates a parbox around the cell contents
4189 * src/frontends/xforms/FormTabular.C (local_update): removed
4190 the radio_useparbox button.
4192 * src/tabular.C (UseParbox): new function
4194 2000-08-06 Baruch Even <baruch.even@writeme.com>
4196 * src/graphics/GraphicsCache.h:
4197 * src/graphics/GraphicsCache.C:
4198 * src/graphics/GraphicsCacheItem.h:
4199 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
4202 * src/insets/insetgraphics.h:
4203 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
4204 and the drawing of the inline image.
4206 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
4207 loaded into the wrong position.
4209 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
4212 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4214 * src/support/translator.h: move all typedefs to public section
4216 * src/support/filetools.C (MakeLatexName): return string const
4218 (TmpFileName): ditto
4219 (FileOpenSearch): ditto
4221 (LibFileSearch): ditto
4222 (i18nLibFileSearch): ditto
4225 (CreateTmpDir): ditto
4226 (CreateBufferTmpDir): ditto
4227 (CreateLyXTmpDir): ditto
4230 (MakeAbsPath): ditto
4232 (OnlyFilename): ditto
4234 (NormalizePath): ditto
4235 (CleanupPath): ditto
4236 (GetFileContents): ditto
4237 (ReplaceEnvironmentPath): ditto
4238 (MakeRelPath): ditto
4240 (ChangeExtension): ditto
4241 (MakeDisplayPath): ditto
4242 (do_popen): return cmdret const
4243 (findtexfile): return string const
4245 * src/support/DebugStream.h: add some /// to please doc++
4247 * src/frontends/DialogBase.h (endif): add some /// to please doc++
4249 * src/texrow.C (same_rownumber): functor to use with find_if
4250 (getIdFromRow): rewritten to use find_if and to not update the
4251 positions. return true if row is found
4252 (increasePos): new method, use to update positions
4254 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
4256 * src/lyxlex_pimpl.C (verifyTable): new method
4259 (GetString): return string const
4260 (pushTable): rewrite to use std::stack
4262 (setFile): better check
4265 * src/lyxlex.h: make LyXLex noncopyable
4267 * src/lyxlex.C (text): return char const * const
4268 (GetString): return string const
4269 (getLongString): return string const
4271 * src/lyx_gui_misc.C (askForText): return pair<...> const
4273 * src/lastfiles.[Ch] (operator): return string const
4275 * src/buffer.C (parseSingleLyXformat2Token): pass string to
4276 istringstream not char const *.
4277 move token.end() out of loop.
4278 (readFile): move initializaton of token
4280 * src/BufferView2.C (insertErrors): run texrow.increasePos if
4281 getIdFromRow is successful.
4283 * lib/bind/emacs.bind: don't include menus bind
4285 * development/Code_rules/Rules: the beginnings of making this
4286 better and covering more of the unwritten rules that we have.
4288 * development/Code_rules/Recommendations: a couple of wording
4291 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4293 * src/support/strerror.c: remove C++ comment.
4295 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
4297 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
4298 LFUN_INDEX_INSERT_LAST
4300 * src/texrow.C (getIdFromRow): changed from const_iterator to
4301 iterator, allowing code to compile with DEC cxx
4303 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
4304 stores part of the class, as suggested by Allan. Will allow
4306 (apply): test to apply uses InsetCommandParams operator!=
4308 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
4309 (apply): test to apply uses InsetCommandParams operator!=
4311 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
4312 stores part of the class.
4313 (update): removed limits on min/max size.
4315 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
4316 (apply): test to apply uses InsetCommandParams operator!=
4318 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
4319 (Read, Write, scanCommand, getCommand): moved functionality
4320 into InsetCommandParams.
4322 (getScreenLabel): made pure virtual
4323 new InsetCommandParams operators== and !=
4325 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
4326 c-tors based on InsetCommandParams. Removed others.
4327 * src/insets/insetinclude.[Ch]: ditto
4328 * src/insets/insetlabel.[Ch]: ditto
4329 * src/insets/insetparent.[Ch]: ditto
4330 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
4332 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
4333 insets derived from InsetCommand created using similar c-tors
4334 based on InsetCommandParams
4335 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
4336 * src/menus.C (ShowRefsMenu): ditto
4337 * src/paragraph.C (Clone): ditto
4338 * src/text2.C (SetCounter): ditto
4339 * src/lyxfunc.C (Dispatch) ditto
4340 Also recreated old InsetIndex behaviour exactly. Can now
4341 index-insert at the start of a paragraph and index-insert-last
4342 without launching the pop-up.
4344 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
4346 * lib/lyxrc.example: mark te pdf options as non functional.
4348 * src/support/lstrings.C (strToInt): move initalization of tmpstr
4349 (isStrDbl): move tmpstr.end() out of loop.
4350 (strToDbl): move intialization of tmpstr
4351 (lowercase): return string const and move tmp.end() out of loop.
4352 (uppercase): return string const and move tmp.edn() out of loop.
4353 (prefixIs): add assertion
4358 (containsOnly): ditto
4359 (containsOnly): ditto
4360 (containsOnly): ditto
4361 (countChar): make last arg char not char const
4362 (token): return string const
4363 (subst): return string const, move tmp.end() out of loop.
4364 (subst): return string const, add assertion
4365 (strip): return string const
4366 (frontStrip): return string const, add assertion
4367 (frontStrip): return string const
4372 * src/support/lstrings.C: add inclde "LAssert.h"
4373 (isStrInt): move tmpstr.end() out of loop.
4375 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
4376 toollist.end() out of loop.
4377 (deactivate): move toollist.end() out of loop.
4378 (update): move toollist.end() out of loop.
4379 (updateLayoutList): move tc.end() out of loop.
4380 (add): move toollist.end() out of loop.
4382 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
4383 md.end() out of loop.
4385 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
4387 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
4390 * src/paragraph.C (Erase): move fontlist.end() out of loop.
4391 (Erase): move insetlist.end() out of loop.
4393 * src/lyx_sendfax_main.C: make show_logfile static and to take a
4394 ref to const string as first arg. Move initialization of some
4395 variables, whitespace changes.
4397 * src/kbmap.C (defkey): move table.end() out of loop.
4398 (kb_keymap): move table.end() out of loop.
4399 (findbinding): move table.end() out of loop.
4401 * src/MenuBackend.C (hasMenu): move end() out of loop.
4402 (getMenu): move end() out of loop.
4403 (getMenu): move menulist_.end() out of loop.
4405 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
4407 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
4410 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
4411 (getFromLyXName): move infotab.end() out of loop.
4413 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
4414 -fvtable-thunks -ffunction-sections -fdata-sections
4416 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
4418 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
4421 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
4423 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
4425 * src/frontends/xforms/FormCitation.[Ch],
4426 src/frontends/xforms/FormIndex.[Ch],
4427 src/frontends/xforms/FormToc.[Ch],
4428 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
4430 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
4432 * src/commandtags.h: renamed, created some flags for citation
4435 * src/lyx_gui_misc.C: stripped out old FD_index_form code
4437 * src/lyxfunc.C (dispatch): use signals to insert index entry
4439 * src/frontends/Dialogs.h: new signal createIndex
4441 * src/frontends/xforms/FormCommand.[Ch],
4442 src/frontends/xforms/FormCitation.[Ch],
4443 src/frontends/xforms/FormToc.[Ch],
4444 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
4446 * src/insets/insetindex.[Ch]: GUI-independent
4448 * src/frontends/xforms/FormIndex.[Ch],
4449 * src/frontends/xforms/forms/form_index.fd: xforms implementation
4452 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
4454 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
4455 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
4457 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
4459 * src/insets/insetref.C (Latex): rewrite so that there is now
4460 question that a initialization is requested.
4462 * src/insets/insetcommand.h: reenable the hide signal
4464 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4466 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
4467 fix handling of shortcuts (many bugs :)
4468 (add_lastfiles): ditto.
4470 * lib/ui/default.ui: fix a few shortcuts.
4472 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
4474 * Makefile.am: Fix ``rpmdist'' target to return the exit
4475 status of the ``rpm'' command, instead of the last command in
4476 the chain (the ``rm lyx.xpm'' command, which always returns
4479 2000-08-02 Allan Rae <rae@lyx.org>
4481 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
4482 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
4483 * src/frontends/xforms/FormToc.C (FormToc): ditto
4485 * src/frontends/xforms/Makefile.am: A few forgotten files
4487 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
4488 Signals-not-copyable-problem Lars' started commenting out.
4490 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
4492 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4494 * src/insets/insetcommand.h: Signals is not copyable so anoter
4495 scheme for automatic hiding of forms must be used.
4497 * src/frontends/xforms/FormCitation.h: don't inerit from
4498 noncopyable, FormCommand already does that.
4499 * src/frontends/xforms/FormToc.h: ditto
4500 * src/frontends/xforms/FormUrl.h: ditto
4502 * src/frontends/xforms/FormCitation.C: add include <algorithm>
4504 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
4506 * src/insets/insetcommand.h (hide): new SigC::Signal0
4507 (d-tor) new virtual destructor emits hide signal
4509 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
4510 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
4512 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
4513 LOF and LOT. Inset is now GUI-independent
4515 * src/insets/insetloa.[Ch]: redundant
4516 * src/insets/insetlof.[Ch]: ditto
4517 * src/insets/insetlot.[Ch]: ditto
4519 * src/frontends/xforms/forms/form_url.fd: tweaked!
4520 * src/frontends/xforms/forms/form_citation.fd: ditto
4522 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
4523 dialogs dealing with InsetCommand insets
4525 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
4526 FormCommand base class
4527 * src/frontends/xforms/FormUrl.[Ch]: ditto
4529 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
4531 * src/frontends/xforms/FormToc.[Ch]: ditto
4533 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
4534 passed a generic InsetCommand pointer
4535 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
4537 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
4538 and modified InsetTOC class
4539 * src/buffer.C: ditto
4541 * forms/lyx.fd: strip out old FD_form_toc code
4542 * src/lyx_gui_misc.C: ditto
4543 * src/lyx_gui.C: ditto
4544 * src/lyx_cb.C: ditto
4545 * src/lyx.[Ch]: ditto
4547 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4549 * src/support/utility.hpp: tr -d '\r'
4551 2000-08-01 Juergen Vigna <jug@sad.it>
4553 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
4555 * src/commandtags.h:
4556 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
4557 LFUN_TABULAR_FEATURES.
4559 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
4560 LFUN_LAYOUT_TABULAR.
4562 * src/insets/insettabular.C (getStatus): implemented helper function.
4564 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
4566 2000-07-31 Juergen Vigna <jug@sad.it>
4568 * src/text.C (draw): fixed screen update problem for text-insets.
4570 * src/text2.C (SetParagrpah): call an update of the inset-owner when
4571 something changed probably this has to be added in various other
4574 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
4576 2000-07-31 Baruch Even <baruch.even@writeme.com>
4578 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
4579 templates to satisfy compaq cxx.
4582 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4584 * src/support/translator.h (equal_1st_in_pair::operator()): take
4585 const ref pair_type as arg.
4586 (equal_2nd_in_pair::operator()): ditto
4587 (Translator::~Translator): remove empty d-tor.
4589 * src/graphics/GraphicsCache.C: move include config.h to top, also
4590 put initialization of GraphicsCache::singleton here.
4591 (~GraphicsCache): move here
4592 (addFile): take const ref as arg
4595 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
4597 * src/BufferView2.C (insertLyXFile): change te with/without header
4600 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4602 * src/frontends/xforms/FormGraphics.C (apply): add some
4603 static_cast. Not very nice, but required by compaq cxx.
4605 * src/frontends/xforms/RadioButtonGroup.h: include header
4606 <utility> instead of <pair.h>
4608 * src/insets/insetgraphicsParams.C: add using directive.
4609 (readResize): change return type to void.
4610 (readOrigin): ditto.
4612 * src/lyxfunc.C (getStatus): add missing break for build-program
4613 function; add test for Literate for export functions.
4615 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
4616 entries in Options menu.
4618 2000-07-31 Baruch Even <baruch.even@writeme.com>
4620 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
4621 protect against auto-allocation; release icon when needed.
4623 2000-07-31 Matej Cepl <CeplM@seznam.cz>
4625 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
4626 on usual typewriter.
4628 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
4629 earlier czech.kmap), useful only for programming.
4631 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4633 * src/frontends/xforms/FormCitation.h: fix conditioning around
4636 2000-07-31 Juergen Vigna <jug@sad.it>
4638 * src/frontends/xforms/FormTabular.C (local_update): changed
4639 radio_linebreaks to radio_useparbox and added radio_useminipage.
4641 * src/tabular.C: made support for using minipages/parboxes.
4643 * src/bufferlist.C (QwriteAll): small fix for asking for save.
4645 * src/insets/insetgraphics.C (draw): just draw the inset so that the
4647 (descent): so the cursor is in the middle.
4648 (width): bit smaller box.
4650 * src/insets/insetgraphics.h: added display() function.
4652 2000-07-31 Baruch Even <baruch.even@writeme.com>
4654 * src/frontends/Dialogs.h: Added showGraphics signals.
4656 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
4657 xforms form definition of the graphics dialog.
4659 * src/frontends/xforms/FormGraphics.h:
4660 * src/frontends/xforms/FormGraphics.C: Added files, the
4661 GUIndependent code of InsetGraphics
4663 * src/insets/insetgraphics.h:
4664 * src/insets/insetgraphics.C: Major writing to make it work.
4666 * src/insets/insetgraphicsParams.h:
4667 * src/insets/insetgraphicsParams.C: Added files, parameter passing
4668 struct between InsetGraphics and GUI.
4670 * src/LaTeXFeatures.h:
4671 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
4672 support for graphicx package.
4674 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
4675 for the graphics inset.
4677 * src/support/translator.h: Added file, used in
4678 InsetGraphicsParams. this is a template to translate between two
4681 * src/frontends/xforms/RadioButtonGroup.h:
4682 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
4683 way to easily control a radio button group.
4685 2000-07-28 Juergen Vigna <jug@sad.it>
4687 * src/insets/insettabular.C (LocalDispatch):
4688 (TabularFeatures): added support for lyx-functions of tabular features.
4689 (cellstart): refixed this function after someone wrongly changed it.
4691 * src/commandtags.h:
4692 * src/LyXAction.C (init): added support for tabular-features
4694 2000-07-28 Allan Rae <rae@lyx.org>
4696 * src/frontends/xforms/FormPreferences.C (build): Setup input return
4697 checking. NOTE: It seems that pressing ESC to cancel the dialog also
4698 triggers the callback for input checking. As a result we sometimes get
4699 "LyX: This shouldn't happen..." printed to cerr.
4700 (input): Started using status variable since I only free() on
4701 destruction. Some input checking for paths and font sizes.
4703 * src/frontends/xforms/FormPreferences.h: Use status to control
4704 activation of Ok and Apply
4706 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
4707 callback. Also resized to stop segfaults with 0.88. The problem is
4708 that xforms-0.88 requires the folder to be wide enough to fit all the
4709 tabs. If it isn't it causes all sorts of problems.
4711 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
4713 * src/frontends/xforms/forms/README: Reflect reality.
4715 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
4716 * src/frontends/xforms/forms/makefile: ditto.
4718 * src/commandtags.h: Get access to new Preferences dialog
4719 * src/LyXAction.C: ditto
4720 * src/lyxfunc.C: ditto
4721 * lib/ui/default.ui: ditto
4723 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4725 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
4727 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
4730 * src/frontends/xforms/form_url.[Ch]: added.
4732 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
4734 * src/insets/insetbib.h: fixed bug in previous commit
4736 * src/frontends/xforms/FormUrl.h: ditto
4738 * src/frontends/xforms/FormPrint.h: ditto
4740 * src/frontends/xforms/FormPreferences.h: ditto
4742 * src/frontends/xforms/FormCopyright.h: ditto
4744 * src/frontends/xforms/FormCitation.C: ditto
4746 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
4747 private copyconstructor and private default contructor
4749 * src/support/Makefile.am: add utility.hpp
4751 * src/support/utility.hpp: new file from boost
4753 * src/insets/insetbib.h: set owner in clone
4755 * src/frontends/xforms/FormCitation.C: added missing include
4758 * src/insets/form_url.[Ch]: removed
4760 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
4762 * development/lyx.spec.in
4763 * Makefile.am: Fix buglet for LyX RPM generation resulting from
4764 file/directory re-organization.
4766 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
4768 * src/insets/insetcommand.[Ch]: moved the string data and
4769 associated manipulation methods into a new stand-alone class
4770 InsetCommandParams. This class has two additional methods
4771 getAsString() and setFromString() allowing the contents to be
4772 moved around as a single string.
4773 (addContents) method removed.
4774 (setContents) method no longer virtual.
4776 * src/buffer.C (readInset): made use of new InsetCitation,
4777 InsetUrl constructors based on InsetCommandParams.
4779 * src/commandtags.h: add LFUN_INSERT_URL
4781 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
4782 independent InsetUrl and use InsetCommandParams to extract
4783 string info and create new Insets.
4785 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
4787 * src/frontends/xforms/FormCitation.C (apply): uses
4790 * src/frontends/xforms/form_url.C
4791 * src/frontends/xforms/form_url.h
4792 * src/frontends/xforms/FormUrl.h
4793 * src/frontends/xforms/FormUrl.C
4794 * src/frontends/xforms/forms/form_url.fd: new files
4796 * src/insets/insetcite.[Ch]: removed unused constructors.
4798 * src/insets/insetinclude.[Ch]: no longer store filename
4800 * src/insets/inseturl.[Ch]: GUI-independent.
4802 2000-07-26 Juergen Vigna <jug@sad.it>
4803 * renamed frontend from gtk to gnome as it is that what is realized
4804 and did the necessary changes in the files.
4806 2000-07-26 Marko Vendelin <markov@ioc.ee>
4808 * configure.in: cleaning up gnome configuration scripts
4810 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4812 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
4813 shortcuts syndrom by redrawing them explicitely (a better solution
4814 would be appreciated).
4816 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
4818 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
4821 * src/lyx_cb.C (MenuExport): change html export to do the right
4822 thing depending of the document type (instead of having
4823 html-linuxdoc and html-docbook).
4824 * src/lyxfunc.C (getStatus): update for html
4825 * lib/ui/default.ui: simplify due to the above change.
4826 * src/menus.C (ShowFileMenu): update too (in case we need it).
4828 * src/MenuBackend.C (read): if a menu is defined twice, add the
4829 new entries to the exiting one.
4831 2000-07-26 Juergen Vigna <jug@sad.it>
4833 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
4835 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
4836 and return a bool if it did actual save the file.
4837 (AutoSave): don't autosave a unnamed doc.
4839 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
4840 check if this is an UNNAMED new file and react to it.
4841 (newFile): set buffer to unnamed and change to not mark a new
4842 buffer dirty if I didn't do anything with it.
4844 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
4846 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4848 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
4849 friend as per Angus's patch posted to lyx-devel.
4851 * src/ext_l10n.h: updated
4853 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
4854 gettext on the style string right before inserting them into the
4857 * autogen.sh: add code to extract style strings form layout files,
4858 not good enough yet.
4860 * src/frontends/gtk/.cvsignore: add MAKEFILE
4862 * src/MenuBackend.C (read): run the label strings through gettext
4863 before storing them in the containers.
4865 * src/ext_l10n.h: new file
4867 * autogen.sh : generate the ext_l10n.h file here
4869 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4871 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
4874 * lib/ui/default.ui: fix a couple of typos.
4876 * config/gnome/gtk.m4: added (and added to the list of files in
4879 * src/insets/insetinclude.C (unique_id): fix when we are using
4880 lyxstring instead of basic_string<>.
4881 * src/insets/insettext.C (LocalDispatch): ditto.
4882 * src/support/filetools.C: ditto.
4884 * lib/configure.m4: create the ui/ directory if necessary.
4886 * src/LyXView.[Ch] (updateToolbar): new method.
4888 * src/BufferView_pimpl.C (buffer): update the toolbar when
4889 opening/closing buffer.
4891 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4893 * src/LyXAction.C (getActionName): enhance to return also the name
4894 and options of pseudo-actions.
4895 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
4897 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
4898 as an example of what is possible). Used in File->Build too (more
4899 useful) and in the import/export menus (to mimick the complicated
4900 handling of linuxdoc and friends). Try to update all the entries.
4902 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
4905 * src/MenuBackend.C (read): Parse the new OptItem tag.
4907 * src/MenuBackend.h: Add a new optional_ data member (used if the
4908 entry should be omitted when the lyxfunc is disabled).
4910 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
4911 function, used as a shortcut.
4912 (create_submenu): align correctly the shortcuts on the widest
4915 * src/MenuBackend.h: MenuItem.label() only returns the label of
4916 the menu without shortcut; new method shortcut().
4918 2000-07-14 Marko Vendelin <markov@ioc.ee>
4920 * src/frontends/gtk/Dialogs.C:
4921 * src/frontends/gtk/FormCopyright.C:
4922 * src/frontends/gtk/FormCopyright.h:
4923 * src/frontends/gtk/Makefile.am: added these source-files for the
4924 Gtk/Gnome support of the Copyright-Dialog.
4926 * src/main.C: added Gnome::Main initialization if using
4927 Gtk/Gnome frontend-GUI.
4929 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
4931 * config/gnome/aclocal-include.m4
4932 * config/gnome/compiler-flags.m4
4933 * config/gnome/curses.m4
4934 * config/gnome/gnome--.m4
4935 * config/gnome/gnome-bonobo-check.m4
4936 * config/gnome/gnome-common.m4
4937 * config/gnome/gnome-fileutils.m4
4938 * config/gnome/gnome-ghttp-check.m4
4939 * config/gnome/gnome-gnorba-check.m4
4940 * config/gnome/gnome-guile-checks.m4
4941 * config/gnome/gnome-libgtop-check.m4
4942 * config/gnome/gnome-objc-checks.m4
4943 * config/gnome/gnome-orbit-check.m4
4944 * config/gnome/gnome-print-check.m4
4945 * config/gnome/gnome-pthread-check.m4
4946 * config/gnome/gnome-support.m4
4947 * config/gnome/gnome-undelfs.m4
4948 * config/gnome/gnome-vfs.m4
4949 * config/gnome/gnome-x-checks.m4
4950 * config/gnome/gnome-xml-check.m4
4951 * config/gnome/gnome.m4
4952 * config/gnome/gperf-check.m4
4953 * config/gnome/gtk--.m4
4954 * config/gnome/linger.m4
4955 * config/gnome/need-declaration.m4: added configuration scripts
4956 for Gtk/Gnome frontend-GUI
4958 * configure.in: added support for the --with-frontend=gtk option
4960 * autogen.sh: added config/gnome/* to list of config-files
4962 * acconfig.h: added define for GTKGUI-support
4964 * config/lyxinclude.m4: added --with-frontend[=value] option value
4965 for Gtk/Gnome frontend-GUI support.
4967 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4969 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
4973 * src/paragraph.C (GetChar): remove non-const version
4975 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
4976 (search_kw): use it.
4978 * src/lyx_main.C (init): if "preferences" exist, read that instead
4980 (ReadRcFile): return bool if the file could be read ok.
4981 (ReadUIFile): add a check to see if lex file is set ok.
4983 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
4984 bastring can be used instead of lyxstring (still uses the old code
4985 if std::string is good enough or if lyxstring is used.)
4987 * src/encoding.C: make the arrays static, move ininle functions
4989 * src/encoding.h: from here.
4991 * src/buffer.C: have last_isnet_read as a file scope variable for now.
4992 (parseSingleLyXformat2Token): move inset parsing to separate method
4993 (readInset): new private method
4995 * src/Variables.h: remove virtual from get().
4997 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
4998 access to NEW_INSETS and NEW_TABULAR
5000 * src/MenuBackend.h: remove superfluous forward declaration of
5001 MenuItem. Add documentations tags "///", remove empty MenuItem
5002 destructor, remove private default contructor.
5004 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
5006 (read): more string mlabel and mname to where they are used
5007 (read): remove unused variables mlabel and mname
5008 (defaults): unconditional clear, make menusetup take advantage of
5009 add returning Menu &.
5011 * src/LyXView.h: define NEW_MENUBAR as default
5013 * src/LyXAction.C: include lyxparagraph.h temporary to get access
5014 to NEW_INSETS and NEW_TABULAR.
5015 (init): commetn out some funcs that is obsolete when NEW_INSETS is
5016 defined. Change some of the "xxxx-inset-insert" functions names to
5019 * several files: more enahncements to NEW_INSETS and the resulting
5022 * lib/lyxrc.example (\date_insert_format): move to misc section
5024 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
5025 bastring and use AC_CACHE_CHECK.
5026 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
5027 the system have the newest methods. uses AC_CACHE_CHECK
5028 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
5029 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
5030 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
5032 * configure.in: add LYX_CXX_GOOD_STD_STRING
5034 * acinclude.m4: recreated
5036 2000-07-24 Amir Karger <karger@lyx.org>
5038 * README: add Hebrew, Arabic kmaps
5041 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5043 * src/buffer.C (writeFileAscii): Define actcell as an int instead
5046 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5048 * Lot of files: add pragma interface/implementation.
5050 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
5052 * lib/ui/default.ui: new file (ans new directory). Contains the
5053 default menu and toolbar.
5055 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
5056 global space. Toolbars are now read (as menus) in ui files.
5058 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
5060 * src/lyxfunc.C (getStatus): do not exit immediately if a command
5061 is disabled because the document is read-only. We want to have the
5062 toggle state of the function anyway.
5063 (getStatus): add code for LFUN_VC* functions (mimicking what is
5064 done in old-style menus)
5066 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
5067 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
5069 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
5070 * src/BufferView_pimpl.C: ditto.
5071 * src/lyxfunc.C: ditto.
5073 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
5074 default). This replaces old-style menus by new ones.
5076 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
5077 MenuItem. Contain the data structure of a menu.
5079 * src/insets/insettext.C: use LyXView::setLayout instead of
5080 accessing directly the toolbar combox.
5081 * src/lyxfunc.C (Dispatch): ditto.
5083 * src/LyXView.C (setLayout): new method, which just calls
5084 Toolbar::setLayout().
5085 (updateLayoutChoice): move part of this method in Toolbar.
5087 * src/toolbar.[Ch]: removed.
5089 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
5090 implementation the toolbar.
5092 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
5093 the toolbar. It might make sense to merge it with ToolbarDefaults
5095 (setLayout): new function.
5096 (updateLayoutList): ditto.
5097 (openLayoutList): ditto.
5099 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
5100 xforms implementation of the toolbar.
5101 (get_toolbar_func): comment out, since I do not
5102 know what it is good for.
5104 * src/ToolbarDefaults.h: Add the ItemType enum.
5106 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
5107 for a list of allocated C strings. Used in Menubar xforms
5108 implementation to avoid memory leaks.
5110 * src/support/lstrings.[Ch] (uppercase): new version taking and
5114 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
5115 * lib/bind/emacs.bind: ditto.
5117 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5119 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
5120 forward decl of LyXView.
5122 * src/toolbar.C (toolbarItem): moved from toolbar.h
5123 (toolbarItem::clean): ditto
5124 (toolbarItem::~toolbarItem): ditto
5125 (toolbarItem::operator): ditto
5127 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
5129 * src/paragraph.h: control the NEW_TABULAR define from here
5131 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
5132 USE_TABULAR_INSETS to NEW_TABULAR
5134 * src/ToolbarDefaults.C: add include "lyxlex.h"
5136 * files using the old table/tabular: use NEW_TABULAR to control
5137 compilation of old tabular stuff.
5139 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
5142 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
5143 planemet in reading of old style floats, fix the \end_deeper
5144 problem when reading old style floats.
5146 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5148 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
5150 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
5152 * lib/bind/sciword.bind: updated.
5154 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5156 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
5157 layout write problem
5159 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5161 * src/Makefile.am (INCLUDES): remove image directory from include
5164 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
5165 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
5167 * src/LyXView.C (create_form_form_main): read the application icon
5170 * lib/images/*.xpm: change the icons to use transparent color for
5173 * src/toolbar.C (update): change the color of the button when it
5176 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5178 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
5179 setting explicitely the minibuffer.
5180 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
5182 * src/LyXView.C (showState): new function. Shows font information
5183 in minibuffer and update toolbar state.
5184 (LyXView): call Toolbar::update after creating the
5187 * src/toolbar.C: change toollist to be a vector instead of a
5189 (BubbleTimerCB): get help string directly from the callback
5190 argument of the corresponding icon (which is the action)
5191 (set): remove unnecessary ugliness.
5192 (update): new function. update the icons (depressed, disabled)
5193 depending of the status of the corresponding action.
5195 * src/toolbar.h: remove help in toolbarItem
5197 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
5199 * src/Painter.C (text): Added code for using symbol glyphs from
5200 iso10646 fonts. Currently diabled.
5202 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
5205 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
5206 magyar,turkish and usorbian.
5208 * src/paragraph.C (isMultiLingual): Made more efficient.
5210 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
5213 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
5214 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
5215 Also changed the prototype to "bool math_insert_greek(char)".
5217 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5219 * lots of files: apply the NEW_INSETS on all code that will not be
5220 needed when we move to use the new insets. Enable the define in
5221 lyxparagrah.h to try it.
5223 * src/insets/insettabular.C (cellstart): change to be a static
5225 (InsetTabular): initialize buffer in the initializer list.
5227 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
5229 * src/frontends/xforms/FormPrint.[Ch] : moved #include
5230 form_print.h out of the header file. Replaced with forward
5231 declarations of the relevant struct.
5233 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
5236 * src/commandtags.h: do not include "debug.h" which does not
5237 belong there. #include it in some other places because of this
5240 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5242 * src/insets/insetcaption.C: add a couple "using" directives.
5244 * src/toolbar.C (add): get the help text directly from lyxaction.
5246 (setPixmap): new function. Loads from disk and sets a pixmap on a
5247 botton; the name of the pixmap file is derived from the command
5250 * src/toolbar.h: remove members isBitmap and pixmap from
5253 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
5254 * lib/images/: move many files from images/banner.xpm.
5256 * src/lyx_gui.C (create_forms): read banner pixmap from file.
5258 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
5259 * src/toolbar.C: ditto.
5260 * configure.in: ditto.
5261 * INSTALL: document.
5263 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
5264 the spellchecker popup is closed from the WM.
5266 2000-07-19 Juergen Vigna <jug@sad.it>
5268 * src/insets/insetfloat.C (Write): small fix because we use the
5269 insetname for the type now!
5271 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
5273 * src/frontends/xforms/forms/form_citation.fd: object sizes are
5276 * src/frontends/Dialogs.h: removed hideCitation signal
5278 * src/insets/insetcite.h: added hide signal
5280 * src/insets/insetcite.C (~InsetCitation): emits new signal
5281 (getScreenLabel): "intelligent" label should now fit on the screen!
5283 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
5285 * src/frontends/xforms/FormCitation.C (showInset): connects
5286 hide() to the inset's hide signal
5287 (show): modified to use fl_set_object_position rather than
5288 fl_set_object_geometry wherever possible
5290 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
5292 * src/insets/lyxinset.h: add caption code
5294 * src/insets/insetfloat.C (type): new method
5296 * src/insets/insetcaption.C (Write): new method
5298 (LyxCode): new method
5300 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
5301 to get it right together with using the FloatList.
5303 * src/commandtags.h: add LFUN_INSET_CAPTION
5304 * src/lyxfunc.C (Dispatch): handle it
5306 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
5309 * src/Variables.[Ch]: make expand take a const reference, remove
5310 the destructor, some whitespace changes.
5312 * src/LyXAction.C (init): add caption-inset-insert
5314 * src/FloatList.C (FloatList): update the default floats a bit.
5316 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5318 * src/Variables.[Ch]: new files. Intended to be used for language
5319 specific strings (like \chaptername) and filename substitution in
5322 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
5324 * lib/kbd/american.kmap: update
5326 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
5328 * src/bufferparams.[Ch]: remove member allowAccents.
5330 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
5332 * src/LaTeXLog.C: use the log_form.h header.
5333 * src/lyx_gui.C: ditto.
5334 * src/lyx_gui_misc.C: ditto.
5335 * src/lyxvc.h: ditto.
5337 * forms/log_form.fd: new file, created from latexoptions.fd. I
5338 kept the log popup and nuked the options form.
5340 * src/{la,}texoptions.[Ch]: removed.
5341 * src/lyx_cb.C (LaTeXOptions): ditto
5343 * src/lyx_gui.C (create_forms): do not handle the
5344 fd_latex_options form.
5346 2000-07-18 Juergen Vigna <jug@sad.it>
5348 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
5349 name of the inset so that it can be requested outside (text2.C).
5351 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
5354 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5356 * src/mathed/formula.h (ConvertFont): constify
5358 * src/mathed/formula.C (Read): add warning if \end_inset is not
5359 found on expected place.
5361 * src/insets/lyxinset.h (ConvertFont): consify
5363 * src/insets/insetquotes.C (ConvertFont): constify
5364 * src/insets/insetquotes.h: ditto
5366 * src/insets/insetinfo.h: add labelfont
5368 * src/insets/insetinfo.C (InsetInfo): set the labelfont
5369 (ascent): use labelfont
5373 (Write): make .lyx file a bit nicer
5375 * src/insets/insetfloat.C (Write): simplify somewhat...
5376 (Read): add warning if arg is not found
5378 * src/insets/insetcollapsable.C: add using std::max
5379 (Read): move string token and add warning in arg is not found
5380 (draw): use std::max to get the right ty
5381 (getMaxWidth): simplify by using std::max
5383 * src/insets/insetsection.h: new file
5384 * src/insets/insetsection.C: new file
5385 * src/insets/insetcaption.h: new file
5386 * src/insets/insetcaption.C: new file
5388 * src/insets/inset.C (ConvertFont): constify signature
5390 * src/insets/Makefile.am (libinsets_la_SOURCES): add
5391 insetcaption.[Ch] and insetsection.[Ch]
5393 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
5394 uses to use LABEL_COUNTER_CHAPTER instead.
5395 * src/text2.C (SetCounter): here
5397 * src/counters.h: new file
5398 * src/counters.C: new file
5399 * src/Sectioning.h: new file
5400 * src/Sectioning.C: new file
5402 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
5404 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5406 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
5409 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
5412 2000-07-17 Juergen Vigna <jug@sad.it>
5414 * src/tabular.C (Validate): check if array-package is needed.
5415 (SetVAlignment): added support for vertical alignment.
5416 (SetLTFoot): better support for longtable header/footers
5417 (Latex): modified to support added features.
5419 * src/LaTeXFeatures.[Ch]: added array-package.
5421 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
5423 * src/lyx_gui.C (LyXGUI): make sure that the height is large
5426 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
5428 * configure.in: do not forget to put a space after -isystem.
5430 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
5432 * lib/kbd/arabic.kmap: a few fixes.
5434 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
5436 * some whitespace chagnes to a number of files.
5438 * src/support/DebugStream.h: change to make it easier for
5439 doc++ to parse correctly.
5440 * src/support/lyxstring.h: ditto
5442 * src/mathed/math_utils.C (compara): change to have only one
5444 (MathedLookupBOP): change because of the above.
5446 * src/mathed/math_delim.C (math_deco_compare): change to have only
5448 (search_deco): change becasue of the above.
5450 * src/insets/insettabular.C (DrawCellSelection): use std::swap
5451 instead of manually coded one.
5453 * src/insets/insetquotes.C (Read): read the \end_inset too
5455 * src/insets/insetlatex.h: remove file
5456 * src/insets/insetlatex.C: remove file
5458 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
5460 (InsetPrintIndex): remove destructor
5462 * src/insets/insetinclude.h: remove default constructor
5464 * src/insets/insetfloat.C: work to make it work better
5466 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
5468 * src/insets/insetcite.h (InsetCitation): remove default constructor
5470 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
5472 * src/text.C (GetColumnNearX): comment out some currently unused code.
5474 * src/paragraph.C (writeFile): move some initializations closer to
5476 (CutIntoMinibuffer): small change to use new matchIT operator
5480 (InsertInset): ditto
5483 (InsetIterator): ditto
5484 (Erase): small change to use new matchFT operator
5486 (GetFontSettings): ditto
5487 (HighestFontInRange): ditto
5490 * src/lyxparagraph.h: some chars changed to value_type
5491 (matchIT): because of some stronger checking (perhaps too strong)
5492 in SGI STL, the two operator() unified to one.
5495 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
5497 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
5498 the last inset read added
5499 (parseSingleLyXformat2Token): some more (future) compability code added
5500 (parseSingleLyXformat2Token): warning about solitary \end_inset added
5501 (parseSingleLyXformat2Token): set last_inset_read
5502 (parseSingleLyXformat2Token): more code to read new "Float" correctly
5503 (parseSingleLyXformat2Token): don't double intializw string next_token
5505 * src/TextCache.C (text_fits::operator()): add const's to the signature
5506 (has_buffer::operator()): ditto
5508 * src/Floating.h: add some comments on the class
5510 * src/FloatList.[Ch] (typeExist): new method
5513 * src/BackStack.h: added default constructor, wanted by Gcc.
5515 2000-07-14 Juergen Vigna <jug@sad.it>
5517 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
5519 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
5521 * src/insets/insettabular.C (resizeLyXText): need this to be able to
5522 do a redraw when the window is resized!
5523 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
5525 * src/insets/insettext.C (resizeLyXText): added function to correctly
5526 being able to resize the LyXWindow.
5528 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
5530 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
5532 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
5533 crashes when closing dialog to a deleted inset.
5535 * src/insets/insetcite.[Ch] (Edit) : the return of this former
5536 method! Now similar to other insets.
5538 2000-07-13 Juergen Vigna <jug@sad.it>
5540 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
5542 * lib/examples/Literate.lyx: small patch!
5544 * src/insets/insetbib.C (Read): added this function because of wrong
5545 Write (without [begin|end]_inset).
5547 2000-07-11 Juergen Vigna <jug@sad.it>
5549 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
5550 as the insertInset could not be good!
5552 * src/screen.C (ToggleSelection): fixed toggle selection bug as
5553 the bool param should not be last.
5555 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5557 * sigc++/configure.in: fix bug in threading-related code (Yes, I
5558 did submit that to Karl).
5560 * configure.in: use -isystem instead of -I for X headers. This
5561 fixes a problem on solaris with a recent gcc;
5562 put the front-end code after the X detection code;
5563 configure in sigc++ before lib/
5565 * src/lyx_main.C (commandLineHelp): remove -display from command
5568 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
5570 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
5571 Also put in Makefile rules for building the ``listerrors''
5572 program for parsing errors from literate programs written in LyX.
5574 * lib/build-listerrors: Added small shell script as part of compile
5575 process. This builds a working ``listerrors'' binary if noweb is
5576 installed and either 1) the VNC X server is installed on the machine,
5577 or 2) the user is compiling from within a GUI. The existence of a GUI
5578 is necessary to use the ``lyx --export'' feature for now. This
5579 hack can be removed once ``lyx --export'' no longer requires a GUI to
5582 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
5584 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
5585 now passed back correctly from gcc and placed "under" error
5586 buttons in a Literate LyX source.
5588 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
5590 * src/text.C (GetColumnNearX): Better behavior when a RTL
5591 paragraph is ended by LTR text.
5593 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
5596 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
5598 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
5599 true when clipboard is empty.
5601 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
5603 * text.C (Backspace): Prevent rebreaking of a row if it is the last
5604 row of the paragraph.
5605 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
5606 to prevent calculation of bidi tables
5608 2000-07-07 Juergen Vigna <jug@sad.it>
5610 * src/screen.C (ToggleSelection): added y_offset and x_offset
5613 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
5616 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
5618 * src/insets/insettext.C: fixed Layout-Display!
5620 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5622 * configure.in: add check for strings.h header.
5624 * src/spellchecker.C: include <strings.h> in order to have a
5625 definition for bzero().
5627 2000-07-07 Juergen Vigna <jug@sad.it>
5629 * src/insets/insettext.C (draw): set the status of the bv->text to
5630 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
5632 * src/screen.C (DrawOneRow):
5633 (DrawFromTo): redraw the actual row if something has changed in it
5636 * src/text.C (draw): call an update of the toplevel-inset if something
5637 has changed inside while drawing.
5639 * src/lyxtext.h: added CHANGED_IN_DRAW status.
5641 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
5643 * src/insets/insetbib.[Ch] (callback) new method, moving callback
5644 processing inside class.
5646 * src/insets/insetindex.[Ch] (callback) new method, moving callback
5647 processing inside class.
5649 * src/insets/insetindex.h new struct Holder, consistent with other
5652 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
5653 citation dialog from main code and placed it in src/frontends/xforms.
5654 Dialog launched through signals instead of callbacks
5656 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
5658 * lyx.man: update the options description.
5660 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
5662 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
5663 handle neg values, set min width to 590, add doc about -display
5665 2000-07-05 Juergen Vigna <jug@sad.it>
5667 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
5668 calls to BufferView *.
5670 * src/insets/insettext.C (checkAndActivateInset): small fix non
5671 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
5673 * src/insets/insetcommand.C (Read): Fixed as insets should read till
5674 their \end_inset token!
5676 2000-07-04 edscott <edscott@imp.mx>
5678 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
5679 lib/lyxrc.example: added option \wheel_jump
5681 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
5683 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
5684 remove support for -width,-height,-xpos and -ypos.
5686 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
5688 * src/encoding.[Ch]: New files.
5690 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
5691 (text): Call to the underline() method only when needed.
5693 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
5695 * src/buffer.C (makeLaTeXFile): Compute automatically the input
5696 encoding(s) for the document.
5698 * src/bufferparams.C (BufferParams): Changed default value of
5701 * src/language.C (newLang): Removed.
5702 (items[]): Added encoding information for all defined languages.
5704 * src/lyx_gui.C (create_forms): Added "auto" option to the input
5705 encoding choice button.
5707 * src/lyxrc.h (font_norm_type): New member variable.
5708 (set_font_norm_type): New method.
5710 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
5711 paragraphs with different encodings.
5713 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
5714 (TransformChar): Changed to work correctly with Arabic points.
5715 (draw): Added support for drawing Arabic points.
5716 (draw): Removed code for drawing underbars (this is done by
5719 * src/support/textutils.h (IsPrintableNonspace): New function.
5721 * src/BufferView_pimpl.h: Added "using SigC::Object".
5722 * src/LyXView.h: ditto.
5724 * src/insets/insetinclude.h (include_label): Changed to mutable.
5726 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5728 * src/mathed/math_iter.h: remove empty destructor
5730 * src/mathed/math_cursor.h: remove empty destructor
5732 * src/insets/lyxinset.h: add THEOREM_CODE
5734 * src/insets/insettheorem.[Ch]: new files
5736 * src/insets/insetminipage.C: (InsertInset): remove
5738 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
5740 (InsertInset): remove
5742 * src/insets/insetlist.C: (InsertList): remove
5744 * src/insets/insetfootlike.[Ch]: new files
5746 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
5749 (InsertInset): ditto
5751 * src/insets/insetert.C: remove include Painter.h, reindent
5752 (InsertInset): move to header
5754 * src/insets/insetcollapsable.h: remove explicit from default
5755 contructor, remove empty destructor, add InsertInset
5757 * src/insets/insetcollapsable.C (InsertInset): new func
5759 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
5761 * src/vspace.h: add explicit to constructor
5763 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
5764 \textcompwordmark, please test this.
5766 * src/lyxrc.C: set ascii_linelen to 65 by default
5768 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
5770 * src/commandtags.h: add LFUN_INSET_THEOREM
5772 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
5773 (makeLinuxDocFile): remove _some_ of the nice logic
5774 (makeDocBookFile): ditto
5776 * src/Painter.[Ch]: (~Painter): removed
5778 * src/LyXAction.C (init): entry for insettheorem added
5780 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
5782 (deplog): code to detect files generated by LaTeX, needs testing
5785 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5787 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
5789 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5791 * src/LaTeX.C (deplog): Add a check for files that are going to be
5792 created by the first latex run, part of the project to remove the
5795 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
5796 contents to the extension list.
5798 2000-07-04 Juergen Vigna <jug@sad.it>
5800 * src/text.C (NextBreakPoint): added support for needFullRow()
5802 * src/insets/lyxinset.h: added needFullRow()
5804 * src/insets/insetcollapsable.C: redone now this uses a text-inset
5807 * src/insets/insettext.C: lots of changes for update!
5809 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
5811 * src/LaTeXFeatures.h: add a missing std:: qualifier.
5813 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
5815 * src/insets/insetinclude.C (InsetInclude): fixed
5816 initialization of include_label.
5817 (unique_id): now returns a string.
5819 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
5821 * src/LaTeXFeatures.h: new member IncludedFiles, for
5822 a map of key, included file name.
5824 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
5825 with the included files for inclusion in SGML preamble,
5826 i. e., linuxdoc and docbook.
5829 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
5830 nice (is the generated linuxdoc code to be exported?), that
5831 allows to remove column, and only_body that will be true for
5832 slave documents. Insets are allowed inside SGML font type.
5833 New handling of the SGML preamble for included files.
5834 (makeDocBookFile): the same for docbook.
5836 * src/insets/insetinclude.h:
5837 * src/insets/insetinclude.C (Validate): keeps a list of included files.
5839 (DocBook): new export methods.
5841 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
5842 and makeDocBookFile.
5844 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
5845 formats to export with command line argument -x.
5847 2000-06-29 Juergen Vigna <jug@sad.it>
5849 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
5850 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
5852 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
5853 region could already been cleared by an inset!
5855 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
5857 * src/BufferView_pimpl.h: remove member variables lyx_focus and
5860 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
5862 (cursorToggle): remove special handling of lyx focus.
5864 2000-06-28 Juergen Vigna <jug@sad.it>
5866 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
5869 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5871 * src/insets/insetindex.C (Edit): add a callback when popup is
5874 * src/insets/insettext.C (LocalDispatch):
5875 * src/insets/insetmarginal.h:
5876 * src/insets/insetlist.h:
5877 * src/insets/insetfoot.h:
5878 * src/insets/insetfloat.h:
5879 * src/insets/insetert.h: add a missing std:: qualifier.
5881 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
5883 * src/support/lyxsum.C (sum): '\0' teminate file read when using
5886 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
5888 * src/insets/insettext.C (Read): remove tmptok unused variable
5889 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
5890 (InsertInset): change for new InsetInset code
5892 * src/insets/insettext.h: add TEXT inline method
5894 * src/insets/insettext.C: remove TEXT macro
5896 * src/insets/insetmarginal.C (Write): new method
5897 (Latex): change output slightly
5899 * src/insets/insetfoot.C (Write): new method
5900 (Latex): change output slightly (don't use endl when no need)
5902 * src/insets/insetert.C (Write): new method
5904 * src/insets/insetcollapsable.h: make button_length, button_top_y
5905 and button_bottm_y protected.
5907 * src/insets/insetcollapsable.C (Write): simplify code by using
5908 tostr. Also do not output the float name, the children class
5909 should to that to get control over own arguments
5911 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
5912 src/insets/insetminipage.[Ch]:
5915 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
5917 * src/lyxfunc.C (Dispatch): cases for new insets/commands
5919 * src/Makefile.am (lyx_SOURCES): add the new files
5921 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
5922 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
5923 * src/commandtags.h: ditto
5925 * src/LaTeXFeatures.h: add a std::set of used floattypes
5927 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
5929 * src/FloatList.[Ch] src/Floating.h: new files
5931 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
5933 * src/lyx_cb.C (TableApplyCB): ditto
5935 * src/text2.C: ditto
5936 * src/buffer.C (SimpleLinuxDocOnePar): ditto
5937 (parseSingleLyXformat2Token): ditto + add code for
5938 backwards compability for old float styles + add code for new insets
5940 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
5942 (InsertInset(size_type, Inset *, LyXFont)): new method
5943 (InsetChar(size_type, char)): changed to use the other InsetChar
5944 with a LyXFont(ALL_INHERIT).
5945 (InsetInset(size_type, Inset*)): changed to use InsetChar to
5946 insert the META_INSET.
5948 * sigc++/thread.cc (Privete<int>::operator int&): move definition
5950 * sigc++/thread.h (Threads): from here
5952 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
5953 definition out of line
5954 * sigc++/scope.h: from here
5956 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5958 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
5959 is specified (adapted from a patch from edscott <edscott@imp.mx>).
5961 * Makefile.am (bindist): new target.
5963 * INSTALL: add instructions for doing a binary distribution.
5965 * development/tools/README.bin.example: update a bit.
5967 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
5970 * lib/lyxrc.example: new lyxrc tag \set_color.
5972 * src/lyxfunc.C (Dispatch):
5973 * src/commandtags.h:
5974 * src/LyXAction.C: new lyxfunc "set-color".
5976 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
5977 and an x11name given as strings.
5979 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
5980 cache when a color is changed.
5982 2000-06-26 Juergen Vigna <jug@sad.it>
5984 * src/lyxrow.C (width): added this functions and variable.
5986 * src/insets/insetcite.C (create_form_citation_form): some Gravity
5989 * src/text.C (SetHeightOfRow): fixed calcualting of width.
5991 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5993 * images/undo_bw.xpm: new icon.
5994 * images/redo_bw.xpm: ditto.
5996 * configure.in (INSTALL_SCRIPT): change value to
5997 ${INSTALL} to avoid failures of install-script target.
5998 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
6000 * src/BufferView.h: add a magic "friend" declaration to please
6003 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
6005 * forms/cite.fd: modified to allow resizing without messing
6008 * src/insetcite.C: Uses code from cite.fd almost without
6010 User can now resize dialog in the x-direction.
6011 Resizing the dialog in the y-direction is prevented, as the
6012 code does this intelligently already.
6014 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6016 * INSTALL: remove obsolete entry in "problems" section.
6018 * lib/examples/sl_*.lyx: update of the slovenian examples.
6020 * src/support/FileInfo.[Ch] (getBlockSize): remove.
6022 2000-06-23 Juergen Vigna <jug@sad.it>
6024 * src/lyxtext.h: added a 'cleared' flag to draw() function.
6026 * src/buffer.C (resize): delete the LyXText of textinsets.
6028 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
6030 * src/insets/lyxinset.h: added another parameter 'cleared' to
6031 the draw() function.
6033 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
6034 unlocking inset in inset.
6036 2000-06-22 Juergen Vigna <jug@sad.it>
6038 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
6039 of insets and moved first to LyXText.
6041 * src/mathed/formulamacro.[Ch]:
6042 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
6044 2000-06-21 Juergen Vigna <jug@sad.it>
6046 * src/text.C (GetVisibleRow): look if I should clear the area or not
6047 using Inset::doClearArea() function.
6049 * src/insets/lyxinset.h: added doClearArea() function and
6050 modified draw(Painter &, ...) to draw(BufferView *, ...)
6052 * src/text2.C (UpdateInset): return bool insted of int
6054 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
6056 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
6057 combox in the character popup
6059 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
6060 BufferParams const & params
6062 2000-06-20 Juergen Vigna <jug@sad.it>
6064 * src/insets/insettext.C (SetParagraphData): set insetowner on
6067 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6069 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
6070 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
6072 (form_main_): remove
6074 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
6075 (create_form_form_main): remove FD_form_main stuff, connect to
6076 autosave_timeout signal
6078 * src/LyXView.[Ch] (getMainForm): remove
6079 (UpdateTimerCB): remove
6080 * src/BufferView_pimpl.h: inherit from SigC::Object
6082 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
6083 signal instead of callback
6085 * src/BufferView.[Ch] (cursorToggleCB): remove
6087 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6089 * src/BufferView_pimpl.C: changes because of the one below
6091 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
6092 instead of storing a pointer to a LyXText.
6094 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
6096 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
6098 * src/lyxparagraph.h
6100 * src/paragraph.C: Changed fontlist to a sorted vector.
6102 2000-06-19 Juergen Vigna <jug@sad.it>
6104 * src/BufferView.h: added screen() function.
6106 * src/insets/insettext.C (LocalDispatch): some selection code
6109 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
6111 * src/insets/insettext.C (SetParagraphData):
6113 (InsetText): fixes for multiple paragraphs.
6115 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
6117 * development/lyx.spec.in: Call configure with ``--without-warnings''
6118 to work around a bug with the Makefiles when doing ``make lyxrpm''.
6119 This should be fine, however, since we generally don't want to be
6120 verbose when making an RPM.
6122 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
6124 * lib/scripts/fig2pstex.py: New file
6126 2000-06-16 Juergen Vigna <jug@sad.it>
6128 * src/insets/insettabular.C (UpdateLocal):
6129 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
6130 (LocalDispatch): Changed all functions to use LyXText.
6132 2000-06-15 Juergen Vigna <jug@sad.it>
6134 * src/text.C (SetHeightOfRow): call inset::update before requesting
6137 * src/insets/insettext.C (update):
6138 * src/insets/insettabular.C (update): added implementation
6140 * src/insets/lyxinset.h: added update function
6142 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6144 * src/text.C (SelectNextWord): protect against null pointers with
6145 old-style string streams. (fix from Paul Theo Gonciari
6148 * src/cite.[Ch]: remove erroneous files.
6150 * lib/configure.m4: update the list of created directories.
6152 * src/lyxrow.C: include <config.h>
6153 * src/lyxcursor.C: ditto.
6155 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6157 * lib/examples/decimal.lyx: new example file from Mike.
6159 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
6160 to find template definitions (from Dekel)
6162 * src/frontends/.cvsignore: add a few things.
6164 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
6166 * src/Timeout.C (TimeOut): remove default argument.
6168 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
6171 * src/insets/ExternalTemplate.C: add a "using" directive.
6173 * src/lyx_main.h: remove the act_ struct, which seems unused
6176 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6178 * LyX Developers Meeting: All files changed, due to random C++ (by
6179 coincidence) code generator script.
6181 - external inset (cool!)
6182 - initial online editing of preferences
6183 - insettabular breaks insettext(s contents)
6185 - some DocBook fixes
6186 - example files update
6187 - other cool stuff, create a diff and look for yourself.
6189 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
6191 * src/insets/insettext.C (computeTextRows): if the maxWidth is
6192 -1 this is a non-line-breaking textinset.
6194 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
6195 if there is no width set.
6197 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6199 * Lots of files: Merged the dialogbase branch.
6201 2000-06-09 Allan Rae <rae@lyx.org>
6203 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
6204 and the Dispatch methods that used it.
6206 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
6207 access to functions formerly kept in Dispatch.
6209 2000-05-19 Allan Rae <rae@lyx.org>
6211 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
6212 made to_page and count_copies integers again. from_page remains a
6213 string however because I want to allow entry of a print range like
6214 "1,4,22-25" using this field.
6216 * src/LyXAction.C: added action info and commands for buffer-print-xtl
6217 and printer-params-get. These aren't useful from the minibuffer but
6218 could be used by a script/LyXServer app provided it passes a suitable
6219 auto_mem_buffer. I guess I should take a look at how the LyXServer
6220 works and make it support xtl buffers.
6222 * sigc++/: updated to libsigc++-1.0.1
6224 * src/xtl/: updated to xtl-1.3.pl.11
6226 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
6227 those changes done to the files in src/ are actually recreated when
6228 they get regenerated. Please don't ever accept a patch that changes a
6229 dialog unless that patch includes the changes to the corresponding *.fd
6232 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
6233 stringOnlyContains, renamed it and generalised it.
6235 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
6236 branch. Removed the remaining old form_print code.
6238 2000-04-26 Allan Rae <rae@lyx.org>
6240 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
6241 trap I was trying to fix with the ID: fields in src/xtl/ :-)
6243 2000-04-25 Allan Rae <rae@lyx.org>
6245 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
6246 against a base of xtl-1.3.pl.4
6248 * development/tools/lxtl.sh: fixed a couple of silly typos and now
6249 filter the Id: entries so they still show the xtl version number
6252 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
6253 into the src/xtl code. Patch still pending with José (XTL)
6255 2000-04-24 Allan Rae <rae@lyx.org>
6257 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
6258 both more generic and much safer. Use the new template functions.
6259 * src/buffer.[Ch] (Dispatch): ditto.
6261 * src/frontends/xforms/FormPrint.C (update): Use new template functions
6262 and mem buffer more intelligently. Also a little general cleanup.
6265 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
6266 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
6267 * src/xtl/Makefile.am: ditto.
6268 * src/xtl/.cvsignore: ditto.
6269 * src/Makefile.am: ditto.
6271 * src/PrinterParams.h: Removed the macros member functions. Added a
6272 testInvariant member function. A bit of tidying up and commenting.
6273 Included Angus's idea for fixing operation with egcs-1.1.2.
6275 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
6276 cool expansion of XTL's mem_buffer to support automatic memory
6277 management within the buffer itself. Removed the various macros and
6278 replaced them with template functions that use either auto_mem_buffer
6279 or mem_buffer depending on a #define. The mem_buffer support will
6280 disappear as soon as the auto_mem_buffer is confirmed to be good on
6281 other platforms/compilers. That is, it's there so you've got something
6284 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
6285 effectively forked XTL. However I expect José will include my code
6286 into the next major release. Also fixed a memory leak.
6287 * src/xtl/text.h: ditto.
6288 * src/xtl/xdr.h: ditto.
6289 * src/xtl/giop.h: ditto.
6291 2000-04-16 Allan Rae <rae@lyx.org>
6293 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
6294 by autogen.sh and removed by maintainer-clean anyway.
6295 * .cvsignore, sigc++/.cvsignore: Support the above.
6297 * sigc++/.cvsignore: Forgot that retbind.h was generated.
6299 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
6301 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
6302 macros, renamed static callback-target member functions to suit new
6303 scheme and made them public.
6304 * src/frontends/xforms/forms/form_print.fd: ditto.
6305 * src/frontends/xforms/forms/form_copyright.fd: ditto.
6307 * src/support/lxtl.h: small cleanup to use typedef instead of #define
6310 * src/xtl/: New directory containing a minimal distribution of XTL.
6311 This is XTL-1.3.pl.4.
6313 * development/tools/lxtl.sh: A script to generate the above mini-dist.
6315 2000-04-15 Allan Rae <rae@lyx.org>
6317 * development/tools/makeLyXsigc.sh: Remove the library version numbers
6319 * sigc++/: Updated to libsigc++-1.0.0
6321 2000-04-14 Allan Rae <rae@lyx.org>
6323 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
6324 use the generic ones in future. I'll modify my conversion script.
6326 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
6328 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
6329 (CloseAllBufferRelatedDialogs): Renamed.
6330 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
6332 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
6333 of the generic ones. These are the same ones my conversion script
6336 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
6337 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
6338 * src/buffer.C (Dispatch): ditto
6340 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
6341 functions for updating and hiding buffer dependent dialogs.
6342 * src/BufferView.C (buffer): ditto
6343 * src/buffer.C (setReadonly): ditto
6344 * src/lyxfunc.C (CloseBuffer): ditto
6346 * src/buffer.h: Take setReadonly() out of line so I don't have to include
6347 Dialogs.h, and hence all the SigC stuff, into every file that includes
6348 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
6350 * src/BufferView2.C: reduce the number of headers included by buffer.h
6352 2000-04-11 Allan Rae <rae@lyx.org>
6354 * src/frontends/xforms/xform_macros.h: A small collection of macros
6355 for building C callbacks.
6357 * src/frontends/xforms/Makefile.am: Added above file.
6359 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
6360 scheme again. This time it should work for JMarc. If this is
6361 successful I'll revise my conversion script to automate some of this.
6362 The static member functions in the class also have to be public for
6363 this scheme will work. If the scheme works (it's almost identical to
6364 the way BufferView::cursorToggleCB is handled so it should work) then
6365 FormCopyright and FormPrint will be ready for inclusion into the main
6366 trunk immediately after 1.1.5 is released -- provided we're prepared
6367 for complaints about lame compilers not handling XTL.
6369 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
6371 2000-04-07 Allan Rae <rae@lyx.org>
6373 * config/lyxinclude.m4: A bit more tidying up (Angus)
6375 * src/LString.h: JMarc's <string> header fix
6377 * src/PrinterParams.h: Used string for most data to remove some
6378 ugly code in the Print dialog and avoid even uglier code when
6379 appending the ints to a string for output.
6381 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
6382 and moved "default:" back to the end of switch statement. Cleaned
6383 up the printing so it uses the right function calls and so the
6384 "print to file" option actually puts the file in the right directory.
6386 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
6388 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
6389 and Ok+Apply button control into a separate method: input (Angus).
6390 (input) Cleaned it up and improved it to be very thorough now.
6391 (All CB) static_cast used instead of C style cast (Angus). This will
6392 probably change again once we've worked out how to keep gcc-2.8.1 happy
6393 with real C callbacks.
6394 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
6395 ignore some of the bool settings and has random numbers instead. Needs
6396 some more investigation. Added other input length checks and checking
6397 of file and printer names.
6399 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
6400 would link (Angus). Seems the old code doesn't compile with the pragma
6401 statement either. Separated callback entries from internal methods.
6403 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
6405 2000-03-17 Allan Rae <rae@lyx.org>
6407 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
6408 need it? Maybe it could go in Dialogs instead? I could make it a
6409 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
6410 values to get the bool return value.
6411 (Dispatch): New overloaded method for xtl support.
6413 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
6414 extern "C" callback instead of static member functions. Hopefully,
6415 JMarc will be able to compile this. I haven't changed
6416 forms/form_copyright.fd yet. Breaking one of my own rules already.
6418 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
6419 because they aren't useful from the minibuffer. Maybe a LyXServer
6420 might want a help message though?
6422 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
6424 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
6425 xtl which needs both rtti and exceptions.
6427 * src/support/Makefile.am:
6428 * src/support/lxtl.h: New file. Some helper macros for using XTL.
6430 * src/frontends/xforms/input_validators.[ch]: input filters and
6431 validators. These conrol what keys are valid in input boxes.
6432 Use them and write some more. Much better idea than waiting till
6433 after the user has pressed Ok to say that the input fields don't make
6436 * src/frontends/xforms/Makefile.am:
6437 * src/frontends/xforms/forms/form_print.fd:
6438 * src/frontends/xforms/forms/makefile:
6439 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
6440 new scheme. Still have to make sure I haven't missed anything from
6441 the current implementation.
6443 * src/Makefile.am, src/PrinterParams.h: New data store.
6445 * other files: Added a couple of copyright notices.
6447 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6449 * src/insets/insetbib.h: move Holder struct in public space.
6451 * src/frontends/include/DialogBase.h: use SigC:: only when
6452 SIGC_CXX_NAMESPACES is defined.
6453 * src/frontends/include/Dialogs.h: ditto.
6455 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
6457 * src/frontends/xforms/FormCopyright.[Ch]: do not
6458 mention SigC:: explicitely.
6460 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6462 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
6463 deals with testing KDE in main configure.in
6464 * configure.in: ditto.
6466 2000-02-22 Allan Rae <rae@lyx.org>
6468 * Lots of files: Merged from HEAD
6470 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
6471 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
6473 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
6475 * sigc++/: new minidist.
6477 2000-02-14 Allan Rae <rae@lyx.org>
6479 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
6481 2000-02-08 Juergen Vigna <jug@sad.it>
6483 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
6484 file for the buildin GUI builder of KDevelop of the copyright-dialog.
6486 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
6487 for this port and so it is much easier for other people to port
6488 dialogs in a common development environment.
6490 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
6491 the QT/KDE implementation.
6493 * src/frontends/kde/Dialogs.C:
6494 * src/frontends/kde/FormCopyright.C:
6495 * src/frontends/kde/FormCopyright.h:
6496 * src/frontends/kde/Makefile.am:
6497 * src/frontends/kde/formcopyrightdialog.C:
6498 * src/frontends/kde/formcopyrightdialog.h:
6499 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
6500 for the kde support of the Copyright-Dialog.
6502 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
6503 subdir-substitution instead of hardcoded 'xforms' as we now have also
6506 * src/frontends/include/DialogBase.h (Object): just commented the
6507 label after #endif (nasty warning and I don't like warnings ;)
6509 * src/main.C (main): added KApplication initialization if using
6512 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
6513 For now only the KDE event-loop is added if frontend==kde.
6515 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
6517 * configure.in: added support for the --with-frontend[=value] option
6519 * autogen.sh: added kde.m4 file to list of config-files
6521 * acconfig.h: added define for KDEGUI-support
6523 * config/kde.m4: added configuration functions for KDE-port
6525 * config/lyxinclude.m4: added --with-frontend[=value] option with
6526 support for xforms and KDE.
6528 2000-02-08 Allan Rae <rae@lyx.org>
6530 * all Makefile.am: Fixed up so the make targets dist, distclean,
6531 install and uninstall all work even if builddir != srcdir. Still
6532 have a new sigc++ minidist update to come.
6534 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
6536 2000-02-01 Allan Rae <rae@lyx.org>
6538 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
6539 Many mods to get builddir != srcdir working.
6541 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
6542 for building on NT and so we can do the builddir != srcdir stuff.
6544 2000-01-30 Allan Rae <rae@lyx.org>
6546 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
6547 This will stay in "rae" branch. We probably don't really need it in
6548 the main trunk as anyone who wants to help programming it should get
6549 a full library installed also. So they can check both included and
6550 system supplied library compilation.
6552 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
6553 Added a 'mini' distribution of libsigc++. If you feel the urge to
6554 change something in these directories - Resist it. If you can't
6555 resist the urge then you should modify the following script and rebuild
6556 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
6557 all happen. Still uses a hacked version of libsigc++'s configure.in.
6558 I'm quite happy with the results. I'm not sure the extra work to turn
6559 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
6560 worth the trouble and would probably lead to extra maintenance
6562 I haven't tested the following important make targets: install, dist.
6563 Not ready for prime time but very close. Maybe 1.1.5.
6565 * development/tools/makeLyXsigc.sh: A shell script to automatically
6566 generate our mini-dist of libsigc++. It can only be used with a CVS
6567 checkout of libsigc++ not a tarball distribution. It's well commented.
6568 This will end up as part of the libsigc++ distribution so other apps
6569 can easily have an included mini-dist. If someone makes mods to the
6570 sigc++ subpackage without modifying this script to generate those
6571 changes I'll be very upset!
6573 * src/frontends/: Started the gui/system indep structure.
6575 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
6576 to access the gui-indep dialogs are in this class. Much improved
6577 design compared to previous revision. Lars, please refrain from
6578 moving this header into src/ like you did with Popups.h last time.
6580 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
6582 * src/frontends/xforms/: Started the gui-indep system with a single
6583 dialog: FormCopyright. Initial testing of use of libsigc++ was very
6586 * src/frontends/xforms/forms: Repository for the xforms .fd files.
6587 Here you'll find a very useful makefile and automated fdfix.sh that
6588 makes updating dailogs a no-brainer -- provided you follow the rules
6589 set out in the README. I'm thinking about adding another script to
6590 automatically generate skeleton code for a new dialog given just the
6593 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
6594 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
6595 Made FormCopyright gui-indep and added a lyxfunc to get to it.
6597 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6599 * src/support/LSubstring.C (operator): simplify
6601 * src/lyxtext.h: removed bparams, use buffer_->params instead
6603 * src/lyxrow.h: make Row a real class, move all variables to
6604 private and use accessors.
6606 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
6608 (isRightToLeftPar): ditto
6609 (ChangeLanguage): ditto
6610 (isMultiLingual): ditto
6613 (SimpleTeXOnePar): ditto
6614 (TeXEnvironment): ditto
6615 (GetEndLabel): ditto
6617 (SetOnlyLayout): ditto
6618 (BreakParagraph): ditto
6619 (BreakParagraphConservative): ditto
6620 (GetFontSettings): ditto
6622 (CopyIntoMinibuffer): ditto
6623 (CutIntoMinibuffer): ditto
6624 (PasteParagraph): ditto
6625 (SetPExtraType): ditto
6626 (UnsetPExtraType): ditto
6627 (DocBookContTableRows): ditto
6628 (SimpleDocBookOneTablePar): ditto
6630 (TeXFootnote): ditto
6631 (SimpleTeXOneTablePar): ditto
6632 (TeXContTableRows): ditto
6633 (SimpleTeXSpecialChars): ditto
6636 * src/lyxcursor.h: make LyXCursor a real class, move all variables
6637 to private and use accessors.
6639 * src/lyx_cb.C: remove char updatetimer, and all code that uses
6640 this, we did not use it anymore and has not been for ages. Just a
6641 waste of cpu cycles.
6643 * src/language.h: make Language a real class, move all variables
6644 to private and use accessors.
6646 * src/BufferView_pimpl.C (Pimpl): use new timer code.
6647 (create_view): remove
6648 (update): some changes for new timer
6649 (cursorToggle): use new timer
6650 (beforeChange): change for new timer
6652 * src/BufferView.h (cursorToggleCB): removed last paramter because
6655 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
6656 (cursorToggleCB): change because of new timer code
6658 * lib/CREDITS: updated own mailaddress
6660 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6662 * src/support/filetools.C (PutEnv): fix the code in case neither
6663 putenv() nor setenv() have been found.
6665 * INSTALL: mention the install-strip Makefile target.
6667 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
6668 read-only documents.
6670 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6672 * lib/reLyX/configure.in (VERSION): avoid using a previously
6673 generated reLyX wrapper to find out $prefix.
6675 * lib/examples/eu_adibide_lyx-atua.lyx:
6676 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
6677 translation of the Tutorial (Dooteo)
6679 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
6681 * forms/cite.fd: new citation dialog
6683 * src/insetcite.[Ch]: the new citation dialog is moved into
6686 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
6689 * src/insets/insetcommand.h: data members made private.
6691 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6693 * LyX 1.1.5 released
6695 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6697 * src/version.h (LYX_RELEASE): to 1.1.5
6699 * src/spellchecker.C (RunSpellChecker): return false if the
6700 spellchecker dies upon creation.
6702 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6704 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
6705 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
6709 * lib/CREDITS: update entry for Martin Vermeer.
6711 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
6713 * src/text.C (draw): Draw foreign language bars at the bottom of
6714 the row instead of at the baseline.
6716 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
6718 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6720 * lib/bind/de_menus.bind: updated
6722 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
6724 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
6726 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
6728 * src/menus.C (Limit_string_length): New function
6729 (ShowTocMenu): Limit the number of items/length of items in the
6732 * src/paragraph.C (String): Correct result for a paragraph inside
6735 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6737 * src/bufferlist.C (close): test of buf->getuser() == NULL
6739 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
6741 * src/BufferView2.C (removeAutoInsets): Fix a bug:
6742 Do not call to SetCursor when the paragraph is a closed footnote!
6744 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
6746 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
6749 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
6751 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
6754 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
6755 reference popup, that activates the reference-back action
6757 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
6759 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
6760 the menus. Also fixed a bug.
6762 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
6763 the math panels when switching buffers (unless new buffer is readonly).
6765 * src/BufferView.C (NoSavedPositions)
6766 * src/BufferView_pimpl.C (NoSavedPositions): New methods
6768 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6770 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
6771 less of dvi dirty or not.
6773 * src/trans_mgr.[Ch] (insert): change first parameter to string
6776 * src/chset.[Ch] (encodeString): add const to first parameter
6778 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
6780 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
6784 * src/LaTeX.C (deplog): better searching for dependency files in
6785 the latex log. Uses now regexps.
6787 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
6788 instead of the box hack or \hfill.
6790 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6792 * src/lyxfunc.C (doImportHelper): do not create the file before
6793 doing the actual import.
6794 (doImportASCIIasLines): create a new file before doing the insert.
6795 (doImportASCIIasParagraphs): ditto.
6797 * lib/lyxrc.example: remove mention of non-existing commands
6799 * lyx.man: remove mention of color-related switches.
6801 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
6803 * src/lyx_gui.C: remove all the color-related ressources, which
6804 are not used anymore.
6806 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
6809 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
6811 * src/lyxrc.C (read): Add a missing break in the switch
6813 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
6815 * src/text2.C (InsertStringA): Fix a bug with insertion into table
6817 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
6820 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
6822 * src/text.C (draw): draw bars under foreign language words.
6824 * src/LColor.[Ch]: add LColor::language
6826 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
6828 * src/lyxcursor.h (boundary): New member variable
6830 * src/text.C (IsBoundary): New methods
6832 * src/text.C: Use the above for currect cursor movement when there
6833 is both RTL & LTR text.
6835 * src/text2.C: ditto
6837 * src/bufferview_funcs.C (ToggleAndShow): ditto
6839 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6841 * src/text.C (DeleteLineForward): set selection to true to avoid
6842 that DeleteEmptyParagraphMechanism does some magic. This is how it
6843 is done in all other functions, and seems reasonable.
6844 (DeleteWordForward): do not jump over non-word stuff, since
6845 CursorRightOneWord() already does it.
6847 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
6848 DeleteWordBackward, since they seem safe to me (since selection is
6849 set to "true") DeleteEmptyParagraphMechanism does nothing.
6851 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6853 * src/lyx_main.C (easyParse): simplify the code by factoring the
6854 part that removes parameters from the command line.
6855 (LyX): check wether wrong command line options have been given.
6857 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
6859 * src/lyx_main.C : add support for specifying user LyX
6860 directory via command line option -userdir.
6862 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
6864 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
6865 the number of items per popup.
6866 (Add_to_refs_menu): Ditto.
6868 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6870 * src/lyxparagraph.h: renamed ClearParagraph() to
6871 StripLeadingSpaces() and moved it to paragraph.C. We pass the
6872 textclass as parameter, and do nothing if free_spacing is
6873 true. This fixes part of the line-delete-forward problems.
6875 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
6876 (pasteSelection): ditto.
6877 (SwitchLayoutsBetweenClasses): more translatable strings.
6879 * src/text2.C (CutSelection): use StripLeadingSpaces.
6880 (PasteSelection): ditto.
6881 (DeleteEmptyParagraphMechanism): ditto.
6883 2000-05-26 Juergen Vigna <jug@sad.it>
6885 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
6886 is not needed in tabular insets.
6888 * src/insets/insettabular.C (TabularFeatures): added missing features.
6890 * src/tabular.C (DeleteColumn):
6892 (AppendRow): implemented this functions
6893 (cellsturct::operator=): clone the inset too;
6895 2000-05-23 Juergen Vigna <jug@sad.it>
6897 * src/insets/insettabular.C (LocalDispatch): better selection support
6898 when having multicolumn-cells.
6900 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
6902 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
6904 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6906 * src/ColorHandler.C (getGCForeground): put more test into _()
6908 * lib/examples/eu_splash.lyx: new file (Basque translation) from
6911 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
6914 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
6916 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
6917 there are no labels, or when buffer is readonly.
6919 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
6920 there are no labels, buffer is SGML, or when buffer is readonly.
6922 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6924 * src/LColor.C (LColor): change a couple of grey40 to grey60
6925 (LColor): rewore initalization to make compiles go some magnitude
6927 (getGUIName): don't use gettext until we need the string.
6929 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
6931 * src/Bullet.[Ch]: Fixed a small bug.
6933 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
6935 * src/paragraph.C (String): Several fixes/improvements
6937 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
6939 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6941 * src/paragraph.C (String): give more correct output.
6943 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
6945 * src/lyxfont.C (stateText) Do not output the language if it is
6946 eqaul to the language of the document.
6948 * src/paragraph.C (TeXOnePar): Do not put language switch commands
6949 between two paragraphs with the same language.
6951 * src/paragraph.C (getParLanguage) Return a correct answer for an
6952 empty dummy paragraph.
6954 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
6957 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
6960 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
6961 the menus/popup, if requested fonts are unavailable.
6963 2000-05-22 Juergen Vigna <jug@sad.it>
6965 * src/insets/insettabular.C (LocalDispatch): added some more cursor
6966 movement support (Up/Down/Tab/Shift-Tab).
6967 (LocalDispatch): added also preliminari cursor-selection.
6969 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
6971 * src/paragraph.C (PasteParagraph): Hopefully now right!
6973 2000-05-22 Garst R. Reese <reese@isn.net>
6975 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
6976 of list, change all references to Environment to Command
6977 * tex/hollywood.cls : rewrite environments as commands, add
6978 \uppercase to interiorshot and exteriorshot to force uppecase.
6979 * tex/broadway.cls : rewrite environments as commands. Tweak
6982 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6984 * src/menus.C (Add_to_toc_menu): fix the code which limits the
6985 size of items: use a constant intead of the hardcoded 40, and more
6986 importantly do not remove the %m and %x tags added at the end.
6987 (Add_to_refs_menu): use vector::size_type instead of
6988 unsigned int as basic types for the variables. _Please_ do not
6989 assume that size_t is equal to unsigned int. On an alpha, this is
6990 unsigned long, which is _not_ the same.
6992 * src/language.C (initL): remove language "hungarian", since it
6993 seems that "magyar" is better.
6995 2000-05-22 Juergen Vigna <jug@sad.it>
6997 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
6999 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
7002 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
7003 next was deleted but not set to 0.
7005 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7007 * src/language.C (initL): change the initialization of languages
7008 so that compiles goes _fast_.
7010 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
7013 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
7015 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7019 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7021 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
7023 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
7027 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
7030 * src/insets/insetlo*.[Ch]: Made editable
7032 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7034 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
7035 the current selection.
7037 * src/BufferView_pimpl.C (stuffClipboard): new method
7039 * src/BufferView.C (stuffClipboard): new method
7041 * src/paragraph.C (String): new method
7043 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
7044 LColor::ignore when lyxname is not found.
7046 * src/BufferView.C (pasteSelection): new method
7048 * src/BufferView_pimpl.C (pasteSelection): new method
7050 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
7052 * src/WorkArea.C (request_clipboard_cb): new static function
7053 (getClipboard): new method
7054 (putClipboard): new method
7056 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7058 * LyX 1.1.5pre2 released
7060 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7062 * src/vspace.C (operator=): removed
7063 (operator=): removed
7065 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
7067 * src/layout.C (NumberOfClass): manually set the type in make_pair
7068 (NumberOfLayout): ditto
7070 * src/language.C: use the Language constructor for ignore_lang
7072 * src/language.h: add constructors to struct Language
7074 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
7076 * src/text2.C (SetCursorIntern): comment out #warning
7078 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
7080 * src/mathed/math_iter.h: initialize sx and sw to 0
7082 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
7084 * forms/lyx.fd: Redesign of form_ref
7086 * src/LaTeXFeatures.[Ch]
7090 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
7093 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
7094 and Buffer::inset_iterator.
7096 * src/menus.C: Added new menus: TOC and Refs.
7098 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
7100 * src/buffer.C (getTocList): New method.
7102 * src/BufferView2.C (ChangeRefs): New method.
7104 * src/buffer.C (getLabelList): New method. It replaces the old
7105 getReferenceList. The return type is vector<string> instead of
7108 * src/insets/insetinclude.C (getLabelList): New method. Replaces
7109 the old getLabel() and GetNumberOfLabels() methods.
7110 * src/insets/insetlabel.C (getLabelList): ditto
7111 * src/mathed/formula.C (getLabelList): ditto
7113 * src/paragraph.C (String): New method.
7115 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
7116 Uses the new getTocList() method.
7117 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
7118 which automatically updates the contents of the browser.
7119 (RefUpdateCB): Use the new getLabelList method.
7121 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
7123 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
7125 * src/spellchecker.C: Added using std::reverse;
7127 2000-05-19 Juergen Vigna <jug@sad.it>
7129 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
7131 * src/insets/insettext.C (computeTextRows): small fix for display of
7132 1 character after a newline.
7134 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
7137 2000-05-18 Juergen Vigna <jug@sad.it>
7139 * src/insets/insettabular.C (TabularFeatures): fixed update of display
7140 when changing width of column.
7142 * src/tabular.C (set_row_column_number_info): setting of
7143 autobreak rows if necessary.
7145 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7147 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
7149 * src/vc-backend.*: renamed stat() to status() and vcstat to
7150 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
7151 compilation broke. The new name seems more relevant, anyway.
7153 2000-05-17 Juergen Vigna <jug@sad.it>
7155 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
7156 which was wrong if the removing caused removing of rows!
7158 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
7159 (pushToken): new function.
7161 * src/text2.C (CutSelection): fix problem discovered with purify
7163 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7165 * src/debug.C (showTags): enlarge the first column, now that we
7166 have 6-digits debug codes.
7168 * lib/layouts/hollywood.layout:
7169 * lib/tex/hollywood.cls:
7170 * lib/tex/brodway.cls:
7171 * lib/layouts/brodway.layout: more commands and fewer
7172 environments. Preambles moved in the .cls files. Broadway now has
7173 more options on scene numbering and less whitespace (from Garst)
7175 * src/insets/insetbib.C (getKeys): make sure that we are in the
7176 document directory, in case the bib file is there.
7178 * src/insets/insetbib.C (Latex): revert bogus change.
7180 2000-05-16 Juergen Vigna <jug@sad.it>
7182 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
7183 the TabularLayout on cursor move.
7185 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
7187 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
7190 (draw): fixed cursor position and drawing so that the cursor is
7191 visible when before the tabular-inset.
7193 * src/insets/insettext.C (init): drawLockedFrame was not initialized
7194 when creating from old insettext.
7196 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
7198 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7200 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
7201 * lib/tex/brodway.cls: ditto
7203 * lib/layouts/brodway.layout: change alignment of parenthical
7206 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7208 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
7209 versions 0.88 and 0.89 are supported.
7211 2000-05-15 Juergen Vigna <jug@sad.it>
7213 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
7216 * src/insets/insettext.C (computeTextRows): redone completely this
7217 function in a much cleaner way, because of problems when having a
7219 (draw): added a frame border when the inset is locked.
7220 (SetDrawLockedFrame): this sets if we draw the border or not.
7221 (SetFrameColor): this sets the frame color (default=insetframe).
7223 * src/insets/lyxinset.h: added x() and y() functions which return
7224 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
7225 function which is needed to see if we have a locking inset of some
7226 type in this inset (needed for now in insettabular).
7228 * src/vspace.C (inPixels): the same function also without a BufferView
7229 parameter as so it is easier to use it in some ocasions.
7231 * src/lyxfunc.C: changed all places where insertInset was used so
7232 that now if it couldn't be inserted it is deleted!
7234 * src/TabularLayout.C:
7235 * src/TableLayout.C: added support for new tabular-inset!
7237 * src/BufferView2.C (insertInset): this now returns a bool if the
7238 inset was really inserted!!!
7240 * src/tabular.C (GetLastCellInRow):
7241 (GetFirstCellInRow): new helper functions.
7242 (Latex): implemented for new tabular class.
7246 (TeXTopHLine): new Latex() helper functions.
7248 2000-05-12 Juergen Vigna <jug@sad.it>
7250 * src/mathed/formulamacro.C (Read):
7251 * src/mathed/formula.C (Read): read also the \end_inset here!
7253 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
7255 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
7256 crush when saving formulae with unbalanced parenthesis.
7258 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
7260 * src/layout.C: Add new keyword "endlabelstring" to layout file
7262 * src/text.C (GetVisibleRow): Draw endlabel string.
7264 * lib/layouts/broadway.layout
7265 * lib/layouts/hollywood.layout: Added endlabel for the
7266 Parenthetical layout.
7268 * lib/layouts/heb-article.layout: Do not use slanted font shape
7269 for Theorem like environments.
7271 * src/buffer.C (makeLaTeXFile): Always add "american" to
7272 the UsedLanguages list if document language is RTL.
7274 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7276 * add addendum to README.OS2 and small patch (from SMiyata)
7278 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7280 * many files: correct the calls to ChangeExtension().
7282 * src/support/filetools.C (ChangeExtension): remove the no_path
7283 argument, which does not belong there. Use OnlyFileName() instead.
7285 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
7286 files when LaTeXing a non-nice latex file.
7288 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
7289 a chain of "if". Return false when deadkeys are not handled.
7291 * src/lyx_main.C (LyX): adapted the code for default bindings.
7293 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
7294 bindings for basic functionality (except deadkeys).
7295 (deadKeyBindings): new method. Performs the bindings of deadkeys.
7297 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
7298 several methods: handle override_x_deadkeys.
7300 * src/lyxrc.h: remove the "bindings" map, which did not make much
7301 sense anyway. New variable override_x_deadkeys, defaulting to "true".
7303 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7305 * src/lyxfont.C (stateText): use a saner method to determine
7306 whether the font is "default". Seems to fix the crash with DEC
7309 * src/Bullet.[Ch] (Bullet): remove const on parameters.
7311 2000-05-08 Juergen Vigna <jug@sad.it>
7313 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
7314 TabularLayoutMenu with mouse-button-3
7315 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
7317 * src/TabularLayout.C: added this file for having a Layout for
7320 2000-05-05 Juergen Vigna <jug@sad.it>
7322 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
7323 recalculating inset-widths.
7324 (TabularFeatures): activated this function so that I can change
7325 tabular-features via menu.
7327 * src/menus.C (ShowEditMenu): inserted support for insettabular so
7328 that I can test some functions with the Table menu.
7330 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7332 * src/lyxfont.C (stateText): guard against stupid c++libs.
7334 * src/tabular.C: add using std::vector
7335 some whitespace changes, + removed som autogenerated code.
7337 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
7339 2000-05-05 Juergen Vigna <jug@sad.it>
7341 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
7342 row, columns and cellstructures.
7344 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7346 * lib/lyxrc.example: remove obsolete entries.
7348 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
7349 reading of protected_separator for free_spacing.
7351 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7353 * src/text.C (draw): do not display an exclamation mark in the
7354 margin for margin notes. This is confusing, ugly and
7357 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
7358 AMS math' is checked.
7360 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
7361 name to see whether including the amsmath package is needed.
7363 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
7365 * src/paragraph.C (validate): Compute UsedLanguages correctly
7366 (don't insert the american language if it doesn't appear in the
7369 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
7370 The argument of \thanks{} command is considered moving argument
7372 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
7375 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
7377 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
7378 for appendix/minipage/depth. The lines can be now both in the footnote
7379 frame, and outside the frame.
7381 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
7384 2000-05-05 Juergen Vigna <jug@sad.it>
7386 * src/table.[Ch]: removed the inset and buffer stuff as this is now
7387 neede only in tabular.[Ch].
7389 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7391 * src/insets/insetspecialchar.C (Read): allow command == '~' for
7393 (Write): write '~' for PROTECTED_SEPARATOR
7395 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7397 * src/lyxparagraph.h: add a friend struct matchIT after the struct
7400 * src/mathed/formula.C (drawStr): rename size to siz.
7402 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
7403 possibly fix a bug by not changing the pflags = flags to piflags =
7406 2000-05-05 Juergen Vigna <jug@sad.it>
7408 * src/insets/insetbib.C: moved using directive
7410 * src/ImportNoweb.C: small fix for being able to compile (missing
7413 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7415 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
7416 to use clear, since we don't depend on this in the code. Add test
7419 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7421 * (various *.C files): add using std::foo directives to please dec
7424 * replace calls to string::clear() to string::erase() (Angus)
7426 * src/cheaders/cmath: modified to provide std::abs.
7428 2000-05-04 Juergen Vigna <jug@sad.it>
7430 * src/insets/insettext.C: Prepared all for inserting of multiple
7431 paragraphs. Still display stuff to do (alignment and other things),
7432 but I would like to use LyXText to do this when we cleaned out the
7433 table-support stuff.
7435 * src/insets/insettabular.C: Changed lot of stuff and added lots
7436 of functionality still a lot to do.
7438 * src/tabular.C: Various functions changed name and moved to be
7439 const functions. Added new Read and Write functions and changed
7440 lots of things so it works good with tabular-insets (also removed
7441 some stuff which is not needed anymore * hacks *).
7443 * src/lyxcursor.h: added operators == and != which just look if
7444 par and pos are (not) equal.
7446 * src/buffer.C (latexParagraphs): inserted this function to latex
7447 all paragraphs form par to endpar as then I can use this too for
7450 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
7451 so that I can call this to from text insets with their own cursor.
7453 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
7454 output off all paragraphs (because of the fix below)!
7456 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
7457 the very last paragraph (this could be also the last paragraph of an
7460 * src/texrow.h: added rows() call which returns the count-variable.
7462 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
7464 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
7466 * lib/configure.m4: better autodetection of DocBook tools.
7468 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7470 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
7472 * src/lyx_cb.C: add using std::reverse;
7474 * src/LaTeX.C (run): on error always run deleteFilesOnError before
7477 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
7478 selected files. Should fix repeated errors from generated files.
7480 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
7482 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
7484 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
7485 the spellchecker popup.
7487 * lib/lyxrc.example: Removed the \number_inset section
7489 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7491 * src/insets/figinset.C (various): Use IsFileReadable() to make
7492 sure that the file actually exist. Relying on ghostscripts errors
7493 is a bad idea since they can lead to X server crashes.
7495 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
7497 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
7500 * lib/lyxrc.example: smallish typo in description of
7501 \view_dvi_paper_option
7503 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7506 * src/lyxfunc.C: doImportHelper to factor out common code of the
7507 various import methods. New functions doImportASCIIasLines,
7508 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
7509 doImportLinuxDoc for the format specific parts.
7512 * buffer.C: Dispatch returns now a bool to indicate success
7515 * lyx_gui.C: Add getLyXView() for member access
7517 * lyx_main.C: Change logic for batch commands: First try
7518 Buffer::Dispatch (possibly without GUI), if that fails, use
7521 * lyx_main.C: Add support for --import command line switch.
7522 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
7523 Available Formats: Everything accepted by 'buffer-import <format>'
7525 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7527 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
7530 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
7531 documents will be reformatted upon reentry.
7533 2000-04-27 Juergen Vigna <jug@sad.it>
7535 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
7536 correctly only last pos this was a bug.
7538 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7540 * release of lyx-1.1.5pre1
7542 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7544 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
7546 * src/menus.C: revert the change of naming (Figure->Graphic...)
7547 from 2000-04-11. It was incomplete and bad.
7549 * src/LColor.[Ch]: add LColor::depthbar.
7550 * src/text.C (GetVisibleRow): use it.
7552 * README: update the languages list.
7554 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
7556 * src/text.C (GetVisibleRow): show the depth of paragraphs using
7559 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7561 * README: remove sections that were just wrong.
7563 * src/text2.C (GetRowNearY): remove currentrow code
7565 * src/text.C (GetRow): remove currentrow code
7567 * src/screen.C (Update): rewritten a bit.
7568 (SmallUpdate): removed func
7570 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
7572 (FullRebreak): return bool
7573 (currentrow): remove var
7574 (currentrow_y): ditto
7576 * src/lyxscreen.h (Draw): change arg to unsigned long
7577 (FitCursor): return bool
7578 (FitManualCursor): ditto
7579 (Smallpdate): remove func
7580 (first): change to unsigned long
7581 (DrawOneRow): change second arg to long (from long &)
7582 (screen_refresh_y): remove var
7583 (scree_refresh_row): ditto
7585 * src/lyxrow.h: change baseline to usigned int from unsigned
7586 short, this brings some implicit/unsigned issues out in the open.
7588 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
7590 (Dispatch): don't call updateScrollbar after fitCursor. Use update
7591 instead of smallUpdate.
7593 * src/lyxcursor.h: change y to unsigned long
7595 * src/buffer.h: don't call updateScrollbar after fitcursor
7597 * src/buffer.C (parseSingleLyXformat2Token): move variables to
7598 where they are used. Removed "\\direction", this was not present
7599 in 1.1.4 and is already obsolete. Commented out some code that I
7600 believe to never be called.
7601 (runLiterate): don't call updateScrollbar after fitCursor
7603 (buildProgram): ditto
7606 * src/WorkArea.h (workWidth): change return val to unsigned
7609 (redraw): remove the button redraws
7610 (setScrollbarValue): change for scrollbar
7611 (getScrollbarValue): change for scrollbar
7612 (getScrollbarBounds): change for scrollbar
7614 * src/WorkArea.C (C_WorkArea_up_cb): removed func
7615 (C_WorkArea_down_cb): removed func
7616 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
7617 (resize): change for scrollbar
7618 (setScrollbar): ditto
7619 (setScrollbarBounds): ditto
7620 (setScrollbarIncrements): ditto
7621 (up_cb): removed func
7622 (down_cb): removed func
7623 (scroll_cb): change for scrollbar
7624 (work_area_handler): ditto
7626 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
7627 when FitCursor did something.
7628 (updateScrollbar): some unsigned changes
7629 (downCB): removed func
7630 (scrollUpOnePage): removed func
7631 (scrollDownOnePage): remvoed func
7632 (workAreaMotionNotify): don't call screen->FitCursor but use
7633 fitCursor instead. and bool return val
7634 (workAreaButtonPress): ditto
7635 (workAreaButtonRelease): some unsigned changes
7636 (checkInsetHit): ditto
7637 (workAreaExpose): ditto
7638 (update): parts rewritten, comments about the signed char arg added
7639 (smallUpdate): removed func
7640 (cursorPrevious): call needed updateScrollbar
7643 * src/BufferView2.C (allFloats): don't call updateScrollbar after
7646 * src/BufferView.[Ch] (upCB): removed func
7647 (downCB): removed func
7648 (smallUpdate): removed func
7650 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7652 * src/lyxtext.h src/text.C src/text2.C: removed support for the
7653 currentrow, currentrow_y optimization. This did not help a lot and
7654 if we want to do this kind of optimization we should rather use
7655 cursor.row instead of the currentrow.
7657 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
7658 buffer spacing and klyx spacing support.
7660 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
7662 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
7665 2000-04-26 Juergen Vigna <jug@sad.it>
7667 * src/insets/figinset.C: fixes to Lars sstream changes!
7669 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
7671 * A lot of files: Added Ascii(ostream &) methods to all inset
7672 classes. Used when exporting to ASCII.
7674 * src/buffer.C (writeFileAscii,RoffAsciiTable)
7675 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
7678 * src/text2.C (ToggleFree): Disabled implicit word selection when
7679 there is a change in the language
7681 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
7682 no output was generated for end-of-sentence inset.
7684 * src/insets/lyxinset.h
7687 * src/paragraph.C: Removed the insetnumber code
7689 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
7691 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7693 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
7694 no_babel and no_epsfig completely from the file.
7695 (parseSingleLyXformat2Token): add handling for per-paragraph
7696 spacing as written by klyx.
7698 * src/insets/figinset.C: applied patch by Andre. Made it work with
7701 2000-04-20 Juergen Vigna <jug@sad.it>
7703 * src/insets/insettext.C (cutSelection):
7704 (copySelection): Fixed with selection from right to left.
7705 (draw): now the rows are not recalculated at every draw.
7706 (computeTextRows): for now reset the inset-owner here (this is
7707 important for an undo or copy where the inset-owner is not set
7710 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
7711 motion to the_locking_inset screen->first was forgotten, this was
7712 not important till we got multiline insets.
7714 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7716 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
7717 code seems to be alright (it is code changed by Dekel, and the
7718 intent is indeed that all macros should be defined \protect'ed)
7720 * NEWS: a bit of reorganisation of the new user-visible features.
7722 2000-04-19 Juergen Vigna <jug@sad.it>
7724 * src/insets/insettext.C (init): using a LyXCursor now for cursor
7725 position. Set the inset_owner of the used paragraph so that it knows
7726 that it is inside an inset. Fixed cursor handling with mouse and
7727 cursor keys. Fixed wrong timed inset redraws and lots of other changes
7728 and cleanups to make TextInsets work better.
7730 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
7731 Changed parameters of various functions and added LockInsetInInset().
7733 * src/insets/insettext.C:
7735 * src/insets/insetcollapsable.h:
7736 * src/insets/insetcollapsable.C:
7737 * src/insets/insetfoot.h:
7738 * src/insets/insetfoot.C:
7739 * src/insets/insetert.h:
7740 * src/insets/insetert.C: cleaned up the code so that it works now
7741 correctly with insettext.
7743 * src/insets/inset.C:
7744 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
7745 that insets in insets are supported right.
7748 * src/table.C: lots of changes for use with inset tabular (and cleanup)
7750 * src/paragraph.C: some small fixes
7752 * src/debug.h: inserted INSETS debug info
7754 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
7755 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
7757 * src/commandtags.h:
7758 * src/LyXAction.C: insert code for InsetTabular.
7760 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
7761 not Button1MotionMask.
7762 (workAreaButtonRelease): send always a InsetButtonRelease event to
7764 (checkInsetHit): some setCursor fixes (always with insets).
7766 * src/BufferView2.C (lockInset): returns a bool now and extended for
7767 locking insets inside insets.
7768 (showLockedInsetCursor): it is important to have the cursor always
7769 before the locked inset.
7770 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
7772 * src/BufferView.h: made lockInset return a bool.
7774 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
7776 * src/text2.C (SetCursor): This now has a version with a LyXCursor
7777 that is used also internally but can be called as public to have back
7778 a cursor pos which is not set internally.
7779 (SetCursorIntern): Changed to use above function.
7781 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
7783 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7788 * NEWS: updated for prerelease of 1.1.5. Please comment and send
7789 patches for things that should be in or should be changed.
7791 * src/* [insetfiles]: change "usigned char fragile" to bool
7792 fragile. There was only one point that could that be questioned
7793 and that is commented in formulamacro.C. Grep for "CHECK".
7795 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
7796 (DeleteBuffer): take it out of CutAndPaste and make it static.
7798 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
7800 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
7801 output the spacing envir commands. Also the new commands used in
7802 the LaTeX output makes the result better.
7804 * src/Spacing.C (writeEnvirBegin): new method
7805 (writeEnvirEnd): new method
7807 2000-04-18 Juergen Vigna <jug@sad.it>
7809 * src/CutAndPaste.C: made textclass a static member of the class
7810 as otherwise it is not accesed right!!!
7812 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
7814 * forms/layout_forms.fd
7815 * src/layout_forms.h
7816 * src/layout_forms.C (create_form_form_character)
7817 * src/lyx_cb.C (UserFreeFont)
7818 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
7819 documents (in the layout->character popup).
7821 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7823 * src/spellchecker.C (create_ispell_pipe): fix a bug where
7824 \spell_command was in fact not honored (from Kevin Atkinson).
7826 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
7829 * src/lyx_gui.h: make lyxViews private (Angus)
7831 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
7833 * src/mathed/math_write.C
7834 (MathMatrixInset::Write) Put \protect before \begin{array} and
7835 \end{array} if fragile
7836 (MathParInset::Write): Put \protect before \\ if fragile
7838 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7840 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
7841 initialization if the LyXColorHandler must be done after the
7842 connections to the XServer has been established.
7844 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
7845 get the background pixel from the lyxColorhandler so that the
7846 figures are rendered with the correct background color.
7847 (NextToken): removed functions.
7848 (GetPSSizes): use ifs >> string instead of NextToken.
7850 * src/Painter.[Ch]: the color cache moved out of this file.
7852 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
7855 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7857 * src/WorkArea.C (work_area_handler): call BufferView::enterView
7858 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
7860 * src/BufferView.C (enterView): new func
7861 (leaveView): new func
7863 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
7865 (leaveView): new func, undefines xterm cursor when approp.
7867 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
7868 (AllowInput): delete the Workarea cursor handling from this func.
7870 * src/Painter.C (underline): draw a slimer underline in most cases.
7872 * src/lyx_main.C (error_handler): use extern "C"
7874 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7876 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
7877 sent directly to me.
7879 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
7880 to the list by Dekel.
7882 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
7885 * src/bufferview_funcs.[Ch]: two new files, moved several of the
7886 methods from lyx_cb.here.
7888 * src/lyx_cb.C: in addition to the above; removed input_prohibited
7891 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7893 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
7894 instead of using current_view directly.
7896 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
7898 * src/LyXAction.C (init): add the paragraph-spacing command.
7900 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
7902 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
7904 * src/lyx_cb.C (CurrentState): output a string when the spacing is
7905 different from the documents.
7907 * src/text.C (SetHeightOfRow): take paragraph spacing into
7908 account, paragraph spacing takes precedence over buffer spacing
7909 (GetVisibleRow): ditto
7911 * src/paragraph.C (writeFile): output the spacing parameter too.
7912 (validate): set the correct features if spacing is used in the
7914 (Clear): set spacing to default
7915 (MakeSameLayout): spacing too
7916 (HasSameLayout): spacing too
7917 (SetLayout): spacing too
7918 (TeXOnePar): output the spacing commands
7920 * src/lyxparagraph.h: added a spacing variable for use with
7921 per-paragraph spacing.
7923 * src/Spacing.h: add a Default spacing and a method to check if
7924 the current spacing is default. also added an operator==
7926 * src/text2.C (DeleteEmptyParagraphMechanism): added a
7929 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7931 * src/lyxserver.C (callback): fix dispatch of functions
7933 * src/insets/insetlatexaccent.C (checkContents): turn bogus
7934 printf() into lyxerr call.
7936 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
7939 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
7940 "Table" to "Table Box", "Float" to "Floating Material"; deletes
7941 the "Float" from each of the subitems.
7942 (ShowHelpMenu): add entry for "FAQ" and "TOC".
7944 * src/support/DebugStream.h: add an #ifdef to work around a gcc
7945 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
7946 documented the change so that the workaround can be nuked later.
7948 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
7951 * src/lyxlex_pimpl.C (next): do not re-declare the default value
7953 * src/buffer.C (getLatexName): ditto
7954 (setReadonly): ditto
7956 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7958 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
7959 avoid some uses of current_view. Added also a bufferParams()
7960 method to get at this.
7962 * src/lyxtext.h: changed params->buffer and paramters->bparams.
7964 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7966 * src/lyxparagraph.[Ch]: removed
7967 operator<(LyXParagraph::InsetTable..., added a struct matchIT
7968 with operators used by lower_bound and
7969 upper_bound in InsetTable's
7970 Make struct InsetTable private again. Used matchpos.
7972 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
7974 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
7975 document, the language of existing text is changed (unless the
7976 document is multi-lingual)
7978 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
7980 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
7982 * A lot of files: A rewrite of the Right-to-Left support.
7984 2000-04-10 Juergen Vigna <jug@sad.it>
7986 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
7987 misplaced cursor when inset in inset is locked.
7989 * src/insets/insettext.C (LocalDispatch): small fix so that a
7990 BREAKLINE is not inserted if we don't permit it with autBreakRows.
7992 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
7993 footnote font should be decreased in size twice when displaying.
7995 * src/insets/insettext.C (GetDrawFont): inserted this function as
7996 the drawing-font may differ from the real paragraph font.
7998 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
7999 insets (inset in inset!).
8001 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
8002 function here because we don't want footnotes inside footnotes.
8004 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
8006 (init): now set the inset_owner in paragraph.C
8007 (LocalDispatch): added some resetPos() in the right position
8010 (pasteSelection): changed to use the new CutAndPaste-Class.
8012 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
8013 which tells if it is allowed to insert another inset inside this one.
8015 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
8016 SwitchLayoutsBetweenClasses.
8018 * src/text2.C (InsertInset): checking of the new paragraph-function
8020 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
8021 is not needed anymore here!
8024 (PasteSelection): redone (also with #ifdef) so that now this uses
8025 the CutAndPaste-Class.
8026 (SwitchLayoutsBetweenClasses): removed here and implemented in the
8029 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
8030 from/to text/insets.
8032 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
8033 so that the paragraph knows if it is inside an (text)-inset.
8034 (InsertFromMinibuffer): changed return-value to bool as now it
8035 may happen that an inset is not inserted in the paragraph.
8036 (InsertInsetAllowed): this checks if it is allowed to insert an
8037 inset in this paragraph.
8039 (BreakParagraphConservative):
8040 (BreakParagraph) : small change for the above change of the return
8041 value of InsertFromMinibuffer.
8043 * src/lyxparagraph.h: added inset_owner and the functions to handle
8044 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
8046 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8048 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
8049 functions from BufferView to BufferView::Pimpl to ease maintence.
8051 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
8052 correctly. Also use SetCursorIntern instead of SetCursor.
8054 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
8057 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8059 * src/WorkArea.C (belowMouse): manually implement below mouse.
8061 * src/*: Add "explicit" on several constructors, I added probably
8062 some unneeded ones. A couple of changes to code because of this.
8064 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
8065 implementation and private parts from the users of BufferView. Not
8068 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
8069 implementation and private parts from the users of LyXLex. Not
8072 * src/BufferView_pimpl.[Ch]: new files
8074 * src/lyxlex_pimpl.[Ch]: new files
8076 * src/LyXView.[Ch]: some inline functions move out-of-line
8078 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8080 * src/lyxparagraph.h: make struct InsetTable public.
8082 * src/support/lyxstring.h: change lyxstring::difference_type to be
8083 ptrdiff_t. Add std:: modifiers to streams.
8085 * src/font.C: include the <cctype> header, for islower() and
8088 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8090 * src/font.[Ch]: new files. Contains the metric functions for
8091 fonts, takes a LyXFont as parameter. Better separation of concepts.
8093 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
8094 changes because of this.
8096 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
8098 * src/*: compile with -Winline and move functions that don't
8101 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
8104 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8106 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
8107 (various files changed because of this)
8109 * src/Painter.C (text): fixed the drawing of smallcaps.
8111 * src/lyxfont.[Ch] (drawText): removed unused member func.
8114 * src/*.C: added needed "using" statements and "std::" qualifiers.
8116 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
8118 * src/*.h: removed all use of "using" from header files use
8119 qualifier std:: instead.
8121 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8123 * src/text.C (Backspace): some additional cleanups (we already
8124 know whether cursor.pos is 0 or not).
8126 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
8127 automake does not provide one).
8129 * src/bmtable.h: replace C++ comments with C comments.
8131 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
8133 * src/screen.C (ShowCursor): Change the shape of the cursor if
8134 the current language is not equal to the language of the document.
8135 (If the cursor change its shape unexpectedly, then you've found a bug)
8137 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
8140 * src/insets/insetnumber.[Ch]: New files.
8142 * src/LyXAction.C (init)
8143 * src/lyxfunc.C (dispatch): Add command number-inset-insert
8146 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
8148 * src/lyxparagraph.h
8149 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
8150 (the vector is kept sorted).
8152 * src/text.C (GetVisibleRow): Draw selection correctly when there
8153 is both LTR and RTL text.
8155 * src/paragraph.C (Clone): Use the assignment operator for cloning,
8156 which is much faster.
8158 * src/text.C (GetVisibleRow and other): Do not draw the last space
8159 in a row if the direction of the last letter is not equal to the
8160 direction of the paragraph.
8162 * src/lyxfont.C (latexWriteStartChanges):
8163 Check that font language is not equal to basefont language.
8164 (latexWriteEndChanges): ditto
8166 * src/lyx_cb.C (StyleReset): Don't change the language while using
8167 the font-default command.
8169 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
8170 empty paragraph before a footnote.
8172 * src/insets/insetcommand.C (draw): Increase x correctly.
8174 * src/screen.C (ShowCursor): Change cursor shape if
8175 current language != document language.
8177 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
8179 2000-03-31 Juergen Vigna <jug@sad.it>
8181 * src/paragraph.C (GetInset): commented out text[pos] = ' '
8182 (Clone): changed mode how the paragraph-data is copied to the
8183 new clone-paragraph.
8185 * src/lyxfunc.C (Dispatch): fixed small problem when calling
8186 GetInset(pos) with no inset anymore there (in inset UNDO)
8188 * src/insets/insetcommand.C (draw): small fix as here x is
8189 incremented not as much as width() returns (2 before, 2 behind = 4)
8191 2000-03-30 Juergen Vigna <jug@sad.it>
8193 * src/insets/insettext.C (InsetText): small fix in initialize
8194 widthOffset (should not be done in the init() function)
8196 2000-03-29 Amir Karger <karger@lyx.org>
8198 * lib/examples/it_ItemizeBullets.lyx: translation by
8201 * Implemented \textasciitilde and fixed a tiny bug in reLyX
8203 2000-03-29 Juergen Vigna <jug@sad.it>
8205 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
8207 * src/insets/insetfoot.C (Clone): small change as for the below
8208 new init function in the text-inset
8210 * src/insets/insettext.C (init): new function as I've seen that
8211 clone did not copy the Paragraph-Data!
8212 (LocalDispatch): Added code so that now we have some sort of Undo
8213 functionality (well actually we HAVE Undo ;)
8215 * src/text.C (Backspace): Small fix for the a | a Backspace problem
8217 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
8219 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
8222 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8224 * src/main.C: added a runtime check that verifies that the xforms
8225 header used when building LyX and the library used when running
8226 LyX match. Exit with a message if they don't match. This is a
8227 version number check only.
8229 * src/buffer.C (save): Don't allocate memory on the heap for
8230 struct utimbuf times.
8232 * *: some using changes, use iosfwd instead of the real headers.
8234 * src/lyxfont.C use char const * instead of string for the static
8235 strings. Rewrite some functions to use sstream.
8237 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8239 * src/text.C (Backspace): hopefully fix the dreaded backaspace
8242 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8244 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
8245 of Geodesy (from Martin Vermeer)
8247 * lib/layouts/svjour.inc: include file for the Springer svjour
8248 class. It can be used to support journals other than JoG.
8250 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
8251 Miskiewicz <misiek@pld.org.pl>)
8252 * lib/reLyX/Makefile.am: ditto.
8254 2000-03-27 Juergen Vigna <jug@sad.it>
8256 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
8257 also some modifications with operations on selected text.
8259 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
8260 problems with clicking on insets (last famous words ;)
8262 * src/insets/insetcommand.C (draw):
8263 (width): Changed to have a bit of space before and after the inset so
8264 that the blinking cursor can be seen (otherwise it was hidden)
8266 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8268 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
8269 would not be added to the link list when an installed gettext (not
8270 part of libc) is found.
8272 2000-03-24 Juergen Vigna <jug@sad.it>
8274 * src/insets/insetcollapsable.C (Edit):
8275 * src/mathed/formula.C (InsetButtonRelease):
8276 (InsetButtonPress): fixed for new handling of ButtonPress/Release
8279 * src/BufferView.C (workAreaButtonPress):
8280 (workAreaButtonRelease):
8281 (checkInsetHit): Finally fixed the clicking on insets be handled
8284 * src/insets/insetert.C (Edit): inserted this call so that ERT
8285 insets work always with LaTeX-font
8287 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
8289 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
8290 caused lyx to startup with no GUI in place, causing in a crash
8291 upon startup when called with arguments.
8293 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8295 * src/FontLoader.C: better initialization of dummyXFontStruct.
8297 2000-03-20 José Abílio Matos <jamatos@lyx.org>
8299 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
8300 for linuxdoc and docbook import and export format options.
8302 * lib/lyxrc.example Example of default values for the previous flags.
8304 * src/lyx_cb.C Use those flags instead of the hardwired values for
8305 linuxdoc and docbook export.
8307 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
8310 * src/menus.C Added menus entries for the new import/exports formats.
8312 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8314 * src/lyxrc.*: Added support for running without Gui
8317 * src/FontLoader.C: sensible defaults if no fonts are needed
8319 * src/lyx_cb.C: New function ShowMessage (writes either to the
8320 minibuffer or cout in case of no gui
8321 New function AskOverwrite for common stuff
8322 Consequently various changes to call these functions
8324 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
8325 wild guess at sensible screen resolution when having no gui
8327 * src/lyxfont.C: no gui, no fonts... set some defaults
8329 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8331 * src/LColor.C: made the command inset background a bit lighter.
8333 2000-03-20 Hartmut Goebel <goebel@noris.net>
8335 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
8336 stdstruct.inc. Koma-Script added some title elements which
8337 otherwise have been listed below "bibliography". This split allows
8338 adding title elements to where they belong.
8340 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
8341 define the additional title elements and then include
8344 * many other layout files: changed to include stdtitle.inc just
8345 before stdstruct.inc.
8347 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
8349 * src/buffer.C: (save) Added the option to store all backup files
8350 in a single directory
8352 * src/lyxrc.[Ch]: Added variable \backupdir_path
8354 * lib/lyxrc.example: Added descriptions of recently added variables
8356 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
8357 bibtex inset, not closing the bibtex popup when deleting the inset)
8359 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8361 * src/lyx_cb.C: add a couple using directives.
8363 2000-03-17 José Abílio Matos <jamatos@lyx.org>
8364 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
8365 import based on the filename.
8367 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
8368 file would be imported at start, if the filename where of a sgml file.
8370 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
8372 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
8374 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
8375 * src/lyxfont.h Replaced the member variable bits.direction by the
8376 member variable lang. Made many changes in other files.
8377 This allows having a multi-lingual document
8379 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
8380 that change the current language to <l>.
8381 Removed the command "font-rtl"
8383 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
8384 format for Hebrew documents)
8386 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
8387 When auto_mathmode is "true", pressing a digit key in normal mode
8388 will cause entering into mathmode.
8389 If auto_mathmode is "rtl" then this behavior will be active only
8390 when writing right-to-left text.
8392 * src/text2.C (InsertStringA) The string is inserted using the
8395 * src/paragraph.C (GetEndLabel) Gives a correct result for
8396 footnote paragraphs.
8398 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
8400 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
8402 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
8403 front of PasteParagraph. Never insert a ' '. This should at least
8404 fix some cause for the segfaults that we have been experiencing,
8405 it also fixes backspace behaviour slightly. (Phu!)
8407 * src/support/lstrings.C (compare_no_case): some change to make it
8408 compile with gcc 2.95.2 and stdlibc++-v3
8410 * src/text2.C (MeltFootnoteEnvironment): change type o
8411 first_footnote_par_is_not_empty to bool.
8413 * src/lyxparagraph.h: make text private. Changes in other files
8415 (fitToSize): new function
8416 (setContentsFromPar): new function
8417 (clearContents): new function
8418 (SetChar): new function
8420 * src/paragraph.C (readSimpleWholeFile): deleted.
8422 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
8423 the file, just use a simple string instead. Also read the file in
8424 a more maintainable manner.
8426 * src/text2.C (InsertStringA): deleted.
8427 (InsertStringB): deleted.
8429 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8431 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
8432 RedoParagraphs from the doublespace handling part, just set status
8433 to NEED_MORE_REFRESH. Also don't update cursor position (should be
8434 done, but perhaps not like this.)
8436 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8438 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
8439 character when inserting an inset.
8441 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8443 * src/bufferparams.C (readLanguage): now takes "default" into
8446 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
8447 also initialize the toplevel_keymap with the default bindings from
8450 * src/buffer.C (Buffer): remove lyxrc from the parameters.
8452 * all files using lyxrc: have lyxrc as a real variable and not a
8453 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
8456 * src/lyxrc.C: remove double call to defaultKeyBindings
8458 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
8459 toolbar defauls using lyxlex. Remove enums, structs, functions
8462 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
8463 toolbar defaults. Also store default keybindings in a map.
8465 * src/ToolbarDefaults.[Ch]: New file. This class is used for
8466 storing the toolbar defaults without any xforms dependencies.
8468 * src/insets/figinset.C: patch posted to list by Andre Poenitz
8469 applied. Changed to use iterators.
8471 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
8473 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
8474 systems that don't have LINGUAS set to begin with.
8476 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8478 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
8479 the list by Dekel Tsur.
8481 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8483 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
8484 * src/insets/form_graphics.C: ditto.
8486 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
8488 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8490 * src/bufferparams.C (readLanguage): use the new language map
8492 * src/intl.C (InitKeyMapper): use the new language map
8494 * src/lyx_gui.C (create_forms): use the new language map
8496 * src/language.[Ch]: New files. Used for holding the information
8497 about each language. Now! Use this new language map enhance it and
8498 make it really usable for our needs.
8500 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
8502 * screen.C (ShowCursor): Removed duplicate code.
8503 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
8504 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
8506 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
8509 * src/text.C Added TransformChar method. Used for rendering Arabic
8510 text correctly (change the glyphs of the letter according to the
8511 position in the word)
8516 * src/lyxrc.C Added lyxrc command {language_command_begin,
8517 language_command_end,language_command_ltr,language_command_rtl,
8518 language_package} which allows the use of either arabtex or Omega
8521 * src/lyx_gui.C (init)
8523 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
8524 to use encoding for menu fonts which is different than the encoding
8527 * src/buffer.C (makeLaTeXFile): If params.language = "default",
8528 do not load the babel package.
8529 To write an English document with Hebrew/Arabic, change the document
8530 language to "english".
8532 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
8533 (alphaCounter): changed to return char
8534 (loweralphaCounter, hebrewCounter, romanCounter): New functions
8536 * lib/lyxrc.example Added examples for Hebrew/Arabic
8539 * src/layout.C Added layout command endlabeltype
8541 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
8543 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
8545 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8547 * src/mathed/math_delim.C (search_deco): return a
8548 math_deco_struct* instead of index.
8550 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8552 * All files with a USE_OSTREAM_ONLY within: removed all code that
8553 was unused when USE_OSTREAM_ONLY is defined.
8555 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
8556 of any less. Removed header and using.
8558 * src/text.C (GetVisibleRow): draw the string "Page Break
8559 (top/bottom)" on screen when drawing a pagebreak line.
8561 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8563 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
8565 * src/mathed/math_macro.C (draw): do some cast magic.
8568 * src/mathed/math_defs.h: change byte* argument to byte const*.
8570 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
8572 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
8573 know it is right to return InsetFoot* too, but cxx does not like
8576 * src/insets/insetcollapsable.[Ch] (Clone): make const.
8578 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
8580 * src/mathed/math_delim.C: change == to proper assignment.
8582 2000-03-09 Juergen Vigna <jug@sad.it>
8584 * src/insets/insettext.C (setPos): fixed various cursor positioning
8585 problems (via mouse and cursor-keys)
8586 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
8587 inset (still a small display problem but it works ;)
8589 * src/insets/insetcollapsable.C (draw): added button_top_y and
8590 button_bottom_y to have correct values for clicking on the inset.
8592 * src/support/lyxalgo.h: commented out 'using std::less'
8594 2000-03-08 Juergen Vigna <jug@sad.it>
8596 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
8597 Button-Release event closes as it is alos the Release-Event
8600 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
8602 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
8604 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
8605 can add multiple spaces in Scrap (literate programming) styles...
8606 which, by the way, is how I got hooked on LyX to begin with.
8608 * src/mathed/formula.C (Write): Added dummy variable to an
8609 inset::Latex() call.
8610 (Latex): Add free_spacing boolean to inset::Latex()
8612 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
8614 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
8615 virtual function to include the free_spacing boolean from
8616 the containing paragraph's style.
8618 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
8619 Added free_spacing boolean arg to match inset.h
8621 * src/insets/insettext.C, src/insets/insettext.h (Latex):
8622 Added free_spacing boolean arg to match inset.h
8624 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
8625 Added free_spacing boolean and made sure that if in a free_spacing
8626 paragraph, that we output normal space if there is a protected space.
8628 * src/insets/insetref.C, src/insets/insetref.h (Latex):
8629 Added free_spacing boolean arg to match inset.h
8631 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
8632 Added free_spacing boolean arg to match inset.h
8634 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
8635 Added free_spacing boolean arg to match inset.h
8637 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
8638 Added free_spacing boolean arg to match inset.h
8640 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
8641 Added free_spacing boolean arg to match inset.h
8643 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
8644 free_spacing boolean arg to match inset.h
8646 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
8647 Added free_spacing boolean arg to match inset.h
8649 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
8650 Added free_spacing boolean arg to match inset.h
8652 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
8653 Added free_spacing boolean arg to match inset.h
8655 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
8656 Added free_spacing boolean arg to match inset.h
8658 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
8659 Added free_spacing boolean arg to match inset.h
8661 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
8662 free_spacing boolean arg to match inset.h
8664 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
8665 free_spacing boolean arg to match inset.h
8667 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
8668 ignore free_spacing paragraphs. The user's spaces are left
8671 * src/text.C (InsertChar): Fixed the free_spacing layout
8672 attribute behavior. Now, if free_spacing is set, you can
8673 add multiple spaces in a paragraph with impunity (and they
8674 get output verbatim).
8675 (SelectSelectedWord): Added dummy argument to inset::Latex()
8678 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
8681 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
8682 paragraph layouts now only input a simple space instead.
8683 Special character insets don't make any sense in free-spacing
8686 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
8687 hard-spaces in the *input* file to simple spaces if the layout
8688 is free-spacing. This converts old files which had to have
8689 hard-spaces in free-spacing layouts where a simple space was
8691 (writeFileAscii): Added free_spacing check to pass to the newly
8692 reworked inset::Latex(...) methods. The inset::Latex() code
8693 ensures that hard-spaces in free-spacing paragraphs get output
8694 as spaces (rather than "~").
8696 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8698 * src/mathed/math_delim.C (draw): draw the empty placeholder
8699 delims with a onoffdash line.
8700 (struct math_deco_compare): struct that holds the "functors" used
8701 for the sort and the binary search in math_deco_table.
8702 (class init_deco_table): class used for initial sort of the
8704 (search_deco): use lower_bound to do a binary search in the
8707 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8709 * src/lyxrc.C: a small secret thingie...
8711 * src/lyxlex.C (printTable): changed to take a ostream as paramter
8712 and to not flush the stream as often as it used to.
8714 * src/support/lyxalgo.h: new file
8715 (sorted): template function used for checking if a sequence is
8716 sorted or not. Two versions with and without user supplied
8717 compare. Uses same compare as std::sort.
8719 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
8720 it and give warning on lyxerr.
8722 (struct compare_tags): struct with function operators used for
8723 checking if sorted, sorting and lower_bound.
8724 (search_kw): use lower_bound instead of manually implemented
8727 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8729 * src/insets/insetcollapsable.h: fix Clone() declaration.
8730 * src/insets/insetfoot.h: ditto.
8732 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
8734 2000-03-08 Juergen Vigna <jug@sad.it>
8736 * src/insets/lyxinset.h: added owner call which tells us if
8737 this inset is inside another inset. Changed also the return-type
8738 of Editable to an enum so it tells clearer what the return-value is.
8740 * src/insets/insettext.C (computeTextRows): fixed computing of
8741 textinsets which split automatically on more rows.
8743 * src/insets/insetert.[Ch]: changed this to be of BaseType
8746 * src/insets/insetfoot.[Ch]: added footnote inset
8748 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
8749 collapsable insets (like footnote, ert, ...)
8751 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8753 * src/lyxdraw.h: remvoe file
8755 * src/lyxdraw.C: remove file
8757 * src/insets/insettext.C: added <algorithm>.
8759 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8761 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
8762 (matrix_cb): case MM_OK use string stream
8764 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
8767 * src/mathed/math_macro.C (draw): use string stream
8768 (Metrics): use string stream
8770 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
8771 directly to the ostream.
8773 * src/vspace.C (asString): use string stream.
8774 (asString): use string stream
8775 (asLatexString): use string stream
8777 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
8778 setting Spacing::Other.
8780 * src/LaTeXFeatures.C (getPackages): use string stream instead of
8781 sprintf when creating the stretch vale.
8783 * src/text2.C (alphaCounter): changed to return a string and to
8784 not use a static variable internally. Also fixed a one-off bug.
8785 (SetCounter): changed the drawing of the labels to use string
8786 streams instead of sprintf.
8788 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
8789 manipulator to use a scheme that does not require library support.
8790 This is also the way it is done in the new GNU libstdc++. Should
8791 work with DEC cxx now.
8793 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8795 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
8796 end. This fixes a bug.
8798 * src/mathed (all files concerned with file writing): apply the
8799 USE_OSTREAM_ONLY changes to mathed too.
8801 * src/support/DebugStream.h: make the constructor explicit.
8803 * src/lyxfont.C (latexWriteStartChanges): small bug related to
8804 count and ostream squashed.
8806 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8808 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
8810 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
8811 ostringstream uses STL strings, and we might not.
8813 * src/insets/insetspecialchar.C: add using directive.
8814 * src/insets/insettext.C: ditto.
8816 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8818 * lib/layouts/seminar.layout: feeble attempt at a layout for
8819 seminar.cls, far from completet and could really use some looking
8820 at from people used to write layout files.
8822 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
8823 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
8824 a lot nicer and works nicely with ostreams.
8826 * src/mathed/formula.C (draw): a slightly different solution that
8827 the one posted to the list, but I think this one works too. (font
8828 size wrong in headers.)
8830 * src/insets/insettext.C (computeTextRows): some fiddling on
8831 Jürgens turf, added some comments that he should read.
8833 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
8834 used and it gave compiler warnings.
8835 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
8838 * src/lyx_gui.C (create_forms): do the right thing when
8839 show_banner is true/false.
8841 * src/lyx_cb.C (TimerCB): no need to close or do anything if
8842 show_banner is false.
8844 * most file writing files: Now use iostreams to do almost all of
8845 the writing. Also instead of passing string &, we now use
8846 stringstreams. mathed output is still not adapted to iostreams.
8847 This change can be turned off by commenting out all the occurences
8848 of the "#define USE_OSTREAM_ONLY 1" lines.
8850 * src/WorkArea.C (createPixmap): don't output debug messages.
8851 (WorkArea): don't output debug messages.
8853 * lib/lyxrc.example: added a comment about the new variable
8856 * development/Code_rules/Rules: Added some more commente about how
8857 to build class interfaces and on how better encapsulation can be
8860 2000-03-03 Juergen Vigna <jug@sad.it>
8862 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
8863 automatically with the width of the LyX-Window
8865 * src/insets/insettext.C (computeTextRows): fixed update bug in
8866 displaying text-insets (scrollvalues where not initialized!)
8868 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8870 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
8871 id in the check of the result from lower_bound is not enough since
8872 lower_bound can return last too, and then res->id will not be a
8875 * all insets and some code that use them: I have conditionalized
8876 removed the Latex(string & out, ...) this means that only the
8877 Latex(ostream &, ...) will be used. This is a work in progress to
8878 move towards using streams for all output of files.
8880 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
8883 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8885 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
8886 routine (this fixes bug where greek letters were surrounded by too
8889 * src/support/filetools.C (findtexfile): change a bit the search
8890 algorithm, to fix bug introduced in 1.1.4. Note that --format is
8891 no longer passed to kpsewhich, we may have to change that later.
8893 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
8894 warning options to avoid problems with X header files (from Angus
8896 * acinclude.m4: regenerated.
8898 2000-03-02 Juergen Vigna <jug@sad.it>
8900 * src/insets/insettext.C (WriteParagraphData): Using the
8901 par->writeFile() function for writing paragraph-data.
8902 (Read): Using buffer->parseSingleLyXformat2Token()-function
8903 for parsing paragraph data!
8905 * src/buffer.C (readLyXformat2): removed all parse data and using
8906 the new parseSingleLyXformat2Token()-function.
8907 (parseSingleLyXformat2Token): added this function to parse (read)
8908 lyx-file-format (this is called also from text-insets now!)
8910 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8912 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
8915 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
8916 directly instead of going through a func. One very bad thing: a
8917 static LyXFindReplace, but I don't know where to place it.
8919 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
8920 string instead of char[]. Also changed to static.
8921 (GetSelectionOrWordAtCursor): changed to static inline
8922 (SetSelectionOverLenChars): ditto.
8924 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
8925 current_view and global variables. both classes has changed names
8926 and LyXFindReplace is not inherited from SearchForm.
8928 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
8929 fl_form_search form.
8931 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
8933 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8935 * lib/bind/*.bind: make sure 'buffer-previous' function is not
8936 bound (from Kayvan).
8938 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
8940 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
8942 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8944 * some things that I should comment but the local pub says head to
8947 * comment out all code that belongs to the Roff code for Ascii
8948 export of tables. (this is unused)
8950 * src/LyXView.C: use correct type for global variable
8951 current_layout. (LyXTextClass::size_type)
8953 * some code to get the new insetgraphics closer to working I'd be
8954 grateful for any help.
8956 * src/BufferView2.C (insertInset): use the return type of
8957 NumberOfLayout properly. (also changes in other files)
8959 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
8960 this as a test. I want to know what breaks because of this.
8962 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
8964 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8966 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
8967 to use a \makebox in the label, this allows proper justification
8968 with out using protected spaces or multiple hfills. Now it is
8969 "label" for left justified, "\hfill label\hfill" for center, and
8970 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
8971 should be changed accordingly.
8973 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8975 * src/lyxtext.h: change SetLayout() to take a
8976 LyXTextClass::size_type instead of a char (when there is more than
8977 127 layouts in a class); also change type of copylayouttype.
8978 * src/text2.C (SetLayout): ditto.
8979 * src/LyXView.C (updateLayoutChoice): ditto.
8981 * src/LaTeX.C (scanLogFile): errors where the line number was not
8982 given just after the '!'-line were ignored (from Dekel Tsur).
8984 * lib/lyxrc.example: fix description of \date_insert_format
8986 * lib/layouts/llncs.layout: new layout, contributed by Martin
8989 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8991 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
8992 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
8993 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
8994 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
8995 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
8996 paragraph.C, text.C, text2.C)
8998 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9000 * src/insets/insettext.C (LocalDispatch): remove extra break
9003 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
9004 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
9006 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
9007 * src/insets/insettext.[Ch] (GetCursorPos): ditto
9009 * src/insets/insetbib.h: move InsetBibkey::Holder and
9010 InsetCitation::Holder in public space.
9012 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9014 * src/insets/insettext.h: small change to get the new files from
9015 Juergen to compile (use "string", not "class string").
9017 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
9018 const & as parameter to LocalDispatch, use LyXFont const & as
9019 paramter to some other func. This also had impacto on lyxinsets.h
9020 and the two mathed insets.
9022 2000-02-24 Juergen Vigna <jug@sad.it>
9025 * src/commandtags.h:
9027 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
9031 * src/BufferView2.C: added/updated code for various inset-functions
9033 * src/insets/insetert.[Ch]: added implementation of InsetERT
9035 * src/insets/insettext.[Ch]: added implementation of InsetText
9037 * src/insets/inset.C (Edit): added "unsigned int button" parameter
9038 (draw): added preliminary code for inset scrolling not finshed yet
9040 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
9041 as it is in lyxfunc.C now
9043 * src/insets/lyxinset.h: Added functions for text-insets
9045 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9047 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
9048 BufferView and reimplement the list as a queue put inside its own
9051 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
9053 * several files: use the new interface to the "updateinsetlist"
9055 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
9057 (work_area_handler): call BufferView::trippleClick on trippleclick.
9059 * src/BufferView.C (doubleClick): new function, selects word on
9061 (trippleClick): new function, selects line on trippleclick.
9063 2000-02-22 Allan Rae <rae@lyx.org>
9065 * lib/bind/xemacs.bind: buffer-previous not supported
9067 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9069 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
9072 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9074 * src/bufferlist.C: get rid of current_view from this file
9076 * src/spellchecker.C: get rid of current_view from this file
9078 * src/vspace.C: get rid of current_view from this file
9079 (inPixels): added BufferView parameter for this func
9080 (asLatexCommand): added a BufferParams for this func
9082 * src/text.C src/text2.C: get rid of current_view from these
9085 * src/lyxfont.C (getFontDirection): move this function here from
9088 * src/bufferparams.C (getDocumentDirection): move this function
9091 * src/paragraph.C (getParDirection): move this function here from
9093 (getLetterDirection): ditto
9095 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
9097 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
9098 resize due to wrong pixmap beeing used. Also took the opurtunity
9099 to make the LyXScreen stateless on regard to WorkArea and some
9100 general cleanup in the same files.
9102 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9104 * src/Makefile.am: add missing direction.h
9106 * src/PainterBase.h: made the width functions const.
9108 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
9111 * src/insets/insetcommand.C (draw): draw Editable as buttons.
9113 * src/insets/insetlatexaccent.C (draw): make the accents draw
9114 better, at present this will only work well with iso8859-1.
9116 * several files: remove the old drawing code, now we use the new
9119 * several files: remove support for mono_video, reverse_video and
9122 2000-02-17 Juergen Vigna <jug@sad.it>
9124 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
9125 int ** as we have to return the pointer, otherwise we have only
9126 NULL pointers in the returning function.
9128 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9130 * src/LaTeX.C (operator()): quote file name when running latex.
9132 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9134 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
9135 (bubble tip), this removes our special handling of this.
9137 * Remove all code that is unused now that we have the new
9138 workarea. (Code that are not active when NEW_WA is defined.)
9140 * Make the uses of XSync not conditionalized on define USE_XSYNC.
9142 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9144 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
9145 nonexisting layout; correctly redirect obsoleted layouts.
9147 * lib/lyxrc.example: document \view_dvi_paper_option
9149 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
9152 * src/lyx_cb.C (RunScript): handle $$FName for command names.
9153 (PreviewDVI): handle the view_dvi_paper_option variable.
9154 [Both from Roland Krause]
9156 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9158 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
9159 char const *, int, LyXFont)
9160 (text(int, int, string, LyXFont)): ditto
9162 * src/text.C (InsertCharInTable): attempt to fix the double-space
9163 feature in tables too.
9164 (BackspaceInTable): ditto.
9165 (GetVisibleRow): make bottom pagebreak line be a onoff line.
9167 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9169 * src/text2.C (owner): only complain if owner_ is set and bv != 0
9171 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
9172 newly found text in textcache to this.
9173 (buffer): set the owner of the text put into the textcache to 0
9175 * src/insets/figinset.C (draw): fixed the drawing of figures with
9178 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
9179 drawing of mathframe, hfills, protected space, table lines. I have
9180 now no outstanding drawing problems with the new Painter code.
9182 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9184 * src/PainterBase.C (ellipse, circle): do not specify the default
9187 * src/LColor.h: add using directive.
9189 * src/Painter.[Ch]: change return type of methods from Painter& to
9190 PainterBase&. Add a using directive.
9192 * src/WorkArea.C: wrap xforms callbacks in C functions
9195 * lib/layouts/foils.layout: font fix and simplifications from Carl
9198 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9200 * a lot of files: The Painter, LColor and WorkArea from the old
9201 devel branch has been ported to lyx-devel. Some new files and a
9202 lot of #ifdeffed code. The new workarea is enabled by default, but
9203 if you want to test the new Painter and LColor you have to compile
9204 with USE_PAINTER defined (do this in config.h f.ex.) There are
9205 still some rought edges, and I'd like some help to clear those
9206 out. It looks stable (loads and displays the Userguide very well).
9209 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9211 * src/buffer.C (pop_tag): revert to the previous implementation
9212 (use a global variable for both loops).
9214 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
9216 * src/lyxrc.C (LyXRC): change slightly default date format.
9218 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
9219 there is an English text with a footnote that starts with a Hebrew
9220 paragraph, or vice versa.
9221 (TeXFootnote): ditto.
9223 * src/text.C (LeftMargin): allow for negative values for
9224 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
9227 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
9228 for input encoding (cyrillic)
9230 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9232 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
9235 * src/toolbar.C (set): ditto
9236 * src/insets/insetbib.C (create_form_citation_form): ditto
9238 * lib/CREDITS: added Dekel Tsur.
9240 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
9241 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
9242 hebrew supports files from Dekel Tsur.
9244 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
9245 <tzafrir@technion.ac.il>
9247 * src/lyxrc.C: put \date_insert_format at the right place.
9249 * src/buffer.C (makeLaTeXFile): fix the handling of
9250 BufferParams::sides when writing out latex files.
9252 * src/BufferView2.C: add a "using" directive.
9254 * src/support/lyxsum.C (sum): when we use lyxstring,
9255 ostringstream::str needs an additional .c_str().
9257 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9259 * src/support/filetools.C (ChangeExtension): patch from Etienne
9262 * src/TextCache.C (show): remove const_cast and make second
9263 parameter non-const LyXText *.
9265 * src/TextCache.h: use non const LyXText in show.
9267 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
9270 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9272 * src/support/lyxsum.C: rework to be more flexible.
9274 * several places: don't check if a pointer is 0 if you are going
9277 * src/text.C: remove some dead code.
9279 * src/insets/figinset.C: remove some dead code
9281 * src/buffer.C: move the BufferView funcs to BufferView2.C
9282 remove all support for insetlatexdel
9283 remove support for oldpapersize stuff
9284 made some member funcs const
9286 * src/kbmap.C: use a std::list to store the bindings in.
9288 * src/BufferView2.C: new file
9290 * src/kbsequence.[Ch]: new files
9292 * src/LyXAction.C + others: remove all trace of buffer-previous
9294 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
9295 only have one copy in the binary of this table.
9297 * hebrew patch: moved some functions from LyXText to more
9298 appropriate places. (LyXParagraph, BufferParams, LyXFont)
9300 * several files: remove support for XForms older than 0.88
9302 remove some #if 0 #endif code
9304 * src/TextCache.[Ch]: new file. Holds the textcache.
9306 * src/BufferView.C: changes to use the new TextCache interface.
9307 (waitForX): remove the now unused code.
9309 * src/BackStack.h: remove some commented code
9311 * lib/bind/emacs.bind: remove binding for buffer-previous
9313 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9315 * applied the hebrew patch.
9317 * src/lyxrow.h: make sure that all Row variables are initialized.
9319 * src/text2.C (TextHandleUndo): comment out a delete, this might
9320 introduce a memory leak, but should also help us to not try to
9321 read freed memory. We need to look at this one.
9323 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
9324 (LyXParagraph): initalize footnotekind.
9326 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
9327 forgot this when applying the patch. Please heed the warnings.
9329 * src/BufferView.C (buffer): a fix for the buffer-reload problem
9330 (aka. reformat problem)
9332 * src/bufferlist.C (exists): made const, and use const_iterator
9333 (isLoaded): new func.
9334 (release): use std::find to find the correct buffer.
9336 * src/bufferlist.h: made getState a const func.
9337 made empty a const func.
9338 made exists a const func.
9341 2000-02-01 Juergen Vigna <jug@sad.it>
9343 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
9345 * po/it.po: updated a bit the italian po file and also changed the
9346 'file nuovo' for newfile to 'filenuovo' without a space, this did
9349 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
9350 for the new insert_date command.
9352 * src/lyxfunc.C (Dispatch): added support for a insert_date function
9353 from jdblair, to insert a date into the current text conforming to
9354 a strftime format (for now only considering the locale-set and not
9355 the document-language).
9357 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9359 * src/lyxfont.C (textWidth): hopefully better fix for the Array
9360 Bounds Read error seen by purify. The problem was that islower is
9361 a macros which takes an unsigned char and uses it as an index for
9362 in array of characters properties (and is thus subject to the
9366 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
9367 correctly the paper sides radio buttons.
9368 (UpdateDocumentButtons): ditto.
9370 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9372 * src/kbmap.C (getsym + others): change to return unsigned int,
9373 returning a long can give problems on 64 bit systems. (I assume
9374 that int is 32bit on 64bit systems)
9376 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9378 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
9379 LyXLookupString to be zero-terminated. Really fixes problems seen
9382 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9384 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
9385 write a (char*)0 to the lyxerr stream.
9387 * src/lastfiles.C: move algorithm before the using statemets.
9389 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9391 * src/lastfiles.C: move using directives in global scope (egcs 1.x
9392 complains otherwise).
9393 * src/table.C: ditto
9395 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
9398 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
9399 that I removed earlier... It is really needed.
9401 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
9403 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9405 * INSTALL: update xforms home page URL.
9407 * lib/configure.m4: fix a bug with unreadable layout files.
9409 * src/table.C (calculate_width_of_column): add "using std::max"
9412 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9414 * several files: marked several lines with "DEL LINE", this is
9415 lines that can be deleted without changing anything.
9416 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
9417 checks this anyway */
9420 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
9422 * src/DepTable.C (update): add a "+" at the end when the checksum
9423 is different. (debugging string only)
9425 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
9426 the next inset to not be displayed. This should also fix the list
9427 of labels in the "Insert Crossreference" dialog.
9429 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9431 * src/support/LSubstring.C (LSubstring): set pos to string::npos
9432 when regex was not found.
9434 * src/support/lstrings.C (lowercase): use handcoded transform always.
9437 * src/text.C (Delete): fixed the crash. cursor.par->prev and
9438 old_cursor.par->prev could be 0.
9440 * several files: changed post inc/dec to pre inc/dec
9442 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
9443 write the lastfiles to file.
9445 * src/BufferView.C (buffer): only show TextCache info when debugging
9447 (resizeCurrentBuffer): ditto
9448 (workAreaExpose): ditto
9450 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
9452 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
9454 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
9455 a bit better by removing the special case for \i and \j.
9457 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9459 * src/lyx_main.C (easyParse): remove test for bad comand line
9460 options, since this broke all xforms-related parsing.
9462 * src/kbmap.C (getsym): set return type to unsigned long, as
9463 declared in header. On an alpha, long is _not_ the same as int.
9465 * src/support/LOstream.h: add a "using std::flush;"
9467 * src/insets/figinset.C: ditto.
9469 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
9471 * src/bufferlist.C (write): use blinding fast file copy instead of
9472 "a char at a time", now we are doing it the C++ way.
9474 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
9475 std::list<int> instead.
9476 (addpidwait): reflect move to std::list<int>
9477 (sigchldchecker): ditto
9479 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
9482 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
9483 that obviously was wrong...
9485 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
9486 c, this avoids warnings with purify and islower.
9488 * src/insets/figinset.C: rename struct queue to struct
9489 queue_element and rewrite to use a std::queue. gsqueue is now a
9490 std::queue<queue_element>
9491 (runqueue): reflect move to std::queue
9494 * src/support/lstrings.h (tostr): specialize for bool, otherwise
9495 we would get "1" "0" instead of "true" "false. Also make the tostr
9498 2000-01-21 Juergen Vigna <jug@sad.it>
9500 * src/buffer.C (writeFileAscii): Disabled code for special groff
9501 handling of tabulars till I fix this in table.C
9503 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9505 * src/support/mkdir.C (mkdir): change second argument of mkdir to
9507 * src/support/lyxlib.h: ditto.
9509 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9511 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
9512 and 'j' look better. This might fix the "macron" bug that has been
9515 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
9516 functions as one template function. Delete the old versions.
9518 * src/support/lyxsum.C: move using std::ifstream inside
9521 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
9524 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
9526 * src/mathed/formula.C: delete #include "bufferlist.h" never used
9528 * src/insets/figinset.C (InitFigures): use new instead of malloc
9529 to allocate memory for figures and bitmaps.
9530 (DoneFigures): use delete[] instead of free to deallocate memory
9531 for figures and bitmaps.
9532 (runqueue): use new to allocate
9533 (getfigdata): use new/delete[] instead of malloc/free
9534 (RegisterFigure): ditto
9536 * some files: moved some declarations closer to first use, small
9537 whitespace changes use preincrement instead of postincrement where
9538 it does not make a difference.
9540 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
9541 step on the way to use stl::containers for key maps.
9543 * src/bufferlist.h: add a typedef for const_iterator and const
9544 versions of begin and end.
9546 * src/bufferlist.[Ch]: change name of member variable _state to
9547 state_. (avoid reserved names)
9549 (getFileNames): returns the filenames of the buffers in a vector.
9551 * configure.in (ALL_LINGUAS): added ro
9553 * src/support/putenv.C: new file
9555 * src/support/mkdir.C: new file
9557 2000-01-20 Allan Rae <rae@lyx.org>
9559 * lib/layouts/IEEEtran.layout: Added several theorem environments
9561 * lib/templates/IEEEtran.lyx: Example theorem environments and a
9562 couple of minor additions.
9564 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
9565 (except for those in footnotes of course)
9567 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
9569 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
9571 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
9572 std::sort and std::lower_bound instead of qsort and handwritten
9574 (struct compara): struct that holds the functors used by std::sort
9575 and std::lower_bound in MathedLookupBOP.
9577 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9579 * src/support/LAssert.h: do not do partial specialization. We do
9582 * src/support/lyxlib.h: note that lyx::getUserName() and
9583 lyx::date() are not in use right now. Should these be suppressed?
9585 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
9586 (makeLinuxDocFile): do not put date and user name in linuxdoc
9589 * src/support/lyxlib.h (kill): change first argument to long int,
9590 since that's what solaris uses.
9592 * src/support/kill.C (kill): fix declaration to match prototype.
9594 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
9595 actually check whether namespaces are supported. This is not what
9598 * src/support/lyxsum.C: add a using directive.
9600 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9602 * src/support/kill.C: if we have namespace support we don't have
9603 to include lyxlib.h.
9605 * src/support/lyxlib.h: use namespace lyx if supported.
9607 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9609 * src/support/date.C: new file
9611 * src/support/chdir.C: new file
9613 * src/support/getUserName.C: new file
9615 * src/support/getcwd.C: new file
9617 * src/support/abort.C: new file
9619 * src/support/kill.C: new file
9621 * src/support/lyxlib.h: moved all the functions in this file
9622 insede struct lyx. Added also kill and abort to this struct. This
9623 is a way to avoid the "kill is not defined in <csignal>", we make
9624 C++ wrappers for functions that are not ANSI C or ANSI C++.
9626 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
9627 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
9628 lyx it has been renamed to sum.
9630 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9632 * src/text.C: add using directives for std::min and std::max.
9634 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9636 * src/texrow.C (getIdFromRow): actually return something useful in
9637 id and pos. Hopefully fixes the bug with positionning of errorbox
9640 * src/lyx_main.C (easyParse): output an error and exit if an
9641 incorrect command line option has been given.
9643 * src/spellchecker.C (ispell_check_word): document a memory leak.
9645 * src/bufferlist.C (write): fix mismatched allocation/deletion,
9646 where a "struct utimbuf" is allocated with "new" and deleted with
9649 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
9651 * src/text2.C (CutSelection): don't delete double spaces.
9652 (PasteSelection): ditto
9653 (CopySelection): ditto
9655 * src/text.C (Backspace): don't delete double spaces.
9657 * src/lyxlex.C (next): fix a bug that were only present with
9658 conformant std::istream::get to read comment lines, use
9659 std::istream::getline instead. This seems to fix the problem.
9661 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9663 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
9664 allowed to insert space before space" editing problem. Please read
9665 commends at the beginning of the function. Comments about usage
9668 * src/text.C (InsertChar): fix for the "not allowed to insert
9669 space before space" editing problem.
9671 * src/text2.C (DeleteEmptyParagraphMechanism): when
9672 IsEmptyTableRow can only return false this last "else if" will
9673 always be a no-op. Commented out.
9675 * src/text.C (RedoParagraph): As far as I can understand tmp
9676 cursor is not really needed.
9678 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
9679 present it could only return false anyway.
9680 (several functions): Did something not so smart...added a const
9681 specifier on a lot of methods.
9683 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
9684 and add a tmp->text.resize. The LyXParagraph constructor does the
9686 (BreakParagraphConservative): ditto
9688 * src/support/path.h (Path): add a define so that the wrong usage
9689 "Path("/tmp") will be flagged as a compilation error:
9690 "`unnamed_Path' undeclared (first use this function)"
9692 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9694 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
9695 which was bogus for several reasons.
9697 * src/LaTeX.C (scanAux): fix the regular expression used to scan
9701 * autogen.sh: do not use "type -path" (what's that anyway?).
9703 * src/support/filetools.C (findtexfile): remove extraneous space
9704 which caused a kpsewhich warning (at least with kpathsea version
9707 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9709 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
9711 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
9713 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
9715 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9717 * src/paragraph.C (BreakParagraph): do not reserve space on text
9718 if we don't need to (otherwise, if pos_end < pos, we end up
9719 reserving huge amounts of memory due to bad unsigned karma).
9720 (BreakParagraphConservative): ditto, although I have not seen
9721 evidence the bug can happen here.
9723 * src/lyxparagraph.h: add a using std::list.
9725 2000-01-11 Juergen Vigna <jug@sad.it>
9727 * src/menus.C (MenuDocu): output an Alert if the documentation-file
9730 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9732 * src/vc-backend.C (doVCCommand): change to be static and take one
9733 more parameter: the path to chdir too be fore executing the command.
9734 (retrive): new function equiv to "co -r"
9736 * src/bufferlist.C (loadLyXFile): implement the missing parts if
9737 file_not_found_hook is true.
9739 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
9741 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
9742 if a file is readwrite,readonly...anything else.
9744 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9746 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
9747 (CreatePostscript): name change from MenuRunDVIPS (or something)
9748 (PreviewPostscript): name change from MenuPreviewPS
9749 (PreviewDVI): name change from MenuPreviewDVI
9751 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
9752 \view_pdf_command., \pdf_to_ps_command
9754 * lib/configure.m4: added search for PDF viewer, and search for
9755 PDF to PS converter.
9756 (lyxrc.defaults output): add \pdflatex_command,
9757 \view_pdf_command and \pdf_to_ps_command.
9759 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
9761 * src/bufferlist.C (write): we don't use blocksize for anything so
9764 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9766 * src/support/block.h: disable operator T* (), since it causes
9767 problems with both compilers I tried. See comments in the file.
9769 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
9772 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
9773 variable LYX_DIR_10x to LYX_DIR_11x.
9775 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
9777 * INSTALL: document --with-lyxname.
9780 * configure.in: new configure flag --with-lyxname which allows to
9781 choose the name under which lyx is installed. Default is "lyx", of
9782 course. It used to be possible to do this with --program-suffix,
9783 but the later has in fact a different meaning for autoconf.
9785 * src/support/lstrings.h (lstrchr): reformat a bit.
9787 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
9788 * src/mathed/math_defs.h: ditto.
9790 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9792 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
9793 true, decides if we create a backup file or not when saving. New
9794 tag and variable \pdf_mode, defaults to false. New tag and
9795 variable \pdflatex_command, defaults to pdflatex. New tag and
9796 variable \view_pdf_command, defaults to xpdf. New tag and variable
9797 \pdf_to_ps_command, defaults to pdf2ps.
9799 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9801 * src/bufferlist.C (close): don't call insetUnlock if the buffer
9802 does not have a BufferView.
9803 (unlockInset): ditto + don't access the_locking_inset if the
9804 buffer does not have a BufferView.
9806 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
9807 certain circumstances so that we don't continue a keyboard
9808 operation long after the key was released. Try f.ex. to load a
9809 large document, press PageDown for some seconds and then release
9810 it. Before this change the document would contine to scroll for
9811 some time, with this change it stops imidiatly.
9813 * src/support/block.h: don't allocate more space than needed. As
9814 long as we don't try to write to the arr[x] in a array_type arr[x]
9815 it is perfectly ok. (if you write to it you might segfault).
9816 added operator value_type*() so that is possible to pass the array
9817 to functions expecting a C-pointer.
9819 * lib/Makefile.am (dist-hook): don't fail completely if unable to
9822 * intl/*: updated to gettext 0.10.35, tried to add our own
9823 required modifications. Please verify.
9825 * po/*: updated to gettext 0.10.35, tried to add our own required
9826 modifications. Please verify.
9828 * src/support/lstrings.C (tostr): go at fixing the problem with
9829 cxx and stringstream. When stringstream is used return
9830 oss.str().c_str() so that problems with lyxstring and basic_string
9831 are avoided. Note that the best solution would be for cxx to use
9832 basic_string all the way, but it is not conformant yet. (it seems)
9834 * src/lyx_cb.C + other files: moved several global functions to
9835 class BufferView, some have been moved to BufferView.[Ch] others
9836 are still located in lyx_cb.C. Code changes because of this. (part
9837 of "get rid of current_view project".)
9839 * src/buffer.C + other files: moved several Buffer functions to
9840 class BufferView, the functions are still present in buffer.C.
9841 Code changes because of this.
9843 * config/lcmessage.m4: updated to most recent. used when creating
9846 * config/progtest.m4: updated to most recent. used when creating
9849 * config/gettext.m4: updated to most recent. applied patch for
9852 * config/gettext.m4.patch: new file that shows what changes we
9853 have done to the local copy of gettext.m4.
9855 * config/libtool.m4: new file, used in creation of acinclude.m4
9857 * config/lyxinclude.m4: new file, this is the lyx created m4
9858 macros, used in making acinclude.m4.
9860 * autogen.sh: GNU m4 discovered as a separate task not as part of
9861 the lib/configure creation.
9862 Generate acinlucde from files in config. Actually cat
9863 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
9864 easier to upgrade .m4 files that really are external.
9866 * src/Spacing.h: moved using std::istringstream to right after
9867 <sstream>. This should fix the problem seen with some compilers.
9869 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9871 * src/lyx_cb.C: began some work to remove the dependency a lot of
9872 functions have on BufferView::text, even if not really needed.
9873 (GetCurrentTextClass): removed this func, it only hid the
9876 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
9877 forgot this in last commit.
9879 * src/Bullet.C (bulletEntry): use static char const *[] for the
9880 tables, becuase of this the return arg had to change to string.
9882 (~Bullet): removed unneeded destructor
9884 * src/BufferView.C (beforeChange): moved from lyx_cb.C
9885 (insetSleep): moved from Buffer
9886 (insetWakeup): moved from Buffer
9887 (insetUnlock): moved from Buffer
9889 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
9890 from Buffer to BufferView.
9892 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
9894 * config/ltmain.sh: updated to version 1.3.4 of libtool
9896 * config/ltconfig: updated to version 1.3.4 of libtool
9898 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9901 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
9902 Did I get that right?
9904 * src/lyxlex.h: add a "using" directive or two.
9905 * src/Spacing.h: ditto.
9906 * src/insets/figinset.C: ditto.
9907 * src/support/filetools.C: ditto.
9908 * src/support/lstrings.C: ditto.
9909 * src/BufferView.C: ditto.
9910 * src/bufferlist.C: ditto.
9911 * src/lyx_cb.C: ditto.
9912 * src/lyxlex.C: ditto.
9914 * NEWS: add some changes for 1.1.4.
9916 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9918 * src/BufferView.C: first go at a TextCache to speed up switching
9921 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9923 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
9924 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
9925 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
9926 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
9929 * src/mathed/math_defs.h (MathedRowSt): make sure that all
9930 members of the struct are correctly initialized to 0 (detected by
9932 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
9933 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
9935 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
9936 pidwait, since it was allocated with "new". This was potentially
9937 very bad. Thanks to Michael Schmitt for running purify for us.
9940 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9942 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
9944 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
9946 1999-12-30 Allan Rae <rae@lyx.org>
9948 * lib/templates/IEEEtran.lyx: minor change
9950 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
9951 src/mathed/formula.C (LocalDispatch): askForText changes
9953 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
9954 know when a user has cancelled input. Fixes annoying problems with
9955 inserting labels and version control.
9957 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9959 * src/support/lstrings.C (tostr): rewritten to use strstream and
9962 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
9964 * src/support/filetools.C (IsFileWriteable): use fstream to check
9965 (IsDirWriteable): use fileinfo to check
9967 * src/support/filetools.h (FilePtr): whole class deleted
9969 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
9971 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
9973 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
9975 * src/bufferlist.C (write): use ifstream and ofstream instead of
9978 * src/Spacing.h: use istrstream instead of sscanf
9980 * src/mathed/math_defs.h: change first arg to istream from FILE*
9982 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
9984 * src/mathed/math_parser.C: have yyis to be an istream
9985 (LexGetArg): use istream (yyis)
9987 (mathed_parse): ditto
9988 (mathed_parser_file): first arg istream instead of FILE*, set yyis
9990 * src/mathed/formula.C (Read): rewritten to use istream
9992 * src/mathed/formulamacro.C (Read): rewritten to use istream
9994 * src/lyxlex.h (~LyXLex): deleted desturctor
9995 (getStream): new function, returns an istream
9996 (getFile): deleted funtion
9997 (IsOK): return is.good();
9999 * src/lyxlex.C (LyXLex): delete file and owns_file
10000 (setFile): open an filebuf and assign that to a istream instead of
10002 (setStream): new function, takes an istream as arg.
10003 (setFile): deleted function
10004 (EatLine): rewritten us use istream instead of FILE*
10008 * src/table.C (LyXTable): use istream instead of FILE*
10009 (Read): rewritten to take an istream instead of FILE*
10011 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10013 * src/buffer.C (Dispatch): remove an extraneous break statement.
10015 * src/support/filetools.C (QuoteName): change to do simple
10016 'quoting'. More work is necessary. Also changed to do nothing
10017 under emx (needs fix too).
10018 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
10020 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
10021 config.h.in to the AC_DEFINE_UNQUOTED() call.
10022 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
10023 needs char * as argument (because Solaris 7 declares it like
10026 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
10027 remove definition of BZERO.
10029 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10031 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
10032 defined, "lyxregex.h" if not.
10034 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
10036 (REGEX): new variable that is set to regex.c lyxregex.h when
10037 AM_CONDITIONAL USE_REGEX is set.
10038 (libsupport_la_SOURCES): add $(REGEX)
10040 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
10043 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
10046 * configure.in: add call to LYX_REGEX
10048 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
10049 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
10051 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10053 * lib/bind/fi_menus.bind: new file, from
10054 pauli.virtanen@saunalahti.fi.
10056 * src/buffer.C (getBibkeyList): pass the parameter delim to
10057 InsetInclude::getKeys and InsetBibtex::getKeys.
10059 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
10060 is passed to Buffer::getBibkeyList
10062 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
10063 instead of the hardcoded comma.
10065 * src/insets/insetbib.C (getKeys): make sure that there are not
10066 leading blanks in bibtex keys. Normal latex does not care, but
10067 harvard.sty seems to dislike blanks at the beginning of citation
10068 keys. In particular, the retturn value of the function is
10070 * INSTALL: make it clear that libstdc++ is needed and that gcc
10071 2.7.x probably does not work.
10073 * src/support/filetools.C (findtexfile): make debug message go to
10075 * src/insets/insetbib.C (getKeys): ditto
10077 * src/debug.C (showTags): make sure that the output is correctly
10080 * configure.in: add a comment for TWO_COLOR_ICON define.
10082 * acconfig.h: remove all the entries that already defined in
10083 configure.in or acinclude.m4.
10085 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
10086 to avoid user name, date and copyright.
10088 1999-12-21 Juergen Vigna <jug@sad.it>
10090 * src/table.C (Read): Now read bogus row format informations
10091 if the format is < 5 so that afterwards the table can
10092 be read by lyx but without any format-info. Fixed the
10093 crash we experienced when not doing this.
10095 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
10097 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
10098 (RedoDrawingOfParagraph): ditto
10099 (RedoParagraphs): ditto
10100 (RemoveTableRow): ditto
10102 * src/text.C (Fill): rename arg paperwidth -> paper_width
10104 * src/buffer.C (insertLyXFile): rename var filename -> fname
10105 (writeFile): rename arg filename -> fname
10106 (writeFileAscii): ditto
10107 (makeLaTeXFile): ditto
10108 (makeLinuxDocFile): ditto
10109 (makeDocBookFile): ditto
10111 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
10114 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
10116 * src/bmtable.h: add extern "C" on this file when __cplusplus is
10119 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
10120 compiled by a C compiler not C++.
10122 * src/layout.h (LyXTextClass): added typedef for const_iterator
10123 (LyXTextClassList): added typedef for const_iterator + member
10124 functions begin and end.
10126 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
10127 iterators to fill the choice_class.
10128 (updateLayoutChoice): rewritten to use iterators to fill the
10129 layoutlist in the toolbar.
10131 * src/BufferView.h (BufferView::work_area_width): removed unused
10134 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
10136 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
10137 (sgmlCloseTag): ditto
10139 * src/support/lstrings.h: return type of countChar changed to
10142 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
10143 what version of this func to use. Also made to return unsigned int.
10145 * configure.in: call LYX_STD_COUNT
10147 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
10148 conforming std::count.
10150 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10152 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
10153 and a subscript would give bad display (patch from Dekel Tsur
10154 <dekel@math.tau.ac.il>).
10156 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
10158 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
10161 * src/chset.h: add a few 'using' directives
10163 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
10164 triggered when no buffer is active
10166 * src/layout.C: removed `break' after `return' in switch(), since
10169 * src/lyx_main.C (init): make sure LyX can be ran in place even
10170 when libtool has done its magic with shared libraries. Fix the
10171 test for the case when the system directory has not been found.
10173 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
10174 name for the latex file.
10175 (MenuMakeHTML): ditto
10177 * src/buffer.h: add an optional boolean argument, which is passed
10178 to ChangeExtension.
10180 1999-12-20 Allan Rae <rae@lyx.org>
10182 * lib/templates/IEEEtran.lyx: small correction and update.
10184 * configure.in: Attempted to use LYX_PATH_HEADER
10186 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
10188 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
10189 input from JMarc. Now use preprocessor to find the header.
10190 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
10191 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
10192 LYX_STL_STRING_FWD. See comments in file.
10194 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
10196 * The global MiniBuffer * minibuffer variable is dead.
10198 * The global FD_form_main * fd_form_main variable is dead.
10200 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10202 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
10204 * src/table.h: add the LOstream.h header
10205 * src/debug.h: ditto
10207 * src/LyXAction.h: change the explaination of the ReadOnly
10208 attribute: is indicates that the function _can_ be used.
10210 * src/LyXAction.C (init): find-replace _can_ be used in read-only
10213 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10215 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
10221 * src/paragraph.C (GetWord): assert on pos>=0
10224 * src/support/lyxstring.C: condition the use of an invariant on
10226 * src/support/lyxstring.h: ditto
10228 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
10229 Use LAssert.h instead of plain assert().
10231 * src/support/lstrings.h: add LAssert.h, in case it is needed.
10233 * src/lyxfunc.C: do not include LAssert.h, it is not used.
10234 * src/support/filetools.C: ditto
10236 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
10239 * INSTALL: document the new configure flags
10241 * configure.in: suppress --with-debug; add --enable-assertions
10243 * acinclude.m4: various changes in alignment of help strings.
10245 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
10247 * src/kbmap.C: commented out the use of the hash map in kb_map,
10248 beginning of movement to a stl::container.
10250 * several files: removed code that was not in effect when
10251 MOVE_TEXT was defined.
10253 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
10254 for escaping should not be used. We can discuss if the string
10255 should be enclosed in f.ex. [] instead of "".
10257 * src/trans_mgr.C (insert): use the new returned value from
10258 encodeString to get deadkeys and keymaps done correctly.
10260 * src/chset.C (encodeString): changed to return a pair, to tell
10261 what to use if we know the string.
10263 * src/lyxscreen.h (fillArc): new function.
10265 * src/FontInfo.C (resize): rewritten to use more std::string like
10266 structore, especially string::replace.
10268 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
10271 * configure.in (chmod +x some scripts): remove config/gcc-hack
10273 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10275 * src/buffer.C (writeFile): change once again the top comment in a
10276 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
10277 instead of an hardcoded version number.
10278 (makeDocBookFile): ditto
10280 * src/version.h: add new define LYX_DOCVERSION
10282 * po/de.po: update from Pit Sütterlin
10283 * lib/bind/de_menus.bind: ditto.
10285 * src/lyxfunc.C (Dispatch): call MenuExport()
10286 * src/buffer.C (Dispatch): ditto
10288 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
10289 LyXFunc::Dispatch().
10290 (MenuExport): new function, moved from
10291 LyXFunc::Dispatch().
10293 * src/trans_mgr.C (insert): small cleanup
10294 * src/chset.C (loadFile): ditto
10296 * lib/kbd/iso8859-1.cdef: add missing backslashes
10298 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
10300 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
10301 help with placing the manually drawn accents better.
10303 (Draw): x2 and hg changed to float to minimize rounding errors and
10304 help place the accents better.
10306 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
10307 unsigned short to char is just wrong...cast the char to unsigned
10308 char instead so that the two values can compare sanely. This
10309 should also make the display of insetlatexaccents better and
10310 perhaps also some other insets.
10312 (lbearing): new function
10315 1999-12-15 Allan Rae <rae@lyx.org>
10317 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
10318 header that provides a wrapper around the very annoying SGI STL header
10321 * src/support/lyxstring.C, src/LString.h:
10322 removed old SGI-STL-compatability attempts.
10324 * configure.in: Use LYX_STL_STRING_FWD.
10326 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
10327 stl_string_fwd.h is around and try to determine it's location.
10328 Major improvement over previous SGI STL 3.2 compatability.
10329 Three small problems remain with this function due to my zero
10330 knowledge of autoconf. JMarc and lgb see the comments in the code.
10332 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10334 * src/broken_const.h, config/hack-gcc, config/README: removed
10336 * configure.in: remove --with-gcc-hack option; do not call
10339 * INSTALL: remove documentation of --with-broken-const and
10342 * acconfig.h: remove all trace of BROKEN_CONST define
10344 * src/buffer.C (makeDocBookFile): update version number in output
10346 (SimpleDocBookOnePar): fix an assert when trying to a character
10347 access beyond string length
10350 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10352 * po/de.po: fix the Export menu
10354 * lyx.man: update the description of -dbg
10356 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
10357 (commandLineHelp): updated
10358 (easyParse): show list of available debug levels if -dbg is passed
10361 * src/Makefile.am: add debug.C
10363 * src/debug.h: moved some code to debug.C
10365 * src/debug.C: new file. Contains code to set and show debug
10368 * src/layout.C: remove 'break' after 'continue' in switch
10369 statements, since these cannot be reached.
10371 1999-12-13 Allan Rae <rae@lyx.org>
10373 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
10374 (in_word_set): hash() -> math_hash()
10376 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
10378 * acconfig.h: Added a test for whether we are using exceptions in the
10379 current compilation run. If so USING_EXCEPTIONS is defined.
10381 * config.in: Check for existance of stl_string_fwd.h
10382 * src/LString.h: If compiling --with-included-string and SGI's
10383 STL version 3.2 is present (see above test) we need to block their
10384 forward declaration of string and supply a __get_c_string().
10385 However, it turns out this is only necessary if compiling with
10386 exceptions enabled so I've a bit more to add yet.
10388 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
10389 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
10390 src/support/LRegex.h, src/undo.h:
10391 Shuffle the order of the included files a little to ensure that
10392 LString.h gets included before anything that includes stl_string_fwd.h
10394 * src/support/lyxstring.C: We need to #include LString.h instead of
10395 lyxstring.h to get the necessary definition of __get_c_string.
10396 (__get_c_string): New function. This is defined static just like SGI's
10397 although why they need to do this I'm not sure. Perhaps it should be
10398 in lstrings.C instead.
10400 * lib/templates/IEEEtran.lyx: New template file.
10402 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10404 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
10405 * intl/Makefile.in (MKINSTALLDIRS): ditto
10407 * src/LyXAction.C (init): changed to hold the LFUN data in a
10408 automatic array in stead of in callso to newFunc, this speeds up
10409 compilation a lot. Also all the memory used by the array is
10410 returned when the init is completed.
10412 * a lot of files: compiled with -Wold-style-cast, changed most of
10413 the reported offenders to C++ style casts. Did not change the
10414 offenders in C files.
10416 * src/trans.h (Match): change argument type to unsigned int.
10418 * src/support/DebugStream.C: fix some types on the streambufs so
10419 that it works on a conforming implementation.
10421 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10423 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
10425 * src/support/lyxstring.C: remove the inline added earlier since
10426 they cause a bunch of unsatisfied symbols when linking with dec
10427 cxx. Cxx likes to have the body of inlines at the place where they
10430 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
10431 accessing negative bounds in array. This fixes the crash when
10432 inserting accented characters.
10433 * src/trans.h (Match): ditto
10435 * src/buffer.C (Dispatch): since this is a void, it should not try
10436 to return anything...
10438 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10440 * src/buffer.h: removed the two friends from Buffer. Some changes
10441 because of this. Buffer::getFileName and Buffer::setFileName
10442 renamed to Buffer::fileName() and Buffer::fileName(...).
10444 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10446 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
10447 and Buffer::update(short) to BufferView. This move is currently
10448 controlled by a define MOVE_TEXT, this will be removed when all
10449 shows to be ok. This move paves the way for better separation
10450 between buffer contents and buffer view. One side effect is that
10451 the BufferView needs a rebreak when swiching buffers, if we want
10452 to avoid this we can add a cache that holds pointers to LyXText's
10453 that is not currently in use.
10455 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
10458 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
10460 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
10462 * lyx_main.C: new command line option -x (or --execute) and
10463 -e (or --export). Now direct conversion from .lyx to .tex
10464 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
10465 Unfortunately, X is still needed and the GUI pops up during the
10468 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10470 * src/Spacing.C: add a using directive to bring stream stuff into
10472 * src/paragraph.C: ditto
10473 * src/buffer.C: ditto
10475 * NEWS: updated a bit the new features of 1.1.3 (took a few things
10476 from Lars' announcement).
10478 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
10479 example files from Tino Meinen.
10481 1999-12-06 Allan Rae <rae@lyx.org>
10483 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
10485 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
10487 * src/support/lyxstring.C: added a lot of inline for no good
10490 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
10491 latexWriteEndChanges, they were not used.
10493 * src/layout.h (operator<<): output operator for PageSides
10495 * src/mathed/math_iter.C (my_memcpy): slightly changed.
10497 * some example files: loaded in LyX 1.0.4 and saved again to update
10498 certain constructs (table format)
10500 * a lot of files: did the change to use fstream/iostream for all
10501 writing of files. Done with a close look at Andre Poenitz's patch.
10503 * some files: whitespace changes.
10505 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10507 * src/mathed/math_iter.C (my_memcpy): new function. Since the
10508 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
10509 architecture, we provide our own. It is used unconditionnally, but
10510 I do not think this is a performance problem. Thanks to Angus
10511 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
10512 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
10514 (GetInset): use my_memcpy.
10518 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
10519 it is easier to understand, but it uses less TeX-only constructs now.
10521 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
10522 elements contain spaces
10524 * lib/configure: regenerated
10526 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
10527 elements contain spaces; display the list of programs that are
10530 * autogen.sh: make sure lib/configure is executable
10532 * lib/examples/*: rename the tutorial examples to begin with the
10533 two-letters language code.
10535 * src/lyxfunc.C (getStatus): do not query current font if no
10538 * src/lyx_cb.C (RunScript): use QuoteName
10539 (MenuRunDvips): ditto
10540 (PrintApplyCB): ditto
10542 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
10543 around argument, so that it works well with the current shell.
10544 Does not work properly with OS/2 shells currently.
10546 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
10547 * src/LyXSendto.C (SendtoApplyCB): ditto
10548 * src/lyxfunc.C (Dispatch): ditto
10549 * src/buffer.C (runLaTeX): ditto
10550 (runLiterate): ditto
10551 (buildProgram): ditto
10553 * src/lyx_cb.C (RunScript): ditto
10554 (MenuMakeLaTeX): ditto
10556 * src/buffer.h (getLatexName): new method
10558 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
10560 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10562 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
10563 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
10564 (create_math_panel): ditto
10566 * src/lyxfunc.C (getStatus): re-activate the code which gets
10567 current font and cursor; add test for export to html.
10569 * src/lyxrc.C (read): remove unreachable break statements; add a
10572 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
10574 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10576 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
10577 introduced by faulty regex.
10578 * src/buffer.C: ditto
10579 * src/lastfiles.C: ditto
10580 * src/paragraph.C: ditto
10581 * src/table.C: ditto
10582 * src/vspace.C: ditto
10583 * src/insets/figinset.C: ditto
10584 Note: most of these is absolutely harmless, except the one in
10585 src/mathed formula.C.
10587 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
10589 * src/ImportNoweb.C (documentclass): fixed bounds for substr
10590 operation, yielding correct results for the reLyX command.
10592 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10594 * src/support/filetools.C (ExpandPath): removed an over eager
10596 (ReplaceEnvironmentPath): ditto
10598 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
10599 shows that we are doing something fishy in our code...
10600 (BubblePost): ditto
10603 * src/lyxrc.C (read): use a double switch trick to get more help
10604 from the compiler. (the same trick is used in layout.C)
10605 (write): new function. opens a ofstream and pass that to output
10606 (output): new function, takes a ostream and writes the lyxrc
10607 elemts to it. uses a dummy switch to make sure no elements are
10610 * src/lyxlex.h: added a struct pushpophelper for use in functions
10611 with more than one exit point.
10613 * src/lyxlex.[Ch] (GetInteger): made it const
10617 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
10619 * src/layout.[hC] : LayoutTags splitted into several enums, new
10620 methods created, better error handling cleaner use of lyxlex. Read
10623 * src/bmtable.[Ch]: change some member prototypes because of the
10624 image const changes.
10626 * commandtags.h, src/LyXAction.C (init): new function:
10627 "preferences-save", saves the lyxrc entries into .lyx/preferences.
10628 This file is not read automatically but you can add \input
10629 preferences to your lyxrc if you want to. We need to discuss how
10632 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
10633 in .aux, also remove .bib and .bst files from dependencies when
10636 * src/BufferView.C, src/LyXView.C: add const_cast several places
10637 because of changes to images.
10639 * lib/images/*: same change as for images/*
10641 * lib/lyxrc.example: Default for accept_compound is false not no.
10643 * images/*: changed to be const, however I have som misgivings
10644 about this change so it might be changed back.
10646 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10648 * lib/configure, po/POTFILES.in: regenerated
10650 * autogen.sh: autogenerate lib/configure from lib/configure.m4
10652 * config/lib_configure.m4: removed
10654 * lib/configure.m4: new file (was config/lib_configure.m4)
10656 * configure.in: do not test for rtti, since we do not use it.
10658 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
10660 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
10661 doubling of allocated space scheme. This makes it faster for large
10662 strings end to use less memory for small strings. xtra rememoved.
10664 * src/insets/figinset.C (waitalarm): commented out.
10665 (GhostscriptMsg): use static_cast
10666 (GhostscriptMsg): use new instead of malloc to allocate memory for
10667 cmap. also delete the memory after use.
10669 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
10671 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
10672 for changes in bibtex database or style.
10673 (runBibTeX): remove all .bib and .bst files from dep before we
10675 (run): use scanAuc in when dep file already exist.
10677 * src/DepTable.C (remove_files_with_extension): new method
10678 (exist): new method
10680 * src/DepTable.[Ch]: made many of the methods const.
10682 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10684 * src/bufferparams.C: make sure that the default textclass is
10685 "article". It used to be the first one by description order, but
10686 now the first one is "docbook".
10688 * src/lyx_main.C (setDebuggingLevel): change type of argument to
10689 string; call Debug::value.
10690 (easyParse): pass complete argument to setDebuggingLevel().
10692 * src/debug.h (value): fix the code that parses debug levels.
10694 * src/debug.h: add new debug type ACTION, reserved for LyXAction
10697 * src/LyXAction.C: use Debug::ACTION as debug channel.
10699 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
10701 * NEWS: updated for the future 1.1.3 release.
10703 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
10704 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
10705 it should. This is of course a controversial change (since many
10706 people will find that their lyx workscreen is suddenly full of
10707 red), but done for the sake of correctness.
10709 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
10710 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
10712 * src/insets/inseterror.h, src/insets/inseturl.h,
10713 src/insets/insetinfo.h, src/insets/figinset.h,
10714 src/mathed/formulamacro.h, src/mathed/math_macro.h
10715 (EditMessage): add a missing const and add _() to make sure that
10716 translation happens
10718 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
10719 src/insets/insetbib.C, src/support/filetools.C: add `using'
10720 directives for cxx.
10722 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
10723 doing 'Insert index of last word' at the beginning of a paragraph.
10725 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10727 * several files: white-space changes.
10729 * src/mathed/formula.C: removed IsAlpha and IsDigit
10731 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
10732 .bib file. use a ifstream instead of FilePtr when parsing the .bib
10735 * src/insets/figinset.C (GetPSSizes): don't break when
10736 "EndComments" is seen. But break when a boundingbox is read.
10738 * all classes inherited from Inset: return value of Clone
10739 changed back to Inset *.
10741 * all classes inherited form MathInset: return value of Clone
10742 changed back to MathedInset *.
10744 * src/insets/figinset.C (runqueue): use a ofstream to output the
10745 gs/ps file. Might need some setpresicion or setw. However I can
10746 see no problem with the current code.
10747 (runqueue): use sleep instead of the alarm/signal code. I just
10748 can't see the difference.
10750 * src/paragraph.C (LyXParagraph): reserve space in the new
10751 paragraph and resize the inserted paragraph to just fit.
10753 * src/lyxfunc.h (operator|=): added operator for func_status.
10755 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
10756 check for readable file.
10758 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
10759 check for readable file.
10760 (MenuMakeLinuxDoc): ditto
10761 (MenuMakeDocBook): ditto
10762 (MenuMakeAscii): ditto
10763 (InsertAsciiFile): split the test for openable and readable
10765 * src/bmtable.C (draw_bitmaptable): use
10766 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
10768 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
10769 findtexfile from LaTeX to filetools.
10771 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
10772 instead of FilePtr. Needs to be verified by a literate user.
10774 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10776 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
10777 (EditMessage): likewise.
10779 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
10780 respectively as \textasciitilde and \textasciicircum.
10782 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10784 * src/support/lyxstring.h: made the methods that take iterators
10785 use const_iterator.
10787 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
10788 (regexMatch): made is use the real regex class.
10790 * src/support/Makefile.am: changed to use libtool
10792 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
10794 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
10796 (MathIsInset ++): changed several macros to be inline functions
10799 * src/mathed/Makefile.am: changed to use libtool
10801 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
10803 * src/insets/inset* : Clone changed to const and return type is
10804 the true insettype not just Inset*.
10806 * src/insets/Makefile.am: changed to use libtool
10808 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
10810 * src/undo.[Ch] : added empty() and changed some of the method
10813 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
10815 * src/lyxparagraph.h: use id() and id(...) instead of getID and
10816 setID use block<> for the bullets array, added const several places.
10818 * src/lyxfunc.C (getStatus): new function
10820 * src/lyxfunc.[Ch] : small changes to take advantage of the new
10821 LyXAction, added const to several funtions.
10823 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
10824 a std::map, and to store the dir items in a vector.
10826 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
10829 * src/LyXView.[Ch] + other files : changed currentView to view.
10831 * src/LyXAction.[Ch] : ported from the old devel branch.
10833 * src/.cvsignore: added .libs and a.out
10835 * configure.in : changes to use libtool.
10837 * acinclude.m4 : inserted libtool.m4
10839 * .cvsignore: added libtool
10841 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10843 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
10844 file name in insets and mathed directories (otherwise the
10845 dependency is not taken in account under cygwin).
10847 * src/text2.C (InsertString[AB]): make sure that we do not try to
10848 read characters past the string length.
10850 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10852 * lib/doc/LaTeXConfig.lyx.in,
10853 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
10855 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
10856 file saying who created them and when this heppened; this is
10857 useless and annoys tools like cvs.
10859 * lib/layouts/g-brief-{en,de}.layout,
10860 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
10861 from Thomas Hartkens <thomas@hartkens.de>.
10863 * src/{insets,mathed}/Makefile.am: do not declare an empty
10864 LDFLAGS, so that it can be set at configure time (useful on Irix
10867 * lib/reLyX/configure.in: make sure that the prefix is set
10868 correctly in LYX_DIR.
10870 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
10872 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
10873 be used by 'command-sequence' this allows to bind a key to a
10874 sequence of LyX-commands
10875 (Example: 'command-sequence math-insert alpha; math-insert beta;")
10877 * src/LyXAction.C: add "command-sequence"
10879 * src/LyXFunction.C: handling of "command-sequence"
10881 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
10882 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
10884 * src/lyxserver.C, src/minibuffer.C: Use this new interface
10886 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10888 * src/buffer.C (writeFile): Do not output a comment giving user
10889 and date at the beginning of a .lyx file. This is useless and
10890 annoys cvs anyway; update version number to 1.1.
10892 * src/Makefile.am (LYX_DIR): add this definition, so that a
10893 default path is hardcoded in LyX.
10895 * configure.in: Use LYX_GNU_GETTEXT.
10897 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
10898 AM_GNU_GETTEXT with a bug fixed.
10900 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
10902 * src/chset.C: add "using std::ifstream;" to please dec cxx.
10904 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
10905 which is used to point to LyX data is now LYX_DIR_11x.
10907 * lyx.man: convert to a unix text file; small updates.
10909 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
10911 * src/support/LSubstring.[Ch]: made the second arg of most of the
10912 constructors be a const reference.
10914 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
10917 * src/support/lyxstring.[Ch] (swap): added missing member function
10918 and specialization of swap(str, str);
10920 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
10922 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
10923 trace of the old one.
10925 * src/undo.[Ch]: made the undostack use std::list to store undo's in
10926 put the member definitions in undo.C.
10928 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
10929 NEW_TEXT and have now only code that was included when this was
10932 * src/intl.C (LCombo): use static_cast
10934 (DispatchCallback): ditto
10936 * src/definitions.h: removed whole file
10938 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
10940 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
10941 parsing and stores in a std:map. a regex defines the file format.
10942 removed unneeded members.
10944 * src/bufferparams.h: added several enums from definitions.h here.
10945 Removed unsused destructor. Changed some types to use proper enum
10946 types. use block to have the temp_bullets and user_defined_bullets
10947 and to make the whole class assignable.
10949 * src/bufferparams.C (Copy): removed this functions, use a default
10950 assignment instead.
10952 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
10955 * src/buffer.C (readLyXformat2): commend out all that have with
10956 oldpapersize to do. also comment out all that hve to do with
10957 insetlatex and insetlatexdel.
10958 (setOldPaperStuff): commented out
10960 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
10962 * src/LyXAction.C: remove use of inset-latex-insert
10964 * src/mathed/math_panel.C (button_cb): use static_cast
10966 * src/insets/Makefile.am (insets_o_SOURCES): removed
10969 * src/support/lyxstring.C (helper): use the unsigned long
10970 specifier, UL, instead of a static_cast.
10972 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
10974 * src/support/block.h: new file. to be used as a c-style array in
10975 classes, so that the class can be assignable.
10977 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10979 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
10980 NULL, make sure to return an empty string (it is not possible to
10981 set a string to NULL).
10983 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10985 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
10987 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
10989 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
10990 link line, so that Irix users (for example) can set it explicitely to
10993 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
10994 it can be overidden at make time (static or dynamic link, for
10997 * src/vc-backend.C, src/LaTeXFeatures.h,
10998 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
10999 statements to bring templates to global namespace.
11001 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
11003 * src/support/lyxstring.C (operator[] const): make it standard
11006 * src/minibuffer.C (Init): changed to reflect that more
11007 information is given from the lyxvc and need not be provided here.
11009 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
11011 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
11013 * src/LyXView.C (UpdateTimerCB): use static_cast
11014 (KeyPressMask_raw_callback): ditto
11016 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
11017 buffer_, a lot of changes because of this. currentBuffer() ->
11018 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
11019 also changes to other files because of this.
11021 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
11023 * src/vc-backend.[Ch]: new files. The backends for vc handling,
11024 have no support for RCS and partial support for CVS, will be
11027 * src/insets/ several files: changes because of function name
11028 changes in Bufferview and LyXView.
11030 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
11032 * src/support/LSubstring.[Ch]: new files. These implement a
11033 Substring that can be very convenient to use. i.e. is this
11035 string a = "Mary had a little sheep";
11036 Substring(a, "sheep") = "lamb";
11037 a is now "Mary has a little lamb".
11039 * src/support/LRegex.[Ch]: a regex class that can be used to pick
11040 out patterns and subpatterns of strings. It is used by LSubstring
11041 and also by vc-backend.C
11043 * src/support/lyxstring.C: went over all the assertions used and
11044 tried to correct the wrong ones and flag which of them is required
11045 by the standard. some bugs found because of this. Also removed a
11046 couple of assertions.
11048 * src/support/Makefile.am (libsupport_a_SOURCES): added
11049 LSubstring.[Ch] and LRegex.[Ch]
11051 * src/support/FileInfo.h: have struct stat buf as an object and
11052 not a pointer to one, some changes because of this.
11054 * src/LaTeXFeatures.C (getTClassPreamble): also use the
11055 information in layout when adding the layouts preamble to the
11056 textclass preamble.
11058 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
11061 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
11062 because of bug in OS/2.
11064 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11066 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
11067 \verbatim@font instead of \ttfamily, so that it can be redefined.
11069 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
11070 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
11071 src/layout.h, src/text2.C: add 'using' directive to bring the
11072 STL templates we need from the std:: namespace to the global one.
11073 Needed by DEC cxx in strict ansi mode.
11075 * src/support/LIstream.h,src/support/LOstream.h,
11076 src/support/lyxstring.h,src/table.h,
11077 src/lyxlookup.h: do not include <config.h> in header
11078 files. This should be done in the .C files only.
11080 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
11084 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11086 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
11087 from Kayvan to fix the tth invokation.
11089 * development/lyx.spec.in: updates from Kayvan to reflect the
11090 changes of file names.
11092 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
11094 * src/text2.C (InsertStringB): use std::copy
11095 (InsertStringA): use std::copy
11097 * src/bufferlist.C: use a vector to store the buffers in. This is
11098 an internal change and should not affect any other thing.
11100 * src/BufferView.C (waitForX): use XSync instead of the lengthy
11103 * src/text.C (Fill): fix potential bug, one off bug.
11105 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
11107 * src/Makefile.am (lyx_main.o): add more files it depends on.
11109 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
11111 * src/support/lyxstring.C: use size_t for the reference count,
11112 size, reserved memory and xtra.
11113 (internal_compare): new private member function. Now the compare
11114 functions should work for std::strings that have embedded '\0'
11116 (compare): all compare functions rewritten to use
11119 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
11121 * src/support/lyxstring.C (compare): pass c_str()
11122 (compare): pass c_str
11123 (compare): pass c_str
11125 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11127 * src/support/DebugStream.C: <config.h> was not included correctly.
11129 * lib/configure: forgot to re-generate it :( I'll make this file
11130 auto generated soon.
11132 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
11134 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
11137 * src/support/lyxstring.C: some changes from length() to rep->sz.
11138 avoids a function call.
11140 * src/support/filetools.C (SpaceLess): yet another version of the
11141 algorithm...now per Jean-Marc's suggestions.
11143 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11145 * src/layout.C (less_textclass_desc): functor for use in sorting
11147 (LyXTextClass::Read): sort the textclasses after reading.
11149 * src/support/filetools.C (SpaceLess): new version of the
11150 SpaceLess functions. What problems does this one give? Please
11153 * images/banner_bw.xbm: made the arrays unsigned char *
11155 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11157 * src/support/lyxstring.C (find): remove bogus assertion in the
11158 two versions of find where this has not been done yet.
11160 * src/support/lyxlib.h: add missing int return type to
11163 * src/menus.C (ShowFileMenu): disable exporting to html if no
11164 html export command is present.
11166 * config/lib_configure.m4: add a test for an HTML converter. The
11167 programs checked for are, in this order: tth, latex2html and
11170 * lib/configure: generated from config/lib_configure.m4.
11172 * src/lyxfunc.C (Dispatch): update and improve the execution of an
11173 html converter. The parameters are now passed through $$FName and
11174 $$OutName, instead of standard input/output.
11176 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
11178 * lib/lyxrc.example: update description of \html_command.
11179 add "quotes" around \screen_font_xxx font setting examples to help
11180 people who use fonts with spaces in their names.
11182 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11184 * Distribution files: updates for v1.1.2
11186 * src/support/lyxstring.C (find): remove bogus assert and return
11187 npos for the same condition.
11189 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11191 * added patch for OS/2 from SMiyata.
11193 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
11195 * src/text2.C (CutSelection): make space_wrapped a bool
11196 (CutSelection): dont declare int i until we have to.
11197 (alphaCounter): return a char const *.
11199 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11201 * src/support/syscall.C (Systemcalls::kill):
11202 src/support/filetools.C (PutEnv, PutEnvPath):
11203 src/lyx_cb.C (addNewlineAndDepth):
11204 src/FontInfo.C (FontInfo::resize): condition some #warning
11205 directives with WITH_WARNINGS.
11208 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
11210 * src/layout.[Ch] + several files: access to class variables
11211 limited and made accessor functions instead a lot of code changed
11212 becuase of this. Also instead of returning pointers often a const
11213 reference is returned instead.
11215 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
11217 * src/Makefile.am (dist-hook): added used to remove the CVS from
11218 cheaders upon creating a dist
11219 (EXTRA_DIST): added cheaders
11221 * src/support/lstrings.C (tostr(char)): fix it to handle param as
11222 a character not as a small integer.
11224 * src/support/lyxstring.C (find): removed Assert and added i >=
11225 rep->sz to the first if.
11227 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
11229 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
11230 src/LyXView.C src/buffer.C src/bufferparams.C
11231 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
11232 src/text2.C src/insets/insetinclude.C:
11233 lyxlayout renamed to textclasslist.
11235 * src/layout.C: some lyxerr changes.
11237 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
11238 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
11239 (LyXLayoutList): removed all traces of this class.
11240 (LyXTextClass::Read): rewrote LT_STYLE
11241 (LyXTextClass::hasLayout): new function
11242 (LyXTextClass::GetLayout): rewritten to return an iterator + has
11243 both const and nonconst version.
11244 (LyXTextClass::delete_layout): new function.
11245 (LyXTextClassList::Style): bug fix. do the right thing if layout
11247 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
11248 (LyXTextClassList::NameOfLayout): ditto
11249 (LyXTextClassList::Load): ditto
11251 * src/buffer.C (makeLaTeXFile): new access to layoutlist
11253 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
11255 * src/LyXAction.C (LookupFunc): added a workaround for sun
11256 compiler, on the other hand...we don't know if the current code
11257 compiles on sun at all...
11259 * src/support/filetools.C (CleanupPath): subst fix
11261 * src/insets/insetbib.C (delDatabase): subst fix, this looks
11264 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
11265 complained about this one?
11267 * src/insets/insetinclude.C (Latex): subst fix
11269 * src/insets/insetbib.C (getKeys): subst fix
11271 * src/LyXSendto.C (SendtoApplyCB): subst fix
11273 * src/lyx_main.C (init): subst fix
11275 * src/layout.C (Read): subst fix
11277 * src/lyx_sendfax_main.C (button_send): subst fix
11279 * src/buffer.C (RoffAsciiTable): subst fix
11281 * src/lyx_cb.C (MenuFax): subst fix
11282 (PrintApplyCB): subst fix
11284 1999-10-26 Juergen Vigna <jug@sad.it>
11286 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
11288 (Read): Cleaned up this code so now we read only format vestion >= 5
11290 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
11292 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
11293 come nobody has complained about this one?
11295 * src/insets/insetinclude.C (Latex): subst fix
11297 * src/insets/insetbib.C (getKeys): subst fix
11299 * src/lyx_main.C (init): subst fix
11301 * src/layout.C (Read): subst fix
11303 * src/buffer.C (RoffAsciiTable): subst fix
11305 * src/lyx_cb.C (MenuFax): subst fix.
11307 * src/layout.[hC] + some other files: rewrote to use
11308 std::container to store textclasses and layouts in.
11309 Simplified, removed a lot of code. Make all classes
11310 assignable. Further simplifications and review of type
11311 use still to be one.
11313 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
11314 lastfiles to create the lastfiles partr of the menu.
11316 * src/lastfiles.[Ch]: rewritten to use deque to store the
11317 lastfiles in. Uses fstream for reading and writing. Simplifies
11320 * src/support/syscall.C: remove explicit cast.
11322 * src/BufferView.C (CursorToggleCB): removed code snippets that
11323 were commented out.
11324 use explicat C++ style casts instead of C style casts. also use
11325 u_vdata instea of passing pointers in longs.
11327 * src/PaperLayout.C: removed code snippets that were commented out.
11329 * src/lyx_gui_misc.C: removed code snippets that were commented out.
11331 * src/lyx_main.C: removed code snippets that wer commented out.
11333 * src/paragraph.C: removed code snippets that were commented out.
11335 * src/lyxvc.C (logClose): use static_cast
11337 (viewLog): remove explicit cast to void*
11338 (showLog): removed old commented code
11340 * src/menus.C: use static_cast instead of C style casts. use
11341 u_vdata instead of u_ldata. remove explicit cast to (long) for
11342 pointers. Removed old code that was commented out.
11344 * src/insets/inset.C: removed old commented func
11346 * src/insets/insetref.C (InsetRef): removed old code that had been
11347 commented out for a long time.
11349 (escape): removed C style cast
11351 * src/insets/insetlatexaccent.C (Draw): removed old commented code
11353 * src/insets/insetlatex.C (Draw): removed old commented code
11354 (Read): rewritten to use string
11356 * src/insets/insetlabel.C (escape): removed C style cast
11358 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
11360 * src/insets/insetindex.C: use static_cast and u_vdata, removed
11361 old commented code.
11363 * src/insets/insetinclude.h: removed a couple of stupid bools
11365 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
11366 (Clone): remove C style cast
11367 (getKeys): changed list to lst because of std::list
11369 * src/insets/inseterror.C (Draw): removed som old commented code.
11371 * src/insets/insetcommand.C (Draw): removed some old commented code.
11373 * src/insets/insetbib.C (bibitem_cb): removed code that has been
11374 commented out forever.
11375 (bibitem_cb): use static_cast instead of C style cast
11376 use of vdata changed to u_vdata.
11378 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
11380 (CloseUrlCB): use static_cast instead of C style cast.
11381 (CloseUrlCB): added a fl_free form...it seemed to be missing.
11383 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
11384 (C_InsetInfo_CloseInfoCB): forward the ob parameter
11385 (CloseInfoCB): static_cast from ob->u_vdata instead.
11386 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
11389 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
11390 (C_InsetError_CloseErrorCB): forward the ob parameter
11391 (CloseErrorCB): static_cast from ob->u_vdata instead.
11393 * src/vspace.h: include LString.h since we use string in this class.
11395 * src/vspace.C (lyx_advance): changed name from advance because of
11396 nameclash with stl. And since we cannot use namespaces yet...I
11397 used a lyx_ prefix instead. Expect this to change when we begin
11400 * src/BufferView.[Ch] (BufferView::~BufferView): removed
11402 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
11403 and removed now defunct constructor and deconstructor.
11405 * src/BufferView.h: have backstack as a object not as a pointer.
11406 removed initialization from constructor. added include for BackStack
11408 * development/lyx.spec.in (%build): add CFLAGS also.
11410 * src/screen.C (drawFrame): removed another warning.
11412 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11414 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
11415 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
11416 README and ANNOUNCE a bit for the next release. More work is
11419 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
11420 unbreakable if we are in freespacing mode (LyX-Code), but not in
11423 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
11425 * src/BackStack.h: fixed initialization order in constructor
11427 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
11429 * acinclude.m4 (VERSION): new rules for when a version is
11430 development, added also a variable for prerelease.
11431 (warnings): we set with_warnings=yes for prereleases
11432 (lyx_opt): prereleases compile with same optimization as development
11433 (CXXFLAGS): only use pedantic if we are a development version
11435 * src/BufferView.C (restorePosition): don't do anything if the
11436 backstack is empty.
11438 * src/BackStack.h: added member empty, use this to test if there
11439 is anything to pop...
11441 1999-10-25 Juergen Vigna <jug@sad.it>
11444 * forms/layout_forms.fd +
11445 * forms/latexoptions.fd +
11446 * lyx.fd: changed for various form resize issues
11448 * src/mathed/math_panel.C +
11449 * src/insets/inseterror.C +
11450 * src/insets/insetinfo.C +
11451 * src/insets/inseturl.C +
11452 * src/insets/inseturl.h +
11454 * src/LyXSendto.C +
11455 * src/PaperLayout.C +
11456 * src/ParagraphExtra.C +
11457 * src/TableLayout.C +
11459 * src/layout_forms.C +
11466 * src/menus.C: fixed various resize issues. So now forms can be
11467 resized savely or not be resized at all.
11469 * forms/form_url.fd +
11470 * src/insets/form_url.[Ch]: added because it's cleaner and easier
11473 * src/insets/Makefile.am: added files form_url.[Ch]
11475 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11477 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
11478 (and presumably 6.2).
11480 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
11481 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
11482 remaining static member callbacks.
11484 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
11487 * src/support/lyxstring.h: declare struct Srep as friend of
11488 lyxstring, since DEC cxx complains otherwise.
11490 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11492 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11494 * src/LaTeX.C (run): made run_bibtex also depend on files with
11496 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
11497 are put into the dependency file.
11499 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
11500 the code has shown itself to work
11501 (create_ispell_pipe): removed another warning, added a comment
11504 * src/minibuffer.C (ExecutingCB): removed code that has been
11505 commented out a long time
11507 * src/lyxfunc.C (processKeyEvent): removed some very old commented
11508 out code + a warning.
11510 * src/support/lyxstring.h: comment out the three private
11511 operators, when compiling with string ansi conforming compilers
11512 they make problems.
11514 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
11516 (pixmapFromBitmapData): change type of bdata to be unsigned char *
11517 (pixmapFromBitmapData): add a reinterpret_cast in the call to
11520 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
11523 * src/mathed/math_panel.C (create_math_panel): remove explicit
11526 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
11529 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
11530 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
11531 to XCreatePixmapFromBitmapData
11532 (fl_set_bmtable_data): change the last argument to be unsigned
11534 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
11535 and bh to be unsigned int, remove explicit casts in call to
11536 XReadBitmapFileData.
11538 * images/arrows.xbm: made the arrays unsigned char *
11539 * images/varsz.xbm: ditto
11540 * images/misc.xbm: ditto
11541 * images/greek.xbm: ditto
11542 * images/dots.xbm: ditto
11543 * images/brel.xbm: ditto
11544 * images/bop.xbm: ditto
11546 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
11548 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
11549 (LYX_PROG_CXX): added -pedantic to g++ compile options when
11550 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
11552 (LYX_CXX_CHEADERS): added <clocale> to the test.
11554 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
11556 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
11558 * src/support/lyxstring.C (append): fixed something that must be a
11559 bug, rep->assign was used instead of rep->append.
11561 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
11564 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
11565 lyx insert double chars. Fix spotted by Kayvan.
11567 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
11569 * Fixed the tth support. I messed up with the Emacs patch apply feature
11570 and omitted the changes in lyxrc.C.
11572 1999-10-22 Juergen Vigna <jug@sad.it>
11574 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
11576 * src/lyx_cb.C (MenuInsertRef) +
11577 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
11578 the form cannot be resized under it limits (fixes a segfault)
11580 * src/lyx.C (create_form_form_ref) +
11581 * forms/lyx.fd: Changed Gravity on name input field so that it is
11584 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11586 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
11587 <ostream> and <istream>.
11589 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
11590 whether <fstream> provides the latest standard features, or if we
11591 have an oldstyle library (like in egcs).
11592 (LYX_CXX_STL_STRING): fix the test.
11594 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
11595 code on MODERN_STL_STREAM.
11597 * src/support/lyxstring.h: use L{I,O}stream.h.
11599 * src/support/L{I,O}stream.h: new files, designed to setup
11600 correctly streams for our use
11601 - includes the right header depending on STL capabilities
11602 - puts std::ostream and std::endl (for LOStream.h) or
11603 std::istream (LIStream.h) in toplevel namespace.
11605 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11607 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
11608 was a bib file that had been changed we ensure that bibtex is run.
11609 (runBibTeX): enhanced to extract the names of the bib files and
11610 getting their absolute path and enter them into the dep file.
11611 (findtexfile): static func that is used to look for tex-files,
11612 checks for absolute patchs and tries also with kpsewhich.
11613 Alternative ways of finding the correct files are wanted. Will
11615 (do_popen): function that runs a command using popen and returns
11616 the whole output of that command in a string. Should be moved to
11619 * src/DepTable.[Ch] (extchanged): new function that returns true if a
11620 file with extension ext has changed.
11622 * src/insets/figinset.C: added ifdef guards around the fl_free
11623 code that jug commented out. Now it is commented out when
11624 compiling with XForms == 0.89.
11626 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
11627 to lyxstring.C, and only keep a forward declaration in
11628 lyxstring.h. Simplifies the header file a bit and should help a
11629 bit on compile time too. Also changes to Srep will not mandate a
11630 recompile of code just using string.
11631 (~lyxstring): definition moved here since it uses srep.
11632 (size): definition moved here since it uses srep.
11634 * src/support/lyxstring.h: removed a couple of "inline" that should
11637 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11639 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
11642 1999-10-21 Juergen Vigna <jug@sad.it>
11644 * src/table.C (SetPWidth): Just a small fix so the alignment is not
11645 set to left if I just remove the width entry (or it is empty).
11647 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
11648 paragraph when having dummy paragraphs.
11650 1999-10-20 Juergen Vigna <jug@sad.it>
11652 * src/insets/figinset.C: just commented some fl_free_form calls
11653 and added warnings so that this calls should be activated later
11654 again. This avoids for now a segfault, but we have a memory leak!
11656 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
11657 'const char * argument' to 'string argument', this should
11658 fix some Asserts() in lyxstring.C.
11660 * src/lyxfunc.h: Removed the function argAsString(const char *)
11661 as it is not used anymore.
11663 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
11665 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
11668 * src/Literate.h: some funcs moved from public to private to make
11669 interface clearer. Unneeded args removed.
11671 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
11673 (scanBuildLogFile): ditto
11675 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
11676 normal TeX Error. Still room for improvement.
11678 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
11680 * src/buffer.C (insertErrors): changes to make the error
11681 desctription show properly.
11683 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
11686 * src/support/lyxstring.C (helper): changed to use
11687 sizeof(object->rep->ref).
11688 (operator>>): changed to use a pointer instead.
11690 * src/support/lyxstring.h: changed const reference & to value_type
11691 const & lets see if that helps.
11693 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
11695 * Makefile.am (rpmdist): fixed to have non static package and
11698 * src/support/lyxstring.C: removed the compilation guards
11700 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
11703 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
11704 conditional compile of lyxstring.Ch
11706 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
11707 stupid check, but it is a lot better than the bastring hack.
11708 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
11710 * several files: changed string::erase into string::clear. Not
11713 * src/chset.C (encodeString): use a char temporary instead
11715 * src/table.C (TexEndOfCell): added tostr around
11716 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
11717 (TexEndOfCell): ditto
11718 (TexEndOfCell): ditto
11719 (TexEndOfCell): ditto
11720 (DocBookEndOfCell): ditto
11721 (DocBookEndOfCell): ditto
11722 (DocBookEndOfCell): ditto
11723 (DocBookEndOfCell): ditto
11725 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
11727 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
11729 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
11730 (MenuBuildProg): added tostr around ret
11731 (MenuRunChktex): added tostr around ret
11732 (DocumentApplyCB): added tostr around ret
11734 * src/chset.C (encodeString): added tostr around t->ic
11736 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
11737 (makeLaTeXFile): added tostr around tocdepth
11738 (makeLaTeXFile): added tostr around ftcound - 1
11740 * src/insets/insetbib.C (setCounter): added tostr around counter.
11742 * src/support/lyxstring.h: added an operator+=(int) to catch more
11745 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
11746 (lyxstring): We DON'T allow NULL pointers.
11748 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11750 * src/mathed/math_macro.C (MathMacroArgument::Write,
11751 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
11752 when writing them out.
11754 * src/LString.C: remove, since it is not used anymore.
11756 * src/support/lyxstring.C: condition the content to
11757 USE_INCLUDED_STRING macro.
11759 * src/mathed/math_symbols.C, src/support/lstrings.C,
11760 src/support/lyxstring.C: add `using' directive to specify what
11761 we need in <algorithm>. I do not think that we need to
11762 conditionalize this, but any thought is appreciated.
11764 * many files: change all callback functions to "C" linkage
11765 functions to please strict C++ compilers like DEC cxx 6.1 in mode
11766 strict_ansi. Those who were static are now global.
11767 The case of callbacks which are static class members is
11768 trickier, since we have to make C wrappers around them (see
11769 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
11770 did not finish this yet, since it defeats the purpose of
11771 encapsulation, and I am not sure what the best route is.
11773 1999-10-19 Juergen Vigna <jug@sad.it>
11775 * src/support/lyxstring.C (lyxstring): we permit to have a null
11776 pointer as assignment value and just don't assign it.
11778 * src/vspace.C (nextToken): corrected this function substituting
11779 find_first(_not)_of with find_last_of.
11781 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
11782 (TableOptCloseCB) (TableSpeCloseCB):
11783 inserted fl_set_focus call for problem with fl_hide_form() in
11786 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11788 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
11791 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11793 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
11794 LyXLex::next() and not eatline() to get its argument.
11796 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
11798 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
11799 instead, use fstreams for io of the depfile, removed unneeded
11800 functions and variables.
11802 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
11803 vector instead, removed all functions and variables that is not in
11806 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
11808 * src/buffer.C (insertErrors): use new interface to TeXError
11810 * Makefile.am (rpmdist): added a rpmdist target
11812 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
11813 per Kayvan's instructions.
11815 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11817 * src/Makefile.am: add a definition for localedir, so that locales
11818 are found after installation (Kayvan)
11820 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
11822 * development/.cvsignore: new file.
11824 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11826 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
11827 C++ compiler provides wrappers for C headers and use our alternate
11830 * configure.in: use LYX_CXX_CHEADERS.
11832 * src/cheader/: new directory, populated with cname headers from
11833 libstdc++-2.8.1. They are a bit old, but probably good enough for
11834 what we want (support compilers who lack them).
11836 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
11837 from includes. It turns out is was stupid.
11839 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
11841 * lib/Makefile.am (install-data-local): forgot a ';'
11842 (install-data-local): forgot a '\'
11843 (libinstalldirs): needed after all. reintroduced.
11845 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
11847 * configure.in (AC_OUTPUT): added lyx.spec
11849 * development/lyx.spec: removed file
11851 * development/lyx.spec.in: new file
11853 * po/*.po: merged with lyx.pot becuase of make distcheck
11855 * lib/Makefile.am (dist-hook): added dist-hook so that
11856 documentation files will be included when doing a make
11857 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
11858 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
11860 more: tried to make install do the right thing, exclude CVS dirs
11863 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
11864 Path would fit in more nicely.
11866 * all files that used to use pathstack: uses now Path instead.
11867 This change was a lot easier than expected.
11869 * src/support/path.h: new file
11871 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
11873 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
11875 * src/support/lyxstring.C (getline): Default arg was given for
11878 * Configure.cmd: removed file
11880 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11882 * src/support/DebugStream.[Ch]: remove the explicit std:: before
11883 streams classes and types, add the proper 'using' statements when
11884 MODERN_STL is defined.
11886 * src/debug.h: move the << operator definition after the inclusion
11889 * src/support/filetools.C: include "LAssert.h", which is needed
11892 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
11895 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
11896 include "debug.h" to define a proper ostream.
11898 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
11900 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
11901 method to the SystemCall class which can kill a process, but it's
11902 not fully implemented yet.
11904 * src/*.C: Changed Systemcalls::Startscript() to startscript()
11906 * src/support/FileInfo.h: Better documentation
11908 * src/lyxfunc.C: Added support for buffer-export html
11910 * src/menus.C: Added Export->As HTML...
11912 * lib/bind/*.bind: Added short-cut for buffer-export html
11914 * src/lyxrc.*: Added support for new \tth_command
11916 * lib/lyxrc.example: Added stuff for new \tth_command
11918 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
11920 * lib/Makefile.am (IMAGES): removed images/README
11921 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
11922 installes in correct place. Check permisions is installed
11925 * src/LaTeX.C: some no-op changes moved declaration of some
11928 * src/LaTeX.h (LATEX_H): changed include guard name
11930 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11932 * lib/reLyX/Makefile.am: install noweb2lyx.
11934 * lib/Makefile.am: install configure.
11936 * lib/reLyX/configure.in: declare a config aux dir; set package
11937 name to lyx (not sure what the best solution is); generate noweb2lyx.
11939 * lib/layouts/egs.layout: fix the bibliography layout.
11941 1999-10-08 Jürgen Vigna <jug@sad.it>
11943 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
11944 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
11945 it returned without continuing to search the path.
11947 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
11949 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
11950 also fixes a bug. It is not allowed to do tricks with std::strings
11951 like: string a("hei"); &a[e]; this will not give what you
11952 think... Any reason for the complexity in this func?
11954 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
11956 * Updated README and INSTALL a bit, mostly to check that my
11957 CVS rights are correctly set up.
11959 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
11961 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
11962 does not allow '\0' chars but lyxstring and std::string does.
11964 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
11966 * autogen.sh (AUTOCONF): let the autogen script create the
11967 POTFILES.in file too. POTFILES.in should perhaps now not be
11968 included in the cvs module.
11970 * some more files changed to use C++ includes instead of C ones.
11972 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
11974 (Reread): added tostr to nlink. buggy output otherwise.
11975 (Reread): added a string() around szMode when assigning to Buffer,
11976 without this I got a log of garbled info strings.
11978 * acconfig.h: commented out the PTR_AS_INT macros. They should not
11981 * I have added several ostream & operator<<(ostream &, some_type)
11982 functions. This has been done to avoid casting and warnings when
11983 outputting enums to lyxerr. This as thus eliminated a lot of
11984 explicit casts and has made the code clearer. Among the enums
11985 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
11986 mathed enums, some font enum the Debug::type enum.
11988 * src/support/lyxstring.h (clear): missing method. equivalent of
11991 * all files that contained "stderr": rewrote constructs that used
11992 stderr to use lyxerr instead. (except bmtable)
11994 * src/support/DebugStream.h (level): and the passed t with
11995 Debug::ANY to avoid spurious bits set.
11997 * src/debug.h (Debug::type value): made it accept strings of the
11998 type INFO,INIT,KEY.
12000 * configure.in (Check for programs): Added a check for kpsewhich,
12001 the latex generation will use this later to better the dicovery of
12004 * src/BufferView.C (create_view): we don't need to cast this to
12005 (void*) that is done automatically.
12006 (WorkAreaButtonPress): removed some dead code.
12008 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12010 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
12011 is not overwritten when translated (David Sua'rez de Lis).
12013 * lib/CREDITS: Added David Sua'rez de Lis
12015 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
12017 * src/bufferparams.C (BufferParams): default input encoding is now
12020 * acinclude.m4 (cross_compiling): comment out macro
12021 LYX_GXX_STRENGTH_REDUCE.
12023 * acconfig.h: make sure that const is not defined (to empty) when
12024 we are compiling C++. Remove commented out code using SIZEOF_xx
12027 * configure.in : move the test for const and inline as late as
12028 possible so that these C tests do not interefere with C++ ones.
12029 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
12030 has not been proven.
12032 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12034 * src/table.C (getDocBookAlign): remove bad default value for
12035 isColumn parameter.
12037 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
12039 (ShowFileMenu2): ditto.
12041 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
12042 of files to ignore.
12044 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
12046 * Most files: finished the change from the old error code to use
12047 DebugStream for all lyxerr debugging. Only minor changes remain
12048 (e.g. the setting of debug levels using strings instead of number)
12050 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
12052 * src/layout.C (Add): Changed to use compare_no_case instead of
12055 * src/FontInfo.C: changed loop variable type too string::size_type.
12057 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
12059 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
12060 set ETAGS_ARGS to --c++
12062 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
12064 * src/table.C (DocBookEndOfCell): commented out two unused variables
12066 * src/paragraph.C: commented out four unused variables.
12068 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
12069 insed a if clause with type string::size_type.
12071 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
12074 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
12076 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
12077 variable, also changed loop to go from 0 to lenght + 1, instead of
12078 -1 to length. This should be correct.
12080 * src/LaTeX.C (scanError): use string::size_type as loop variable
12083 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
12084 (l.896) since y_tmp and row was not used anyway.
12086 * src/insets/insetref.C (escape): use string::size_type as loop
12089 * src/insets/insetquotes.C (Width): use string::size_type as loop
12091 (Draw): use string::size_type as loop variable type.
12093 * src/insets/insetlatexaccent.C (checkContents): use
12094 string::size_type as loop variable type.
12096 * src/insets/insetlabel.C (escape): use string::size_type as loop
12099 * src/insets/insetinfo.C: added an extern for current_view.
12101 * src/insets/insetcommand.C (scanCommand): use string::size_type
12102 as loop variable type.
12104 * most files: removed the RCS tags. With them we had to recompile
12105 a lot of files after a simple cvs commit. Also we have never used
12106 them for anything meaningful.
12108 * most files: tags-query-replace NULL 0. As adviced several plases
12109 we now use "0" instead of "NULL" in our code.
12111 * src/support/filetools.C (SpaceLess): use string::size_type as
12112 loop variable type.
12114 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
12116 * src/paragraph.C: fixed up some more string stuff.
12118 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
12120 * src/support/filetools.h: make modestr a std::string.
12122 * src/filetools.C (GetEnv): made ch really const.
12124 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
12125 made code that used these use max/min from <algorithm> instead.
12127 * changed several c library include files to their equivalent c++
12128 library include files. All is not changed yet.
12130 * created a support subdir in src, put lyxstring and lstrings
12131 there + the extra files atexit, fileblock, strerror. Created
12132 Makefile.am. edited configure.in and src/Makefile.am to use this
12133 new subdir. More files moved to support.
12135 * imported som of the functions from repository lyx, filetools
12137 * ran tags-query-replace on LString -> string, corrected the bogus
12138 cases. Tried to make use of lstrings.[hC], debugged a lot. There
12139 is still some errors in there. This is errors where too much or
12140 too litle get deleted from strings (string::erase, string::substr,
12141 string::replace), there can also be some off by one errors, or
12142 just plain wrong use of functions from lstrings. Viewing of quotes
12145 * LyX is now running fairly well with string, but there are
12146 certainly some bugs yet (see above) also string is quite different
12147 from LString among others in that it does not allow null pointers
12148 passed in and will abort if it gets any.
12150 * Added the revtex4 files I forgot when setting up the repository.
12152 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
12154 * All over: Tried to clean everything up so that only the files
12155 that we really need are included in the cvs repository.
12156 * Switched to use automake.
12157 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
12158 * Install has not been checked.
12160 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
12162 * po/pt.po: Three errors:
12163 l.533 and l.538 format specification error
12164 l. 402 duplicate entry, I just deleted it.